Merge pull request #48 from jakcron/nstool-1.0

Update master to NSTool v1.0.4

lib/libes/libes.vcxproj

@@ -20,7 +20,7 @@
   </ItemGroup>
   <PropertyGroup Label="Globals">
     <ProjectGuid>{7BE99936-0D40-410D-944B-4513C2EFF8DC}</ProjectGuid>
-    <WindowsTargetPlatformVersion>8.1</WindowsTargetPlatformVersion>
+    <WindowsTargetPlatformVersion>10.0.16299.0</WindowsTargetPlatformVersion>
   </PropertyGroup>
   <Import Project="$(VCTargetsPath)\Microsoft.Cpp.Default.props" />
   <PropertyGroup Condition="'$(Configuration)|$(Platform)'=='Debug|Win32'" Label="Configuration">

lib/libfnd/include/fnd/BitMath.h

@@ -1,8 +1,6 @@
 /*
 BitMath.h
 (c) 2018 Jakcron
-
-This is a 0x40 byte header to prepend to raw EXEFS .code binaries that provide enough data to be equivalent to an ELF.
 */
 #pragma once
 
@@ -12,3 +10,5 @@ This is a 0x40 byte header to prepend to raw EXEFS .code binaries that provide e
 // Bit math macros
 #define _BIT(n) BIT(n)
 #define _HAS_BIT(val, bit) (((val) & _BIT(bit)) != 0)
+#define _SET_BIT(val, bit) ((val) |= _BIT(bit))
+#define _BITMASK(width) (_BIT(width)-1)

lib/libfnd/include/fnd/SharedPtr.h

@@ -0,0 +1,141 @@
+#pragma once
+#include <fnd/types.h>
+#include <cstdio>
+
+namespace fnd
+{
+	template <class T>
+	class SharedPtr
+	{
+	public:
+		SharedPtr();
+
+		// constructor for creating owner object
+		SharedPtr(T* ptr);
+
+		// copy constructor
+		SharedPtr(const SharedPtr<T>& other);
+
+		// destructor
+		~SharedPtr();
+
+		// own operator
+		void operator=(T* ptr);
+
+		// copy operator
+		void operator=(const SharedPtr<T>& other);
+
+		// access ptr
+		const T* operator*() const;
+		T* operator*();
+
+	private:
+		T* mPtr;
+		size_t* mRefCnt;
+
+		void deletePtr();
+	};
+
+	template <class T>
+	inline SharedPtr<T>::SharedPtr() :
+		mPtr(nullptr),
+		mRefCnt(new size_t)
+	{
+		*mRefCnt = 0;
+	}
+
+	template <class T>
+	inline SharedPtr<T>::SharedPtr(T* ptr) :
+		SharedPtr()
+	{
+		*this = ptr;
+	}
+
+	template <class T>
+	inline SharedPtr<T>::SharedPtr(const SharedPtr<T>& other) :
+		SharedPtr()
+	{
+		*this = other;
+	}
+
+	template <class T>
+	inline SharedPtr<T>::~SharedPtr()
+	{
+		deletePtr();
+	}
+
+	template <class T>
+	inline void SharedPtr<T>::operator=(T* ptr)
+	{
+		deletePtr();
+		if (ptr != nullptr)
+		{
+			mPtr = ptr;
+			mRefCnt = new size_t;
+			*mRefCnt = 1;
+		}
+		else
+		{
+			mPtr = nullptr;
+			mRefCnt = new size_t;
+			*mRefCnt = 0;
+		}
+		
+	}
+
+	template <class T>
+	inline void SharedPtr<T>::operator=(const SharedPtr<T>& other)
+	{
+		deletePtr();
+
+		mPtr = other.mPtr;
+		mRefCnt = other.mRefCnt;
+		*mRefCnt += 1;
+	}
+
+	template <class T>
+	inline const T* SharedPtr<T>::operator*() const
+	{
+		return mPtr;
+	}
+
+	template <class T>
+	inline T* SharedPtr<T>::operator*()
+	{
+		return mPtr;
+	}
+
+	template <class T>
+	inline void SharedPtr<T>::deletePtr()
+	{
+		// if this is not the last reference
+		if (*mRefCnt > 1)
+		{
+			// decrement reference count
+			*mRefCnt -= 1;
+
+			// make ptrs null
+			mPtr = nullptr;
+			mRefCnt = nullptr;
+		}
+		// if this is the last refeference
+		else if (*mRefCnt == 1)
+		{
+			// delete memory
+			delete mPtr;
+			delete mRefCnt;
+
+			// make ptrs null
+			mPtr = nullptr;
+			mRefCnt = nullptr;
+		}
+		// else if this is an empty refernce
+		else if (*mRefCnt == 0)
+		{
+			delete mRefCnt;
+
+			mPtr = nullptr;
+			mRefCnt = nullptr;
+		}
+	}
+}

lib/libfnd/include/fnd/SimpleTextOutput.h

@@ -1,5 +1,7 @@
 #pragma once
+#include <string>
 #include <fnd/types.h>
+#include <fnd/Vec.h>
 
 namespace fnd
 {
@@ -10,6 +12,9 @@ namespace fnd
 		static void hxdStyleDump(const byte_t* data, size_t len);
 		static void hexDump(const byte_t* data, size_t len, size_t row_len, size_t indent_len);
 		static void hexDump(const byte_t* data, size_t len);
+		static std::string arrayToString(const byte_t* data, size_t len, bool upper_case, const std::string& separator);
+		static void stringToArray(const std::string& str, fnd::Vec<byte_t>& array);
+
 	private:
 		static const size_t kDefaultRowLen = 0x10;
 		static const size_t kDefaultByteGroupingSize = 1;

lib/libfnd/include/fnd/ecdsa.h

@@ -21,8 +21,8 @@ namespace fnd
 
 			void operator=(const sEcdsa240Point& other)
 			{
-				memcpy(this->r, r, kEcdsa240Size);
+				memcpy(this->r, other.r, kEcdsa240Size);
-				memcpy(this->s, s, kEcdsa240Size);
+				memcpy(this->s, other.s, kEcdsa240Size);
 			}
 
 			bool operator==(const sEcdsa240Point& other) const
@@ -43,7 +43,7 @@ namespace fnd
 
 			void operator=(const sEcdsa240PrivateKey& other)
 			{
-				memcpy(this->k, k, kEcdsa240Size);
+				memcpy(this->k, other.k, kEcdsa240Size);
 			}
 
 			bool operator==(const sEcdsa240PrivateKey& other) const
@@ -56,6 +56,28 @@ namespace fnd
 				return !operator==(other);
 			}
 		};
+
+		struct sEcdsa240Key
+		{
+			sEcdsa240Point pub;
+			sEcdsa240PrivateKey pvt;
+
+			void operator=(const sEcdsa240Key& other)
+			{
+				this->pub = other.pub;
+				this->pvt = other.pvt;
+			}
+
+			bool operator==(const sEcdsa240Key& other) const
+			{
+				return this->pub == other.pub && this->pvt == other.pvt;
+			}
+
+			bool operator!=(const sEcdsa240Key& other) const
+			{
+				return !operator==(other);
+			}
+		};
 #pragma pack (pop)
 	}
 }

lib/libfnd/include/fnd/elf.h

@@ -1,216 +1,458 @@
 #pragma once
 #include "types.h"
 
-typedef byte_t Elf_Byte;
+namespace fnd
-typedef word_t Elf32_Addr;
-typedef word_t Elf32_Off;
-typedef long_t Elf32_Sword; // lol "sword"
-typedef word_t Elf32_Word;
-typedef hword_t Elf32_Half;
-
-enum
 {
-	EI_MAG0    = 0, // 0x7F
+	namespace elf
-	EI_MAG1    = 1, // 'E'
+	{
-	EI_MAG2    = 2, // 'L'
+		/* These constants are for the segment types stored in the image headers */
-	EI_MAG3    = 3, // 'F'
+		enum SegmentType
-	EI_CLASS   = 4, // File class
+		{
-	EI_DATA    = 5, // Data encoding
+			PT_NULL = 0,
-	EI_VERSION = 6, // File version
+			PT_LOAD = 1,
-	EI_PAD     = 7, // Start of padding bytes
+			PT_DYNAMIC = 2,
-	EI_NIDENT  = 16 // Size of e_ident[]
+			PT_INTERP = 3,
-};
+			PT_NOTE = 4,
+			PT_SHLIB = 5,
+			PT_PHDR = 6,
+			PT_TLS = 7,               /* Thread local storage segment */
+			PT_LOOS = 0x60000000,      /* OS-specific */
+			PT_HIOS = 0x6fffffff,      /* OS-specific */
+			PT_LOPROC = 0x70000000,
+			PT_HIPROC = 0x7fffffff
+		};
 
-typedef struct
+		/* These constants define the different elf file types */
-{
+		enum ElfType
-	unsigned char e_ident[EI_NIDENT]; // Identification bytes
+		{
-	Elf32_Half    e_type;             // Object file type
+			ET_NONE = 0,
-	Elf32_Half    e_machine;          // Object architecture
+			ET_REL = 1,
-	Elf32_Word    e_version;          // Object file version
+			ET_EXEC = 2,
-	Elf32_Addr    e_entry;            // Object entry point
+			ET_DYN = 3,
-	Elf32_Off     e_phoff;            // Program header file offset
+			ET_CORE = 4,
-	Elf32_Off     e_shoff;            // Section header file offset
+			ET_LOPROC = 0xff00,
-	Elf32_Word    e_flags;            // Processor-specific flags
+			ET_HIPROC = 0xffff
-	Elf32_Half    e_ehsize;           // ELF header size
+		};
-	Elf32_Half    e_phentsize;        // Program header entry size
-	Elf32_Half    e_phnum;            // Program header entries
-	Elf32_Half    e_shentsize;        // Section header entry size
-	Elf32_Half    e_shnum;            // Section header entries
-	Elf32_Half    e_shstrndx;         // String table index
-} Elf32_Ehdr;
 
-typedef struct
+		/* This is the info that is needed to parse the dynamic section of the file */
-{
+		enum DynamicSectionType
-	Elf32_Word p_type;   // Segment type
+		{
-	Elf32_Off  p_offset; // File offset
+			DT_NULL = 0,
-	Elf32_Addr p_vaddr;  // Virtual address
+			DT_NEEDED = 1,
-	Elf32_Addr p_paddr;  // Physical address
+			DT_PLTRELSZ = 2,
-	Elf32_Word p_filesz; // File image size
+			DT_PLTGOT = 3,
-	Elf32_Word p_memsz;  // Memory image size
+			DT_HASH = 4,
-	Elf32_Word p_flags;  // Segment flags
+			DT_STRTAB = 5,
-	Elf32_Word p_align;  // Alignment value
+			DT_SYMTAB = 6,
-} Elf32_Phdr;
+			DT_RELA = 7,
+			DT_RELASZ = 8,
+			DT_RELAENT = 9,
+			DT_STRSZ = 10,
+			DT_SYMENT = 11,
+			DT_INIT = 12,
+			DT_FINI = 13,
+			DT_SONAME = 14,
+			DT_RPATH = 15,
+			DT_SYMBOLIC = 16,
+			DT_REL = 17,
+			DT_RELSZ = 18,
+			DT_RELENT = 19,
+			DT_PLTREL = 20,
+			DT_DEBUG = 21,
+			DT_TEXTREL = 22,
+			DT_JMPREL = 23,
+			DT_ENCODING = 32,
+			OLD_DT_LOOS = 0x60000000,
+			DT_LOOS = 0x6000000d,
+			DT_HIOS = 0x6ffff000,
+			DT_VALRNGLO = 0x6ffffd00,
+			DT_VALRNGHI = 0x6ffffdff,
+			DT_ADDRRNGLO = 0x6ffffe00,
+			DT_ADDRRNGHI = 0x6ffffeff,
+			DT_VERSYM = 0x6ffffff0,
+			DT_RELACOUNT = 0x6ffffff9,
+			DT_RELCOUNT = 0x6ffffffa,
+			DT_FLAGS_1 = 0x6ffffffb,
+			DT_VERDEF = 0x6ffffffc,
+			DT_VERDEFNUM = 0x6ffffffd,
+			DT_VERNEED = 0x6ffffffe,
+			DT_VERNEEDNUM = 0x6fffffff,
+			OLD_DT_HIOS = 0x6fffffff,
+			DT_LOPROC = 0x70000000,
+			DT_HIPROC = 0x7fffffff
+		};
 
-typedef struct
+		/* This info is needed when parsing the symbol table */
-{
+		enum SymbolBinding
-	Elf32_Word sh_name;      // Name (index into section header string table section)
+		{
-	Elf32_Word sh_type;      // Type
+			STB_LOCAL = 0,
-	Elf32_Word sh_flags;     // Flags
+			STB_GLOBAL = 1,
-	Elf32_Addr sh_addr;      // Address
+			STB_WEAK = 2,
-	Elf32_Off  sh_offset;    // File offset
+			STB_LOOS = 10,
-	Elf32_Word sh_size;      // Section size
+			STB_HIOS = 12,
-	Elf32_Word sh_link;      // Section header table index link
+			STB_LOPROC,
-	Elf32_Word sh_info;      // Extra information
+			STB_HIPROC = 0xf
-	Elf32_Word sh_addralign; // Address alignment
+		};
-	Elf32_Word sh_entsize;   // Section entry size
-} Elf32_Shdr;
 
-typedef struct
+		enum SymbolType
-{
+		{
-	Elf32_Addr r_offset; // Offset of relocation
+			STT_NOTYPE = 0,
-	Elf32_Word r_info;   // Symbol table index and type
+			STT_OBJECT = 1,
-} Elf32_Rel;
+			STT_FUNC = 2,
+			STT_SECTION = 3,
+			STT_FILE = 4,
+			STT_COMMON = 5,
+			STT_TLS = 6,
+			STT_LOOS = 10,
+			STT_HIOS = 12,
+			STT_LOPROC,
+			STT_HIPROC = 0xf
+		};
 
-typedef struct
+		/* These constants define the permissions on sections in the program
-{
+		header, p_flags. */
-	Elf32_Word    st_name;  // Name - index into string table
+		enum PermissionFlag
-	Elf32_Addr    st_value; // Symbol value
+		{
-	Elf32_Word    st_size;  // Symbol size
+			PF_R = 0x4,
-	unsigned char st_info;  // Type and binding
+			PF_W = 0x2,
-	unsigned char st_other; // Visibility
+			PF_X = 0x1
-	Elf32_Half    st_shndx; // Section header index
+		};
-} Elf32_Sym;
 
-enum
+		/* sh_type */
-{
+		enum SectionHeaderType
-	ET_NONE = 0, // No file type
+		{
-	ET_REL  = 1, // Relocatable file
+			SHT_NULL = 0,
-	ET_EXEC = 2, // Executable file
+			SHT_PROGBITS = 1,
-	ET_DYN  = 3, // Shared object file
+			SHT_SYMTAB = 2,
-	ET_CORE = 4, // Core file
+			SHT_STRTAB = 3,
-};
+			SHT_RELA = 4,
+			SHT_HASH = 5,
+			SHT_DYNAMIC = 6,
+			SHT_NOTE = 7,
+			SHT_NOBITS = 8,
+			SHT_REL	 = 9,
+			SHT_SHLIB = 10,
+			SHT_DYNSYM = 11,
+			SHT_NUM	 = 12,
+			SHT_LOPROC = 0x70000000,
+			SHT_HIPROC = 0x7fffffff,
+			SHT_LOUSER = 0x80000000,
+			SHT_HIUSER = 0xffffffff
+		};
 		
-enum
+		/* sh_flags */
-{
+		enum SectionHeaderFlag
-	ET_ARM = 40 // ARM architecture
+		{
-};
+			SHF_WRITE = 0x1,
+			SHF_ALLOC = 0x2,
+			SHF_EXECINSTR = 0x4,
+			SHF_RELA_LIVEPATCH = 0x00100000,
+			SHF_RO_AFTER_INIT = 0x00200000,
+			SHF_MASKPROC = 0xf0000000
+		};
 		
-enum
+		/* special section indexes */
-{
+		enum SpecialSectionIndex
-	EV_NONE    = 0, // Invalid version
+		{
-	EV_CURRENT = 1  // Current version
+			SHN_UNDEF = 0,
-};
+			SHN_LORESERVE = 0xff00,
+			SHN_LOPROC = 0xff00,
+			SHN_HIPROC = 0xff1f,
+			SHN_LOOS = 0xff20,
+			SHN_HIOS = 0xff3f,
+			SHN_ABS = 0xfff1,
+			SHN_COMMON = 0xfff2,
+			SHN_HIRESERVE = 0xffff
+		};
 
-#define ELF_MAGIC "\177ELF"
+		enum ElfIdentIndex
+		{
+			EI_MAG0 = 0,		/* e_ident[] indexes */
+			EI_MAG1 = 1,
+			EI_MAG2 = 2,
+			EI_MAG3 = 3,
+			EI_CLASS = 4,
+			EI_DATA = 5,
+			EI_VERSION = 6,
+			EI_OSABI = 7,
+			EI_PAD = 8
+		};
 
-enum
+		enum ElfClass
-{
+		{
-	ELFDATANONE = 0, // Invalid data encoding
+			ELFCLASSNONE = 0,		/* EI_CLASS */
-	ELFDATA2LSB = 1, // Little endian
+			ELFCLASS32 = 1,
-	ELFDATA2MSB = 2, // Big endian
+			ELFCLASS64 = 2,
-};
+			ELFCLASSNUM = 3
+		};
 		
-enum
+		enum ElfData
-{
+		{
-	PT_NULL    = 0, // Unused
+			ELFDATANONE = 0,		/* e_ident[EI_DATA] */
-	PT_LOAD    = 1, // Loadable segment
+			ELFDATA2LSB = 1,
-	PT_DYNAMIC = 2, // Dynamic linking information
+			ELFDATA2MSB = 2
-	PT_INTERP  = 3, // Interpreter
+		};
-	PT_NOTE    = 4, // Auxiliary information
-	PT_SHLIB   = 5, // Reserved
-	PT_PHDR    = 6  // Program header table
-};
 		
-enum
+		enum ElfVersion
-{
+		{
-	PF_R = 4, // Read flag
+			EV_NONE = 0,		/* e_version, EI_VERSION */
-	PF_W = 2, // Write flag
+			EV_CURRENT = 1,
-	PF_X = 1, // Execute flag
+			EV_NUM = 2,
-	PF_OS_SHARED = 0x100000, // OS-specific
+		};
-	PF_CTRSDK = 0x80000000, // Set in CTRSDK ELF Text segments
-};
 		
-enum
+		enum ElfOsAbi
-{
+		{
-	SHN_LORESERVE = 0xFF00,
+			ELFOSABI_NONE = 0,
-	SHN_HIRESERVE = 0xFFFF
+			ELFOSABI_LINUX =3
-};
+		};
 		
-enum
-{
-	SHT_NULL = 0,            // Inactive
-	SHT_PROGBITS = 1,        // Program defined information
-	SHT_SYMTAB = 2,          // Symbol table section
-	SHT_STRTAB = 3,          // String table section
-	SHT_RELA = 4,            // Relocation section with addends
-	SHT_HASH = 5,            // Symbol hash table section
-	SHT_DYNAMIC = 6,         // Dynamic section
-	SHT_NOTE = 7,            // Note section
-	SHT_NOBITS = 8,          // No space section
-	SHT_REL = 9,             // Relation section without addends
-	SHT_SHLIB = 10,          // Reserved
-	SHT_DYNSYM = 11,         // Dynamic symbol table section
-	SHT_NUM = 12,            // Number of section types
-	SHT_LOPROC = 0x70000000, // Reserved range for processor
-	SHT_ARM_EXIDX = 0x70000001, // ARM exception index table
-	SHT_HIPROC = 0x7fffffff, // Specific section header types
-	SHT_LOUSER = 0x80000000, // Reserved range for application
-	SHT_HIUSER = 0xffffffff  // Specific indexes
-};
 
-enum
+		/*
-{
+		* Notes used in ET_CORE. Architectures export some of the arch register sets
-	SHF_WRITE = 1,             // Writable section
+		* using the corresponding note types via the PTRACE_GETREGSET and
-	SHF_ALLOC = 2,             // Loadable section
+		* PTRACE_SETREGSET requests.
-	SHF_EXECINSTR = 4,         // Executable section
+		*/
-	SHF_MASKPROC = 0xf0000000, // Processor-specific
+		enum NoteType
-};
+		{
+			NT_PRSTATUS = 1,
+			NT_PRFPREG = 2,
+			NT_PRPSINFO = 3,
+			NT_TASKSTRUCT = 4,
+			NT_AUXV = 6,
+		/*
+		* Note to userspace developers: size of NT_SIGINFO note may increase
+		* in the future to accomodate more fields, don't assume it is fixed!
+		*/
+			NT_SIGINFO = 0x53494749,
+			NT_FILE = 0x46494c45,
+			NT_PRXFPREG = 0x46e62b7f,      /* copied from gdb5.1/include/elf/common.h */
+			NT_PPC_VMX = 0x100,		/* PowerPC Altivec/VMX registers */
+			NT_PPC_SPE = 0x101,		/* PowerPC SPE/EVR registers */
+			NT_PPC_VSX = 0x102,		/* PowerPC VSX registers */
+			NT_PPC_TAR = 0x103,		/* Target Address Register */
+			NT_PPC_PPR = 0x104,		/* Program Priority Register */
+			NT_PPC_DSCR = 0x105,		/* Data Stream Control Register */
+			NT_PPC_EBB = 0x106,		/* Event Based Branch Registers */
+			NT_PPC_PMU = 0x107,		/* Performance Monitor Registers */
+			NT_PPC_TM_CGPR = 0x108,		/* TM checkpointed GPR Registers */
+			NT_PPC_TM_CFPR = 0x109,		/* TM checkpointed FPR Registers */
+			NT_PPC_TM_CVMX = 0x10a,		/* TM checkpointed VMX Registers */
+			NT_PPC_TM_CVSX = 0x10b,		/* TM checkpointed VSX Registers */
+			NT_PPC_TM_SPR = 0x10c,		/* TM Special Purpose Registers */
+			NT_PPC_TM_CTAR = 0x10d,		/* TM checkpointed Target Address Register */
+			NT_PPC_TM_CPPR = 0x10e,		/* TM checkpointed Program Priority Register */
+			NT_PPC_TM_CDSCR = 0x10f,		/* TM checkpointed Data Stream Control Register */
+			NT_PPC_PKEY = 0x110,		/* Memory Protection Keys registers */
+			NT_386_TLS = 0x200,		/* i386 TLS slots (struct user_desc) */
+			NT_386_IOPERM = 0x201,		/* x86 io permission bitmap (1=deny) */
+			NT_X86_XSTATE = 0x202,		/* x86 extended state using xsave */
+			NT_S390_HIGH_GPRS = 0x300,	/* s390 upper register halves */
+			NT_S390_TIMER = 0x301,		/* s390 timer register */
+			NT_S390_TODCMP = 0x302,		/* s390 TOD clock comparator register */
+			NT_S390_TODPREG = 0x303,		/* s390 TOD programmable register */
+			NT_S390_CTRS = 0x304,		/* s390 control registers */
+			NT_S390_PREFIX = 0x305,		/* s390 prefix register */
+			NT_S390_LAST_BREAK = 0x306,	/* s390 breaking event address */
+			NT_S390_SYSTEM_CALL = 0x307,	/* s390 system call restart data */
+			NT_S390_TDB = 0x308,		/* s390 transaction diagnostic block */
+			NT_S390_VXRS_LOW = 0x309,	/* s390 vector registers 0-15 upper half */
+			NT_S390_VXRS_HIGH = 0x30a,	/* s390 vector registers 16-31 */
+			NT_S390_GS_CB = 0x30b,		/* s390 guarded storage registers */
+			NT_S390_GS_BC = 0x30c,		/* s390 guarded storage broadcast control block */
+			NT_S390_RI_CB = 0x30d,		/* s390 runtime instrumentation */
+			NT_ARM_VFP = 0x400,		/* ARM VFP/NEON registers */
+			NT_ARM_TLS = 0x401,		/* ARM TLS register */
+			NT_ARM_HW_BREAK = 0x402,		/* ARM hardware breakpoint registers */
+			NT_ARM_HW_WATCH = 0x403,		/* ARM hardware watchpoint registers */
+			NT_ARM_SYSTEM_CALL = 0x404,	/* ARM system call number */
+			NT_ARM_SVE = 0x405,		/* ARM Scalable Vector Extension registers */
+			NT_ARC_V2 = 0x600,		/* ARCv2 accumulator/extra registers */
+			NT_VMCOREDD = 0x700,		/* Vmcore Device Dump Note */
+			NT_MIPS_DSP = 0x800,		/* MIPS DSP ASE registers */
+			NT_MIPS_FP_MODE = 0x801,		/* MIPS floating-point mode */
+		};
 		
-#define ELF32_R_SYM(i)    ((i) >> 8)
+		static const size_t kEIdentSize = 0x10;
-#define ELF32_R_TYPE(i)   ((unsigned char)(i))
+		static const byte_t kElfMagic[sizeof(uint32_t)] = {0x7f, 'E', 'L', 'F'};
-#define ELF32_R_INFO(s,t) (((s) << 8) + (unsigned char)(t))
 
-enum
-{
-	R_ARM_NONE = 0,
-	R_ARM_PC24 = 1,
-	R_ARM_ABS32 = 2,
-	R_ARM_REL32 = 3,
-	R_ARM_THM_CALL = 10,
-	R_ARM_PLT32 = 27,
-	R_ARM_CALL = 28,
-	R_ARM_JUMP24 = 29,
-	R_ARM_TARGET1 = 38,
-	R_ARM_TARGET2 = 41,
-	R_ARM_PREL31 = 42,
-	R_ARM_THM_JUMP11 = 102,
-	R_ARM_THM_JUMP8 = 103
-};
 
-// Symbol scope
+		inline byte_t get_elf_st_bind(byte_t st_info) { return st_info >> 4; }
-enum
+		inline byte_t get_elf_st_type(byte_t st_info) { return st_info & 0xf; }
-{
+		inline byte_t get_elf_st_info(byte_t st_bind, byte_t st_type) { return (st_type & 0xf) | ((st_bind & 0xf) << 4);}
-	STB_LOCAL = 0,
-	STB_GLOBAL = 1,
-	STB_WEAK = 2
-};
 
-#define ELF32_ST_BIND(i)   (((unsigned char)(i)) >> 4)
+		/* The following are used with relocations */
-#define ELF32_ST_TYPE(val) ((val) & 0xf)
+		#define ELF32_R_SYM(x) ((x) >> 8)
+		#define ELF32_R_TYPE(x) ((x) & 0xff)
 
-// Symbol type
+		#define ELF64_R_SYM(i)			((i) >> 32)
-enum
+		#define ELF64_R_TYPE(i)			((i) & 0xffffffff)
-{
+	}
-	STT_NOTYPE = 0,
-	STT_OBJECT = 1,
-	STT_FUNC = 2
-};
 
-// Symbol visibility
+	struct Elf32_Dyn
-enum
+	{
-{
+		int32_t d_tag;
-	STV_DEFAULT = 0,
+		union{
-	STV_INTERNAL = 1,
+			int32_t	d_val;
-	STV_HIDDEN = 2,
+			uint32_t	d_ptr;
-	STV_PROTECTED = 3
+		} d_un;
-};
+	};
+
+	struct Elf64_Dyn
+	{
+		int64_t d_tag;		/* entry tag value */
+		union {
+			uint64_t d_val;
+			uint64_t d_ptr;
+		} d_un;
+	};
+
+	struct Elf32_Rel
+	{
+		uint32_t	r_offset;
+		uint32_t	r_info;
+	};
+
+	struct Elf64_Rel
+	{
+		uint64_t r_offset;	/* Location at which to apply the action */
+		uint64_t r_info;	/* index and type of relocation */
+	};
+
+	struct Elf32_Rela
+	{
+		uint32_t	r_offset;
+		uint32_t	r_info;
+		int32_t	r_addend;
+	};
+
+	struct Elf64_Rela
+	{
+		uint64_t r_offset;	/* Location at which to apply the action */
+		uint64_t r_info;	/* index and type of relocation */
+		int64_t r_addend;	/* Constant addend used to compute value */
+	};
+
+	struct Elf32_Sym
+	{
+		uint32_t	st_name;
+		uint32_t	st_value;
+		uint32_t	st_size;
+		byte_t	st_info;
+		byte_t	st_other;
+		uint16_t	st_shndx;
+	};
+
+	struct Elf64_Sym
+	{
+		uint32_t st_name;		/* Symbol name, index in string tbl */
+		byte_t	st_info;	/* Type and binding attributes */
+		byte_t	st_other;	/* No defined meaning, 0 */
+		uint16_t st_shndx;		/* Associated section index */
+		uint64_t st_value;		/* Value of the symbol */
+		uint64_t st_size;		/* Associated symbol size */
+	};
+
+	struct Elf32_Ehdr
+	{
+		byte_t	e_ident[elf::kEIdentSize];
+		uint16_t	e_type;
+		uint16_t	e_machine;
+		uint32_t	e_version;
+		uint32_t	e_entry;  /* Entry point */
+		uint32_t	e_phoff;
+		uint32_t	e_shoff;
+		uint32_t	e_flags;
+		uint16_t	e_ehsize;
+		uint16_t	e_phentsize;
+		uint16_t	e_phnum;
+		uint16_t	e_shentsize;
+		uint16_t	e_shnum;
+		uint16_t	e_shstrndx;
+	};
+
+	struct Elf64_Ehdr
+	{
+		byte_t	e_ident[elf::kEIdentSize];	/* ELF "magic number" */
+		uint16_t e_type;
+		uint16_t e_machine;
+		uint32_t e_version;
+		uint64_t e_entry;		/* Entry point virtual address */
+		uint64_t e_phoff;		/* Program header table file offset */
+		uint64_t e_shoff;		/* Section header table file offset */
+		uint32_t e_flags;
+		uint16_t e_ehsize;
+		uint16_t e_phentsize;
+		uint16_t e_phnum;
+		uint16_t e_shentsize;
+		uint16_t e_shnum;
+		uint16_t e_shstrndx;
+	};
+
+	struct Elf32_Phdr
+	{
+		uint32_t	p_type;
+		uint32_t	p_offset;
+		uint32_t	p_vaddr;
+		uint32_t	p_paddr;
+		uint32_t	p_filesz;
+		uint32_t	p_memsz;
+		uint32_t	p_flags;
+		uint32_t	p_align;
+	};
+
+	struct Elf64_Phdr
+	{
+		uint32_t p_type;
+		uint32_t p_flags;
+		uint64_t p_offset;		/* Segment file offset */
+		uint64_t p_vaddr;		/* Segment virtual address */
+		uint64_t p_paddr;		/* Segment physical address */
+		uint64_t p_filesz;		/* Segment size in file */
+		uint64_t p_memsz;		/* Segment size in memory */
+		uint64_t p_align;		/* Segment alignment, file & memory */
+	};
+
+	struct Elf32_Shdr
+	{
+		uint32_t	sh_name;
+		uint32_t	sh_type;
+		uint32_t	sh_flags;
+		uint32_t	sh_addr;
+		uint32_t	sh_offset;
+		uint32_t	sh_size;
+		uint32_t	sh_link;
+		uint32_t	sh_info;
+		uint32_t	sh_addralign;
+		uint32_t	sh_entsize;
+	};
+
+	struct Elf64_Shdr
+	{
+		uint32_t sh_name;		/* Section name, index in string tbl */
+		uint32_t sh_type;		/* Type of section */
+		uint64_t sh_flags;		/* Miscellaneous section attributes */
+		uint64_t sh_addr;		/* Section virtual addr at execution */
+		uint64_t sh_offset;		/* Section file offset */
+		uint64_t sh_size;		/* Size of section in bytes */
+		uint32_t sh_link;		/* Index of another section */
+		uint32_t sh_info;		/* Additional section information */
+		uint64_t sh_addralign;	/* Section alignment */
+		uint64_t sh_entsize;	/* Entry size if section holds table */
+	};
+
+	/* Note header in a PT_NOTE section */
+	struct Elf32_Nhdr
+	{
+		uint32_t	n_namesz;	/* Name size */
+		uint32_t	n_descsz;	/* Content size */
+		uint32_t	n_type;		/* Content type */
+	};
+
+	/* Note header in a PT_NOTE section */
+	struct Elf64_Nhdr
+	{
+		uint32_t n_namesz;	/* Name size */
+		uint32_t n_descsz;	/* Content size */
+		uint32_t n_type;	/* Content type */
+	};
+}

lib/libfnd/include/fnd/rsa.h

@@ -114,7 +114,7 @@ namespace fnd
 			//int rsaSign(const sRsa1024Key& key, sha::HashType hash_type, const uint8_t* hash, uint8_t signature[kRsa1024Size]);
 			//int rsaVerify(const sRsa1024Key& key, sha::HashType hash_type, const uint8_t* hash, const uint8_t signature[kRsa1024Size]);
 			// rsa2048
-			//int rsaSign(const sRsa2048Key& key, sha::HashType hash_type, const uint8_t* hash, uint8_t signature[kRsa2048Size]);
+			int rsaSign(const sRsa2048Key& key, sha::HashType hash_type, const uint8_t* hash, uint8_t signature[kRsa2048Size]);
 			int rsaVerify(const sRsa2048Key& key, sha::HashType hash_type, const uint8_t* hash, const uint8_t signature[kRsa2048Size]);
 			// rsa4096
 			//int rsaSign(const sRsa4096Key& key, sha::HashType hash_type, const uint8_t* hash, uint8_t signature[kRsa4096Size]);

lib/libfnd/libfnd.vcxproj

@@ -21,7 +21,7 @@
   <PropertyGroup Label="Globals">
     <VCProjectVersion>15.0</VCProjectVersion>
     <ProjectGuid>{4D27EDB9-5110-44FE-8CE2-D46C5AD3C55B}</ProjectGuid>
-    <WindowsTargetPlatformVersion>10.0.15063.0</WindowsTargetPlatformVersion>
+    <WindowsTargetPlatformVersion>10.0.16299.0</WindowsTargetPlatformVersion>
   </PropertyGroup>
   <Import Project="$(VCTargetsPath)\Microsoft.Cpp.Default.props" />
   <PropertyGroup Condition="'$(Configuration)|$(Platform)'=='Debug|Win32'" Label="Configuration">
@@ -136,6 +136,7 @@
     <ClInclude Include="include\fnd\ResourceFileReader.h" />
     <ClInclude Include="include\fnd\rsa.h" />
     <ClInclude Include="include\fnd\sha.h" />
+    <ClInclude Include="include\fnd\SharedPtr.h" />
     <ClInclude Include="include\fnd\SimpleFile.h" />
     <ClInclude Include="include\fnd\SimpleTextOutput.h" />
     <ClInclude Include="include\fnd\StringConv.h" />

lib/libfnd/libfnd.vcxproj.filters

@@ -63,6 +63,9 @@
     <ClInclude Include="include\fnd\sha.h">
       <Filter>Header Files</Filter>
     </ClInclude>
+    <ClInclude Include="include\fnd\SharedPtr.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
     <ClInclude Include="include\fnd\SimpleFile.h">
       <Filter>Header Files</Filter>
     </ClInclude>

lib/libfnd/source/SimpleTextOutput.cpp

@@ -1,5 +1,8 @@
-#include <fnd/SimpleTextOutput.h>
+#include <iostream>
+#include <iomanip>
+#include <sstream>
 #include <cstdio>
+#include <fnd/SimpleTextOutput.h>
 
 void fnd::SimpleTextOutput::hxdStyleDump(const byte_t* data, size_t len, size_t row_len, size_t byte_grouping_size)
 {
@@ -58,31 +61,57 @@ void fnd::SimpleTextOutput::hxdStyleDump(const byte_t* data, size_t len)
 
 void fnd::SimpleTextOutput::hexDump(const byte_t* data, size_t len, size_t row_len, size_t indent_len)
 {
-	for (size_t i = 0; i < len; i++)
+	for (size_t i = 0; i < len; i += row_len)
 	{
-		if ((i % row_len) == 0)
+		for (size_t j = 0; j < indent_len; j++)
-		{
+			std::cout << " ";
-			if (i > 0)
+		std::cout << arrayToString(data+i, _MIN(len-i, row_len), true, "") << std::endl;
-				putchar('\n');
-			for (size_t j = 0; j < indent_len; j++)
-			{
-				putchar(' ');
-			}
-		}
-		printf("%02X", data[i]);
-		if ((i+1) >= len)
-		{
-			putchar('\n');
-		}
-		
 	}
 }
 
 void fnd::SimpleTextOutput::hexDump(const byte_t* data, size_t len)
 {
+	std::cout << arrayToString(data, len, true, "") << std::endl;
+}
+
+std::string fnd::SimpleTextOutput::arrayToString(const byte_t* data, size_t len, bool upper_case, const std::string& separator)
+{
+	std::stringstream ss;
+
+	if (upper_case)
+			ss << std::uppercase;
 	for (size_t i = 0; i < len; i++)
 	{
-		printf("%02X", data[i]);
+		ss << std::hex << std::setw(2) << std::setfill('0') << (uint32_t)data[i];
+		if (i+1 < len)
+			ss << separator;
+	}
+	return ss.str();
+}
+
+inline byte_t charToByte(char chr)
+{
+	if (chr >= 'a' && chr <= 'f')
+		return (chr - 'a') + 0xa;
+	else if (chr >= 'A' && chr <= 'F')
+		return (chr - 'A') + 0xa; 
+	else if (chr >= '0' && chr <= '9')
+		return chr - '0';
+	return 0;
+}
+
+void fnd::SimpleTextOutput::stringToArray(const std::string& str, fnd::Vec<byte_t>& array)
+{
+	size_t size = str.size();
+	if ((size % 2))
+	{
+		return;
+	}
+
+	array.alloc(size/2);
+
+	for (size_t i = 0; i < array.size(); i++)
+	{
+		array[i] = (charToByte(str[i * 2]) << 4) | charToByte(str[(i * 2) + 1]);
 	}
-	putchar('\n');
 }

lib/libfnd/source/rsa_wrapper.cpp

@@ -1,6 +1,8 @@
 #include <fnd/rsa.h>
 #include <polarssl/rsa.h>
 #include <polarssl/md.h>
+#include <polarssl/entropy.h>
+#include <polarssl/ctr_drbg.h>
 
 using namespace fnd::rsa;
 using namespace fnd::sha;
@@ -165,6 +167,33 @@ int fnd::rsa::pkcs::rsaVerify(const sRsa4096Key & key, HashType hash_type, const
 	return ret;
 }
 
+int fnd::rsa::pss::rsaSign(const sRsa2048Key & key, HashType hash_type, const uint8_t * hash, uint8_t signature[kRsa2048Size])
+{
+	int ret;
+	const char* pers = "fnd::rsa::pss::rsaSign";
+
+	// rsa
+	rsa_context rsa;
+	rsa_init(&rsa, RSA_PKCS_V21, getMdWrappedHashType(hash_type));
+	rsa.len = kRsa2048Size;
+	mpi_read_binary(&rsa.D, key.priv_exponent, rsa.len);
+	mpi_read_binary(&rsa.N, key.modulus, rsa.len);
+
+	entropy_context entropy;
+	entropy_init(&entropy);
+	
+	ctr_drbg_context ctr_drbg;
+	ctr_drbg_init(&ctr_drbg, entropy_func, &entropy, (const uint8_t*)pers, strlen(pers));
+
+	ret = rsa_rsassa_pss_sign(&rsa, ctr_drbg_random, &ctr_drbg, RSA_PRIVATE, getWrappedHashType(hash_type), getWrappedHashSize(hash_type), hash, signature);
+
+	rsa_free(&rsa);
+	
+
+	return ret;
+}
+
+
 int fnd::rsa::pss::rsaVerify(const sRsa2048Key & key, HashType hash_type, const uint8_t * hash, const uint8_t signature[kRsa2048Size])
 {
 	static const uint8_t public_exponent[3] = { 0x01, 0x00, 0x01 };

lib/libhac/include/nn/hac/ContentMetaBinary.h

@@ -120,18 +120,18 @@ namespace hac
 		struct AddOnContentMetaExtendedHeader
 		{
 			uint64_t application_id;
-			uint32_t required_system_version;
+			uint32_t required_application_version;
 
 			void operator=(const AddOnContentMetaExtendedHeader& other)
 			{
 				application_id = other.application_id;
-				required_system_version = other.required_system_version;
+				required_application_version = other.required_application_version;
 			}
 
 			bool operator==(const AddOnContentMetaExtendedHeader& other) const
 			{
 				return (application_id == other.application_id) \
-					&& (required_system_version == other.required_system_version);
+					&& (required_application_version == other.required_application_version);
 			}
 
 			bool operator!=(const AddOnContentMetaExtendedHeader& other) const

lib/libhac/include/nn/hac/IdConverter.h

@@ -0,0 +1,21 @@
+#pragma once
+#include <fnd/types.h>
+
+namespace nn
+{
+namespace hac
+{
+	class IdConverter
+	{
+	public:
+		static uint64_t convertToAocBaseId(uint64_t application_id);
+		static uint64_t convertToDeltaId(uint64_t application_id);
+		static uint64_t convertToPatchId(uint64_t application_id);
+
+	private:
+		static const uint64_t kAocBaseId = 0x1000;
+		static const uint64_t kDeltaId = 0xc00;
+		static const uint64_t kPatchId = 0x800;
+	};
+}
+}

lib/libhac/include/nn/hac/Result.h

@@ -0,0 +1,39 @@
+#pragma once
+#include <fnd/types.h>
+
+namespace nn
+{
+namespace hac
+{
+	class Result
+	{
+	public:
+		Result();
+		Result(uint32_t result);
+		Result(uint32_t module_num, uint32_t desc, uint32_t sub_desc);
+
+		void operator=(const Result& other);
+		bool operator==(const Result& other) const;
+		bool operator!=(const Result& other) const;
+
+		bool isSuccess() const;
+		bool isFailure() const;
+
+		uint32_t getInnerValue() const;
+		uint32_t getModuleNum() const;
+		uint32_t getDescription() const;
+		uint32_t getSubDescription() const;
+
+	private:
+		static const uint32_t kModuleNumBitWidth = 9;
+		static const uint32_t kModuleNumBitPos = 0;
+		static const uint32_t kDescriptionBitWidth = 13;
+		static const uint32_t kDescriptionBitPos = 9;
+		static const uint32_t kSubDescriptionBitWidth = 10;
+		static const uint32_t kSubDescriptionBitPos = 22;
+		inline uint32_t bitWidthToMask(uint32_t bit_width) const { return _BIT(bit_width) - 1; }
+
+		uint32_t mResult;
+	};
+}
+}

lib/libhac/include/nn/hac/cnmt.h

@@ -118,7 +118,7 @@ namespace hac
 	struct sAddOnContentMetaExtendedHeader
 	{
 		le_uint64_t application_id;
-		le_uint32_t required_system_version;
+		le_uint32_t required_application_version;
 		byte_t reserved[4];
 	};
 

lib/libhac/include/nn/hac/elf.h

@@ -1,70 +0,0 @@
-#pragma once
-#include <fnd/types.h>
-
-namespace nn
-{
-namespace hac
-{
-	namespace elf
-	{
-		enum SpecialSectionIndex
-		{
-			SHN_UNDEF,
-			SHN_LORESERVE = 0xFF00,
-			SHN_LOPROC = 0xFF00,
-			SHN_HIPROC = 0xFF1F,
-			SHN_LOOS,
-			SHN_HIOS = 0xFF3F,
-			SHN_ABS = 0xFFF1,
-			SHN_COMMON,
-			SHN_HIRESERVE = 0xFFFF
-		};
-
-		enum SymbolType
-		{
-			STT_NOTYPE,
-			STT_OBJECT,
-			STT_FUNC,
-			STT_SECTION,
-			STT_FILE,
-			STT_LOOS = 10,
-			STT_HIOS = 12,
-			STT_LOPROC,
-			STT_HIPROC = 0xF
-		};
-
-		enum SymbolBinding
-		{
-			STB_LOCAL,
-			STB_GLOBAL,
-			STB_WEAK,
-			STB_LOOS = 10,
-			STB_HIOS = 12,
-			STB_LOPROC,
-			STB_HIPROC = 0xF
-		};
-	}
-
-#pragma pack(push,1)
-	struct sElfSymbol32Bit
-	{
-		le_uint32_t name;
-		le_uint32_t value;
-		le_uint32_t size;
-		le_uint32_t info;
-		le_uint32_t other;
-		le_uint32_t special_section_index;
-	};
-
-	struct sElfSymbol64Bit
-	{
-		le_uint32_t name;
-		byte_t info;
-		byte_t other;
-		le_uint16_t special_section_index;
-		le_uint64_t value;
-		le_uint64_t size;
-	};
-#pragma pack(pop)
-}
-}

lib/libhac/libhac.vcxproj

@@ -39,6 +39,7 @@
     <ClInclude Include="include\nn\hac\HierarchicalIntegrityHeader.h" />
     <ClInclude Include="include\nn\hac\hierarchicalsha256.h" />
     <ClInclude Include="include\nn\hac\HierarchicalSha256Header.h" />
+    <ClInclude Include="include\nn\hac\IdConverter.h" />
     <ClInclude Include="include\nn\hac\IKernelCapabilityHandler.h" />
     <ClInclude Include="include\nn\hac\InteruptEntry.h" />
     <ClInclude Include="include\nn\hac\InteruptHandler.h" />
@@ -67,6 +68,7 @@
     <ClInclude Include="include\nn\hac\NsoHeader.h" />
     <ClInclude Include="include\nn\hac\pfs.h" />
     <ClInclude Include="include\nn\hac\PfsHeader.h" />
+    <ClInclude Include="include\nn\hac\Result.h" />
     <ClInclude Include="include\nn\hac\romfs.h" />
     <ClInclude Include="include\nn\hac\ServiceAccessControlBinary.h" />
     <ClInclude Include="include\nn\hac\ServiceAccessControlEntry.h" />
@@ -90,6 +92,7 @@
     <ClCompile Include="source\HandleTableSizeHandler.cpp" />
     <ClCompile Include="source\HierarchicalIntegrityHeader.cpp" />
     <ClCompile Include="source\HierarchicalSha256Header.cpp" />
+    <ClCompile Include="source\IdConverter.cpp" />
     <ClCompile Include="source\InteruptEntry.cpp" />
     <ClCompile Include="source\InteruptHandler.cpp" />
     <ClCompile Include="source\KernelCapabilityBinary.cpp" />
@@ -108,6 +111,7 @@
     <ClCompile Include="source\NroHeader.cpp" />
     <ClCompile Include="source\NsoHeader.cpp" />
     <ClCompile Include="source\PfsHeader.cpp" />
+    <ClCompile Include="source\Result.cpp" />
     <ClCompile Include="source\ServiceAccessControlBinary.cpp" />
     <ClCompile Include="source\ServiceAccessControlEntry.cpp" />
     <ClCompile Include="source\SystemCallEntry.cpp" />
@@ -121,7 +125,7 @@
     <VCProjectVersion>15.0</VCProjectVersion>
     <ProjectGuid>{91BA9E79-8242-4F7D-B997-0DFEC95EA22B}</ProjectGuid>
     <RootNamespace>hac</RootNamespace>
-    <WindowsTargetPlatformVersion>10.0.15063.0</WindowsTargetPlatformVersion>
+    <WindowsTargetPlatformVersion>10.0.16299.0</WindowsTargetPlatformVersion>
     <ProjectName>libhac</ProjectName>
   </PropertyGroup>
   <Import Project="$(VCTargetsPath)\Microsoft.Cpp.Default.props" />

lib/libhac/libhac.vcxproj.filters

@@ -183,6 +183,12 @@
     <ClInclude Include="include\nn\hac\XciUtils.h">
       <Filter>Header Files</Filter>
     </ClInclude>
+    <ClInclude Include="include\nn\hac\IdConverter.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
+    <ClInclude Include="include\nn\hac\Result.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
   </ItemGroup>
   <ItemGroup>
     <ClCompile Include="source\AccessControlInfoBinary.cpp">
@@ -296,5 +302,11 @@
     <ClCompile Include="source\XciUtils.cpp">
       <Filter>Source Files</Filter>
     </ClCompile>
+    <ClCompile Include="source\IdConverter.cpp">
+      <Filter>Source Files</Filter>
+    </ClCompile>
+    <ClCompile Include="source\Result.cpp">
+      <Filter>Source Files</Filter>
+    </ClCompile>
   </ItemGroup>
 </Project>

lib/libhac/source/AccessControlInfoBinary.cpp

@@ -34,14 +34,10 @@ bool nn::hac::AccessControlInfoBinary::operator!=(const AccessControlInfoBinary
 
 void nn::hac::AccessControlInfoBinary::toBytes()
 {
-	if (mFileSystemAccessControl.getBytes().size() == 0)
+	// serialise the sections
-		mFileSystemAccessControl.toBytes();
+	mFileSystemAccessControl.toBytes();
-
+	mServiceAccessControl.toBytes();
-	if (mServiceAccessControl.getBytes().size() == 0)
+	mKernelCapabilities.toBytes();
-		mServiceAccessControl.toBytes();
-
-	if (mKernelCapabilities.getBytes().size() == 0)
-		mKernelCapabilities.toBytes();
 
 	// determine section layout
 	struct sLayout {
@@ -74,6 +70,11 @@ void nn::hac::AccessControlInfoBinary::toBytes()
 	hdr->sac.size = sac.size;
 	hdr->kc.offset = kc.offset;
 	hdr->kc.size = kc.size;
+
+	// write data
+	memcpy(mRawBinary.data() + fac.offset, mFileSystemAccessControl.getBytes().data(), fac.size);
+	memcpy(mRawBinary.data() + sac.offset, mServiceAccessControl.getBytes().data(), sac.size);
+	memcpy(mRawBinary.data() + kc.offset, mKernelCapabilities.getBytes().data(), kc.size);
 }
 
 void nn::hac::AccessControlInfoBinary::fromBytes(const byte_t* data, size_t len)

lib/libhac/source/AccessControlInfoDescBinary.cpp

@@ -38,14 +38,10 @@ bool nn::hac::AccessControlInfoDescBinary::operator!=(const AccessControlInfoDes
 
 void nn::hac::AccessControlInfoDescBinary::toBytes()
 {
-	if (mFileSystemAccessControl.getBytes().size() == 0)
+	// serialise the sections
-		mFileSystemAccessControl.toBytes();
+	mFileSystemAccessControl.toBytes();
-
+	mServiceAccessControl.toBytes();
-	if (mServiceAccessControl.getBytes().size() == 0)
+	mKernelCapabilities.toBytes();
-		mServiceAccessControl.toBytes();
-
-	if (mKernelCapabilities.getBytes().size() == 0)
-		mKernelCapabilities.toBytes();
 
 	// determine section layout
 	struct sLayout {
@@ -91,6 +87,11 @@ void nn::hac::AccessControlInfoDescBinary::toBytes()
 	hdr->sac.size = sac.size;
 	hdr->kc.offset = kc.offset;
 	hdr->kc.size = kc.size;
+
+	// write data
+	memcpy(mRawBinary.data() + fac.offset, mFileSystemAccessControl.getBytes().data(), fac.size);
+	memcpy(mRawBinary.data() + sac.offset, mServiceAccessControl.getBytes().data(), sac.size);
+	memcpy(mRawBinary.data() + kc.offset, mKernelCapabilities.getBytes().data(), kc.size);
 }
 
 void nn::hac::AccessControlInfoDescBinary::fromBytes(const byte_t* data, size_t len)
@@ -157,7 +158,7 @@ void nn::hac::AccessControlInfoDescBinary::generateSignature(const fnd::rsa::sRs
 	byte_t hash[fnd::sha::kSha256HashLen];
 	fnd::sha::Sha256(mRawBinary.data() + fnd::rsa::kRsa2048Size, mRawBinary.size() - fnd::rsa::kRsa2048Size, hash);
 
-	if (fnd::rsa::pkcs::rsaSign(key, fnd::sha::HASH_SHA256, hash, mRawBinary.data()) != 0)
+	if (fnd::rsa::pss::rsaSign(key, fnd::sha::HASH_SHA256, hash, mRawBinary.data()) != 0)
 	{
 		throw fnd::Exception(kModuleName, "Failed to sign Access Control Info Desc");
 	}

lib/libhac/source/ContentMetaBinary.cpp

@@ -100,7 +100,7 @@ void nn::hac::ContentMetaBinary::fromBytes(const byte_t* data, size_t len)
 				break;
 			case (cnmt::METATYPE_ADD_ON_CONTENT):
 				mAddOnContentMetaExtendedHeader.application_id = ((sAddOnContentMetaExtendedHeader*)mExtendedHeader.data())->application_id.get();
-				mAddOnContentMetaExtendedHeader.required_system_version = ((sAddOnContentMetaExtendedHeader*)mExtendedHeader.data())->required_system_version.get();
+				mAddOnContentMetaExtendedHeader.required_application_version = ((sAddOnContentMetaExtendedHeader*)mExtendedHeader.data())->required_application_version.get();
 				break;
 			case (cnmt::METATYPE_DELTA):
 				mDeltaMetaExtendedHeader.application_id = ((sDeltaMetaExtendedHeader*)mExtendedHeader.data())->application_id.get();

lib/libhac/source/FileSystemAccessControlBinary.cpp

@@ -41,9 +41,17 @@ void nn::hac::FileSystemAccessControlBinary::toBytes()
 	} content, savedata;
 
 	content.offset = (uint32_t)align(sizeof(sFacHeader), fac::kSectionAlignSize);
-	content.size = (uint32_t)(sizeof(uint32_t) + mContentOwnerIdList.size() * sizeof(uint64_t));
+	if (mContentOwnerIdList.size() > 0)
+		content.size = (uint32_t)(sizeof(uint32_t) + mContentOwnerIdList.size() * sizeof(uint64_t));
+	else
+		content.size = 0;
+
 	savedata.offset = (uint32_t)(content.offset + (content.size > 0 ? align(content.size, fac::kSectionAlignSize) : 0));
-	savedata.size = (uint32_t)(sizeof(uint32_t) + align(mSaveDataOwnerIdList.size(), fac::kSectionAlignSize) + mSaveDataOwnerIdList.size() * sizeof(uint64_t));
+	if (mSaveDataOwnerIdList.size() > 0)
+		savedata.size = (uint32_t)(sizeof(uint32_t) + align(mSaveDataOwnerIdList.size(), fac::kSectionAlignSize) + mSaveDataOwnerIdList.size() * sizeof(uint64_t));
+	else
+		savedata.size = 0;
+	
 
 	// get total size
 	size_t total_size = _MAX(_MAX(content.offset + content.size, savedata.offset + savedata.size), align(sizeof(sFacHeader), fac::kSectionAlignSize)); 

lib/libhac/source/IdConverter.cpp

@@ -0,0 +1,16 @@
+#include <nn/hac/IdConverter.h>
+
+uint64_t nn::hac::IdConverter::convertToAocBaseId(uint64_t application_id)
+{
+	return application_id + kAocBaseId;
+}
+
+uint64_t nn::hac::IdConverter::convertToDeltaId(uint64_t application_id)
+{
+	return application_id + kDeltaId;
+}
+
+uint64_t nn::hac::IdConverter::convertToPatchId(uint64_t application_id)
+{
+	return application_id + kPatchId;
+}

lib/libhac/source/KernelCapabilityBinary.cpp

@@ -11,6 +11,7 @@ nn::hac::KernelCapabilityBinary::KernelCapabilityBinary(const KernelCapabilityBi
 void nn::hac::KernelCapabilityBinary::operator=(const KernelCapabilityBinary & other)
 {
 	clear();
+	mRawBinary = other.mRawBinary;
 	mThreadInfo = other.mThreadInfo;
 	mSystemCalls = other.mSystemCalls;
 	mMemoryMap = other.mMemoryMap;

lib/libhac/source/NpdmBinary.cpp

@@ -132,16 +132,8 @@ void nn::hac::NpdmBinary::fromBytes(const byte_t* data, size_t len)
 	mMainThreadCpuId = hdr.main_thread_cpu_id;
 	mVersion = hdr.version.get();
 	mMainThreadStackSize = hdr.main_thread_stack_size.get();
-	mName = std::string(hdr.name, npdm::kNameMaxLen);
+	mName = std::string(hdr.name, _MIN(strlen(hdr.name), npdm::kNameMaxLen));
-	if (mName[0] == '\0')
+	mProductCode = std::string(hdr.product_code, _MIN(strlen(hdr.product_code), npdm::kProductCodeMaxLen));
-	{
-		mName.clear();
-	}
-	mProductCode = std::string(hdr.product_code, npdm::kProductCodeMaxLen);
-	if (mProductCode[0] == '\0')
-	{
-		mProductCode.clear();
-	}
 
 	// total size
 	size_t total_size = _MAX(_MAX(hdr.acid.offset.get() + hdr.acid.size.get(), hdr.aci.offset.get() + hdr.aci.size.get()), sizeof(sNpdmHeader));

lib/libhac/source/Result.cpp

@@ -0,0 +1,62 @@
+#include <nn/hac/Result.h>
+
+nn::hac::Result::Result() :
+	mResult(0)
+{}
+
+nn::hac::Result::Result(uint32_t result) :
+	mResult(result)
+{}
+
+nn::hac::Result::Result(uint32_t module_num, uint32_t desc, uint32_t sub_desc) :
+	mResult(0)
+{
+	mResult |= (module_num & bitWidthToMask(kModuleNumBitWidth)) << kModuleNumBitPos;
+	mResult |= (desc & bitWidthToMask(kDescriptionBitWidth)) << kDescriptionBitPos;
+	mResult |= (sub_desc & bitWidthToMask(kSubDescriptionBitWidth)) << kSubDescriptionBitPos;
+}
+
+void nn::hac::Result::operator=(const Result & other)
+{
+	mResult = other.mResult;
+}
+
+bool nn::hac::Result::operator==(const Result & other) const
+{
+	return mResult == other.mResult;
+}
+
+bool nn::hac::Result::operator!=(const Result & other) const
+{
+	return !(*this == other);
+}
+
+bool nn::hac::Result::isSuccess() const
+{
+	return mResult == 0;
+}
+
+bool nn::hac::Result::isFailure() const
+{
+	return !isSuccess();
+}
+
+uint32_t nn::hac::Result::getInnerValue() const
+{
+	return mResult;
+}
+
+uint32_t nn::hac::Result::getModuleNum() const
+{
+	return (mResult >> kModuleNumBitPos) & bitWidthToMask(kModuleNumBitWidth);
+}
+
+uint32_t nn::hac::Result::getDescription() const
+{
+	return (mResult >> kDescriptionBitPos) & bitWidthToMask(kDescriptionBitWidth);
+}
+
+uint32_t nn::hac::Result::getSubDescription() const
+{
+	return (mResult >> kSubDescriptionBitPos) & bitWidthToMask(kSubDescriptionBitWidth);
+}

lib/libhac/source/SystemCallHandler.cpp

@@ -54,7 +54,7 @@ void nn::hac::SystemCallHandler::exportKernelCapabilityList(fnd::List<KernelCapa
 	if (isSet() == false)
 		return;
 
-	fnd::List<SystemCallEntry> entries;
+	SystemCallEntry entries[kSyscallTotalEntryNum];
 	for (size_t i = 0; i < kSyscallTotalEntryNum; i++)
 	{
 		entries[i].setSystemCallUpperBits((uint32_t)i);
@@ -71,7 +71,7 @@ void nn::hac::SystemCallHandler::exportKernelCapabilityList(fnd::List<KernelCapa
 		entries[mSystemCalls[i] / 24].setSystemCallLowerBits(entries[mSystemCalls[i] / 24].getSystemCallLowerBits() | BIT(mSystemCalls[i] % 24));
 	}
 
-	for (size_t i = 0; i < entries.size(); i++)
+	for (size_t i = 0; i < kSyscallTotalEntryNum; i++)
 	{
 		if (entries[i].getSystemCallLowerBits() != 0)
 		{

lib/liblz4/liblz4.vcxproj.filters

@@ -15,8 +15,8 @@
     </Filter>
   </ItemGroup>
   <ItemGroup>
-    <ClInclude Include="source\lz4.h">
+    <ClInclude Include="include\lz4.h">
-      <Filter>Source Files</Filter>
+      <Filter>Header Files</Filter>
     </ClInclude>
   </ItemGroup>
   <ItemGroup>

lib/libpolarssl/include/polarssl/config.h

@@ -506,7 +506,7 @@
  *
  * This module provides the CTR_DRBG AES-256 random number generator.
  */
-//#define POLARSSL_CTR_DRBG_C
+#define POLARSSL_CTR_DRBG_C
 
 /**
  * \def POLARSSL_DEBUG_C
@@ -578,7 +578,7 @@
  *
  * This module provides a generic entropy pool
  */
-//#define POLARSSL_ENTROPY_C
+#define POLARSSL_ENTROPY_C
 
 /**
  * \def POLARSSL_ERROR_C
@@ -838,7 +838,7 @@
  *
  * This module adds support for SHA-384 and SHA-512.
  */
-//#define POLARSSL_SHA4_C
+#define POLARSSL_SHA4_C
 
 /**
  * \def POLARSSL_SSL_CACHE_C

lib/libpolarssl/include/polarssl/ctr_drbg.h

@@ -0,0 +1,234 @@
+/**
+ * \file ctr_drbg.h
+ *
+ * \brief CTR_DRBG based on AES-256 (NIST SP 800-90)
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+#ifndef POLARSSL_CTR_DRBG_H
+#define POLARSSL_CTR_DRBG_H
+
+#include <string.h>
+
+#include "aes.h"
+
+#define POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED        -0x0034  /**< The entropy source failed. */
+#define POLARSSL_ERR_CTR_DRBG_REQUEST_TOO_BIG              -0x0036  /**< Too many random requested in single call. */
+#define POLARSSL_ERR_CTR_DRBG_INPUT_TOO_BIG                -0x0038  /**< Input too large (Entropy + additional). */
+#define POLARSSL_ERR_CTR_DRBG_FILE_IO_ERROR                -0x003A  /**< Read/write error in file. */
+
+#define CTR_DRBG_BLOCKSIZE          16      /**< Block size used by the cipher                  */
+#define CTR_DRBG_KEYSIZE            32      /**< Key size used by the cipher                    */
+#define CTR_DRBG_KEYBITS            ( CTR_DRBG_KEYSIZE * 8 )
+#define CTR_DRBG_SEEDLEN            ( CTR_DRBG_KEYSIZE + CTR_DRBG_BLOCKSIZE )
+                                            /**< The seed length (counter + AES key)            */
+
+#if !defined(POLARSSL_CONFIG_OPTIONS)
+#define CTR_DRBG_ENTROPY_LEN        48      /**< Amount of entropy used per seed by default */
+#define CTR_DRBG_RESEED_INTERVAL    10000   /**< Interval before reseed is performed by default */
+#define CTR_DRBG_MAX_INPUT          256     /**< Maximum number of additional input bytes */
+#define CTR_DRBG_MAX_REQUEST        1024    /**< Maximum number of requested bytes per call */
+#define CTR_DRBG_MAX_SEED_INPUT     384     /**< Maximum size of (re)seed buffer */
+#endif /* !POLARSSL_CONFIG_OPTIONS */
+
+#define CTR_DRBG_PR_OFF             0       /**< No prediction resistance       */
+#define CTR_DRBG_PR_ON              1       /**< Prediction resistance enabled  */
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/**
+ * \brief          CTR_DRBG context structure
+ */
+typedef struct
+{
+    unsigned char counter[16];  /*!<  counter (V)       */
+    int reseed_counter;         /*!<  reseed counter    */
+    int prediction_resistance;  /*!<  enable prediction resistance (Automatic
+                                      reseed before every random generation)        */
+    size_t entropy_len;         /*!<  amount of entropy grabbed on each (re)seed    */
+    int reseed_interval;        /*!<  reseed interval   */
+
+    aes_context aes_ctx;        /*!<  AES context       */
+
+    /*
+     * Callbacks (Entropy)
+     */
+    int (*f_entropy)(void *, unsigned char *, size_t);
+
+    void *p_entropy;            /*!<  context for the entropy function */
+}
+ctr_drbg_context;
+
+/**
+ * \brief               CTR_DRBG initialization
+ * 
+ * Note: Personalization data can be provided in addition to the more generic
+ *       entropy source to make this instantiation as unique as possible.
+ *
+ * \param ctx           CTR_DRBG context to be initialized
+ * \param f_entropy     Entropy callback (p_entropy, buffer to fill, buffer
+ *                      length)
+ * \param p_entropy     Entropy context
+ * \param custom        Personalization data (Device specific identifiers)
+ *                      (Can be NULL)
+ * \param len           Length of personalization data
+ *
+ * \return              0 if successful, or
+ *                      POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED
+ */
+int ctr_drbg_init( ctr_drbg_context *ctx,
+                   int (*f_entropy)(void *, unsigned char *, size_t),
+                   void *p_entropy,
+                   const unsigned char *custom,
+                   size_t len );
+
+/**
+ * \brief               Enable / disable prediction resistance (Default: Off)
+ *
+ * Note: If enabled, entropy is used for ctx->entropy_len before each call!
+ *       Only use this if you have ample supply of good entropy!
+ *
+ * \param ctx           CTR_DRBG context
+ * \param resistance    CTR_DRBG_PR_ON or CTR_DRBG_PR_OFF
+ */
+void ctr_drbg_set_prediction_resistance( ctr_drbg_context *ctx,
+                                         int resistance );
+
+/**
+ * \brief               Set the amount of entropy grabbed on each (re)seed
+ *                      (Default: CTR_DRBG_ENTROPY_LEN)
+ *
+ * \param ctx           CTR_DRBG context
+ * \param len           Amount of entropy to grab
+ */
+void ctr_drbg_set_entropy_len( ctr_drbg_context *ctx,
+                               size_t len );
+
+/**
+ * \brief               Set the reseed interval
+ *                      (Default: CTR_DRBG_RESEED_INTERVAL)
+ *
+ * \param ctx           CTR_DRBG context
+ * \param interval      Reseed interval
+ */
+void ctr_drbg_set_reseed_interval( ctr_drbg_context *ctx,
+                                   int interval );
+
+/**
+ * \brief               CTR_DRBG reseeding (extracts data from entropy source)
+ * 
+ * \param ctx           CTR_DRBG context
+ * \param additional    Additional data to add to state (Can be NULL)
+ * \param len           Length of additional data
+ *
+ * \return              0 if successful, or
+ *                      POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED
+ */
+int ctr_drbg_reseed( ctr_drbg_context *ctx,
+                     const unsigned char *additional, size_t len );
+
+/**
+ * \brief               CTR_DRBG update state
+ *
+ * \param ctx           CTR_DRBG context
+ * \param additional    Additional data to update state with
+ * \param add_len       Length of additional data
+ *
+ * \note                If add_len is greater than CTR_DRBG_MAX_SEED_INPUT,
+ *                      only the first CTR_DRBG_MAX_SEED_INPUT bytes are used,
+ *                      the remaining ones are silently discarded.
+ */
+void ctr_drbg_update( ctr_drbg_context *ctx,
+                      const unsigned char *additional, size_t add_len );
+
+/**
+ * \brief               CTR_DRBG generate random with additional update input
+ *
+ * Note: Automatically reseeds if reseed_counter is reached.
+ *
+ * \param p_rng         CTR_DRBG context
+ * \param output        Buffer to fill
+ * \param output_len    Length of the buffer
+ * \param additional    Additional data to update with (Can be NULL)
+ * \param add_len       Length of additional data
+ *
+ * \return              0 if successful, or
+ *                      POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED, or
+ *                      POLARSSL_ERR_CTR_DRBG_REQUEST_TOO_BIG
+ */
+int ctr_drbg_random_with_add( void *p_rng,
+                              unsigned char *output, size_t output_len,
+                              const unsigned char *additional, size_t add_len );
+
+/**
+ * \brief               CTR_DRBG generate random
+ *
+ * Note: Automatically reseeds if reseed_counter is reached.
+ *
+ * \param p_rng         CTR_DRBG context
+ * \param output        Buffer to fill
+ * \param output_len    Length of the buffer
+ *
+ * \return              0 if successful, or
+ *                      POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED, or
+ *                      POLARSSL_ERR_CTR_DRBG_REQUEST_TOO_BIG
+ */
+int ctr_drbg_random( void *p_rng,
+                     unsigned char *output, size_t output_len );
+
+#if defined(POLARSSL_FS_IO)
+/**
+ * \brief               Write a seed file
+ *
+ * \param path          Name of the file
+ *
+ * \return              0 if successful,
+ *                      POLARSSL_ERR_CTR_DRBG_FILE_IO_ERROR on file error, or
+ *                      POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED
+ */
+int ctr_drbg_write_seed_file( ctr_drbg_context *ctx, const char *path );
+
+/**
+ * \brief               Read and update a seed file. Seed is added to this
+ *                      instance
+ *
+ * \param path          Name of the file
+ *
+ * \return              0 if successful,
+ *                      POLARSSL_ERR_CTR_DRBG_FILE_IO_ERROR on file error,
+ *                      POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED or
+ *                      POLARSSL_ERR_CTR_DRBG_INPUT_TOO_BIG
+ */
+int ctr_drbg_update_seed_file( ctr_drbg_context *ctx, const char *path );
+#endif
+
+/**
+ * \brief               Checkup routine
+ *
+ * \return              0 if successful, or 1 if the test failed
+ */
+int ctr_drbg_self_test( int verbose );
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* ctr_drbg.h */

lib/libpolarssl/include/polarssl/entropy.h

@@ -0,0 +1,180 @@
+/**
+ * \file entropy.h
+ *
+ * \brief Entropy accumulator implementation
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+#ifndef POLARSSL_ENTROPY_H
+#define POLARSSL_ENTROPY_H
+
+#include <string.h>
+
+#include "config.h"
+
+#include "sha4.h"
+#if defined(POLARSSL_HAVEGE_C)
+#include "havege.h"
+#endif
+
+#define POLARSSL_ERR_ENTROPY_SOURCE_FAILED                 -0x003C  /**< Critical entropy source failure. */
+#define POLARSSL_ERR_ENTROPY_MAX_SOURCES                   -0x003E  /**< No more sources can be added. */
+#define POLARSSL_ERR_ENTROPY_NO_SOURCES_DEFINED            -0x0040  /**< No sources have been added to poll. */
+#define POLARSSL_ERR_ENTROPY_FILE_IO_ERROR                 -0x0058  /**< Read/write error in file. */
+
+#if !defined(POLARSSL_CONFIG_OPTIONS)
+#define ENTROPY_MAX_SOURCES     20      /**< Maximum number of sources supported */
+#define ENTROPY_MAX_GATHER      128     /**< Maximum amount requested from entropy sources */
+#endif /* !POLARSSL_CONFIG_OPTIONS  */
+
+#define ENTROPY_BLOCK_SIZE      64      /**< Block size of entropy accumulator (SHA-512) */
+
+#define ENTROPY_MAX_SEED_SIZE   1024    /**< Maximum size of seed we read from seed file */
+#define ENTROPY_SOURCE_MANUAL   ENTROPY_MAX_SOURCES
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/**
+ * \brief           Entropy poll callback pointer
+ *
+ * \param data      Callback-specific data pointer
+ * \param output    Data to fill
+ * \param len       Maximum size to provide
+ * \param olen      The actual amount of bytes put into the buffer (Can be 0)
+ *
+ * \return          0 if no critical failures occurred,
+ *                  POLARSSL_ERR_ENTROPY_SOURCE_FAILED otherwise
+ */
+typedef int (*f_source_ptr)(void *data, unsigned char *output, size_t len, size_t *olen);
+
+/**
+ * \brief           Entropy source state
+ */
+typedef struct
+{
+    f_source_ptr    f_source;   /**< The entropy source callback */
+    void *          p_source;   /**< The callback data pointer */
+    size_t          size;       /**< Amount received */
+    size_t          threshold;  /**< Minimum level required before release */
+}
+source_state;
+
+/**
+ * \brief           Entropy context structure
+ */
+typedef struct 
+{
+    sha4_context    accumulator;
+    int             source_count;
+    source_state    source[ENTROPY_MAX_SOURCES];
+#if defined(POLARSSL_HAVEGE_C)
+    havege_state    havege_data;
+#endif
+}
+entropy_context;
+
+/**
+ * \brief           Initialize the context
+ *
+ * \param ctx       Entropy context to initialize
+ */
+void entropy_init( entropy_context *ctx );
+
+/**
+ * \brief           Adds an entropy source to poll
+ *
+ * \param ctx       Entropy context
+ * \param f_source  Entropy function
+ * \param p_source  Function data
+ * \param threshold Minimum required from source before entropy is released
+ *                  ( with entropy_func() )
+ *
+ * \return          0 if successful or POLARSSL_ERR_ENTROPY_MAX_SOURCES
+ */
+int entropy_add_source( entropy_context *ctx,
+                        f_source_ptr f_source, void *p_source,
+                        size_t threshold );
+
+/**
+ * \brief           Trigger an extra gather poll for the accumulator
+ *
+ * \param ctx       Entropy context
+ *
+ * \return          0 if successful, or POLARSSL_ERR_ENTROPY_SOURCE_FAILED
+ */
+int entropy_gather( entropy_context *ctx );
+
+/**
+ * \brief           Retrieve entropy from the accumulator (Max ENTROPY_BLOCK_SIZE)
+ *
+ * \param data      Entropy context
+ * \param output    Buffer to fill
+ * \param len       Length of buffer
+ *
+ * \return          0 if successful, or POLARSSL_ERR_ENTROPY_SOURCE_FAILED
+ */
+int entropy_func( void *data, unsigned char *output, size_t len );
+
+/**
+ * \brief           Add data to the accumulator manually
+ * 
+ * \param ctx       Entropy context
+ * \param data      Data to add
+ * \param len       Length of data
+ *
+ * \return          0 if successful
+ */
+int entropy_update_manual( entropy_context *ctx,
+                           const unsigned char *data, size_t len );
+
+#if defined(POLARSSL_FS_IO)
+/**
+ * \brief               Write a seed file
+ *
+ * \param ctx           Entropy context
+ * \param path          Name of the file
+ *
+ * \return              0 if successful,
+ *                      POLARSSL_ERR_ENTROPY_FILE_IO_ERROR on file error, or
+ *                      POLARSSL_ERR_ENTROPY_SOURCE_FAILED
+ */
+int entropy_write_seed_file( entropy_context *ctx, const char *path );
+
+/**
+ * \brief               Read and update a seed file. Seed is added to this
+ *                      instance. No more than ENTROPY_MAX_SEED_SIZE bytes are
+ *                      read from the seed file. The rest is ignored.
+ *
+ * \param ctx           Entropy context
+ * \param path          Name of the file
+ *
+ * \return              0 if successful,
+ *                      POLARSSL_ERR_ENTROPY_FILE_IO_ERROR on file error,
+ *                      POLARSSL_ERR_ENTROPY_SOURCE_FAILED
+ */
+int entropy_update_seed_file( entropy_context *ctx, const char *path );
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* entropy.h */

lib/libpolarssl/include/polarssl/entropy_poll.h

@@ -0,0 +1,72 @@
+/**
+ * \file entropy_poll.h
+ *
+ * \brief Platform-specific and custom entropy polling functions
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+#ifndef POLARSSL_ENTROPY_POLL_H
+#define POLARSSL_ENTROPY_POLL_H
+
+#include <string.h>
+
+#include "config.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/*
+ * Default thresholds for built-in sources
+ */
+#define ENTROPY_MIN_PLATFORM    128     /**< Minimum for platform source    */
+#define ENTROPY_MIN_HAVEGE      128     /**< Minimum for HAVEGE             */
+#define ENTROPY_MIN_HARDCLOCK    32     /**< Minimum for hardclock()        */
+
+#if !defined(POLARSSL_NO_PLATFORM_ENTROPY)
+/**
+ * \brief           Platform-specific entropy poll callback
+ */
+int platform_entropy_poll( void *data,
+                           unsigned char *output, size_t len, size_t *olen );
+#endif
+
+#if defined(POLARSSL_HAVEGE_C)
+/**
+ * \brief           HAVEGE based entropy poll callback
+ *
+ * Requires an HAVEGE state as its data pointer.
+ */
+int havege_poll( void *data,
+                 unsigned char *output, size_t len, size_t *olen );
+#endif
+
+#if defined(POLARSSL_TIMING_C)
+/**
+ * \brief           hardclock-based entropy poll callback
+ */
+int hardclock_poll( void *data,
+                    unsigned char *output, size_t len, size_t *olen );
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* entropy_poll.h */

lib/libpolarssl/include/polarssl/sha4.h

@@ -0,0 +1,183 @@
+/**
+ * \file sha4.h
+ *
+ * \brief SHA-384 and SHA-512 cryptographic hash function
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+#ifndef POLARSSL_SHA4_H
+#define POLARSSL_SHA4_H
+
+#include "config.h"
+
+#include <string.h>
+
+#if defined(_MSC_VER) || defined(__WATCOMC__)
+  #define UL64(x) x##ui64
+  typedef unsigned __int64 uint64_t;
+#else
+  #include <inttypes.h>
+  #define UL64(x) x##ULL
+#endif
+
+#define POLARSSL_ERR_SHA4_FILE_IO_ERROR                -0x007A  /**< Read/write error in file. */
+
+#if !defined(POLARSSL_SHA1_ALT)
+// Regular implementation
+//
+
+/**
+ * \brief          SHA-512 context structure
+ */
+typedef struct
+{
+    uint64_t total[2];          /*!< number of bytes processed  */
+    uint64_t state[8];          /*!< intermediate digest state  */
+    unsigned char buffer[128];  /*!< data block being processed */
+
+    unsigned char ipad[128];    /*!< HMAC: inner padding        */
+    unsigned char opad[128];    /*!< HMAC: outer padding        */
+    int is384;                  /*!< 0 => SHA-512, else SHA-384 */
+}
+sha4_context;
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/**
+ * \brief          SHA-512 context setup
+ *
+ * \param ctx      context to be initialized
+ * \param is384    0 = use SHA512, 1 = use SHA384
+ */
+void sha4_starts( sha4_context *ctx, int is384 );
+
+/**
+ * \brief          SHA-512 process buffer
+ *
+ * \param ctx      SHA-512 context
+ * \param input    buffer holding the  data
+ * \param ilen     length of the input data
+ */
+void sha4_update( sha4_context *ctx, const unsigned char *input, size_t ilen );
+
+/**
+ * \brief          SHA-512 final digest
+ *
+ * \param ctx      SHA-512 context
+ * \param output   SHA-384/512 checksum result
+ */
+void sha4_finish( sha4_context *ctx, unsigned char output[64] );
+
+#ifdef __cplusplus
+}
+#endif
+
+#else  /* POLARSSL_SHA4_ALT */
+#include "sha4_alt.h"
+#endif /* POLARSSL_SHA4_ALT */
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/**
+ * \brief          Output = SHA-512( input buffer )
+ *
+ * \param input    buffer holding the  data
+ * \param ilen     length of the input data
+ * \param output   SHA-384/512 checksum result
+ * \param is384    0 = use SHA512, 1 = use SHA384
+ */
+void sha4( const unsigned char *input, size_t ilen,
+           unsigned char output[64], int is384 );
+
+/**
+ * \brief          Output = SHA-512( file contents )
+ *
+ * \param path     input file name
+ * \param output   SHA-384/512 checksum result
+ * \param is384    0 = use SHA512, 1 = use SHA384
+ *
+ * \return         0 if successful, or POLARSSL_ERR_SHA4_FILE_IO_ERROR
+ */
+int sha4_file( const char *path, unsigned char output[64], int is384 );
+
+/**
+ * \brief          SHA-512 HMAC context setup
+ *
+ * \param ctx      HMAC context to be initialized
+ * \param is384    0 = use SHA512, 1 = use SHA384
+ * \param key      HMAC secret key
+ * \param keylen   length of the HMAC key
+ */
+void sha4_hmac_starts( sha4_context *ctx, const unsigned char *key, size_t keylen,
+                       int is384 );
+
+/**
+ * \brief          SHA-512 HMAC process buffer
+ *
+ * \param ctx      HMAC context
+ * \param input    buffer holding the  data
+ * \param ilen     length of the input data
+ */
+void sha4_hmac_update( sha4_context *ctx, const unsigned char *input, size_t ilen );
+
+/**
+ * \brief          SHA-512 HMAC final digest
+ *
+ * \param ctx      HMAC context
+ * \param output   SHA-384/512 HMAC checksum result
+ */
+void sha4_hmac_finish( sha4_context *ctx, unsigned char output[64] );
+
+/**
+ * \brief          SHA-512 HMAC context reset
+ *
+ * \param ctx      HMAC context to be reset
+ */
+void sha4_hmac_reset( sha4_context *ctx );
+
+/**
+ * \brief          Output = HMAC-SHA-512( hmac key, input buffer )
+ *
+ * \param key      HMAC secret key
+ * \param keylen   length of the HMAC key
+ * \param input    buffer holding the  data
+ * \param ilen     length of the input data
+ * \param output   HMAC-SHA-384/512 result
+ * \param is384    0 = use SHA512, 1 = use SHA384
+ */
+void sha4_hmac( const unsigned char *key, size_t keylen,
+                const unsigned char *input, size_t ilen,
+                unsigned char output[64], int is384 );
+
+/**
+ * \brief          Checkup routine
+ *
+ * \return         0 if successful, or 1 if the test failed
+ */
+int sha4_self_test( int verbose );
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* sha4.h */

lib/libpolarssl/libpolarssl.vcxproj

@@ -21,7 +21,7 @@
   <PropertyGroup Label="Globals">
     <VCProjectVersion>15.0</VCProjectVersion>
     <ProjectGuid>{394EFC16-BD3A-4538-B33D-7BA1EDB8DAC1}</ProjectGuid>
-    <WindowsTargetPlatformVersion>10.0.15063.0</WindowsTargetPlatformVersion>
+    <WindowsTargetPlatformVersion>10.0.16299.0</WindowsTargetPlatformVersion>
   </PropertyGroup>
   <Import Project="$(VCTargetsPath)\Microsoft.Cpp.Default.props" />
   <PropertyGroup Condition="'$(Configuration)|$(Platform)'=='Debug|Win32'" Label="Configuration">
@@ -117,30 +117,38 @@
       <OptimizeReferences>true</OptimizeReferences>
     </Link>
   </ItemDefinitionGroup>
+  <ItemGroup>
+    <None Include="makefile" />
+  </ItemGroup>
   <ItemGroup>
     <ClInclude Include="include\polarssl\aes.h" />
     <ClInclude Include="include\polarssl\base64.h" />
     <ClInclude Include="include\polarssl\bignum.h" />
     <ClInclude Include="include\polarssl\bn_mul.h" />
     <ClInclude Include="include\polarssl\config.h" />
+    <ClInclude Include="include\polarssl\ctr_drbg.h" />
+    <ClInclude Include="include\polarssl\entropy.h" />
+    <ClInclude Include="include\polarssl\entropy_poll.h" />
     <ClInclude Include="include\polarssl\md.h" />
     <ClInclude Include="include\polarssl\md_wrap.h" />
     <ClInclude Include="include\polarssl\rsa.h" />
     <ClInclude Include="include\polarssl\sha1.h" />
     <ClInclude Include="include\polarssl\sha2.h" />
+    <ClInclude Include="include\polarssl\sha4.h" />
   </ItemGroup>
   <ItemGroup>
     <ClCompile Include="source\aes.c" />
     <ClCompile Include="source\base64.c" />
     <ClCompile Include="source\bignum.c" />
+    <ClCompile Include="source\ctr_drbg.c" />
+    <ClCompile Include="source\entropy.c" />
+    <ClCompile Include="source\entropy_poll.c" />
     <ClCompile Include="source\md.c" />
     <ClCompile Include="source\md_wrap.c" />
     <ClCompile Include="source\rsa.c" />
     <ClCompile Include="source\sha1.c" />
     <ClCompile Include="source\sha2.c" />
-  </ItemGroup>
+    <ClCompile Include="source\sha4.c" />
-  <ItemGroup>
-    <None Include="makefile" />
   </ItemGroup>
   <Import Project="$(VCTargetsPath)\Microsoft.Cpp.targets" />
   <ImportGroup Label="ExtensionTargets">

lib/libpolarssl/libpolarssl.vcxproj.filters

@@ -14,6 +14,9 @@
       <Extensions>rc;ico;cur;bmp;dlg;rc2;rct;bin;rgs;gif;jpg;jpeg;jpe;resx;tiff;tif;png;wav;mfcribbon-ms</Extensions>
     </Filter>
   </ItemGroup>
+  <ItemGroup>
+    <None Include="makefile" />
+  </ItemGroup>
   <ItemGroup>
     <ClInclude Include="include\polarssl\aes.h">
       <Filter>Header Files</Filter>
@@ -30,6 +33,21 @@
     <ClInclude Include="include\polarssl\config.h">
       <Filter>Header Files</Filter>
     </ClInclude>
+    <ClInclude Include="include\polarssl\ctr_drbg.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
+    <ClInclude Include="include\polarssl\entropy.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
+    <ClInclude Include="include\polarssl\entropy_poll.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
+    <ClInclude Include="include\polarssl\md.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
+    <ClInclude Include="include\polarssl\md_wrap.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
     <ClInclude Include="include\polarssl\rsa.h">
       <Filter>Header Files</Filter>
     </ClInclude>
@@ -39,10 +57,7 @@
     <ClInclude Include="include\polarssl\sha2.h">
       <Filter>Header Files</Filter>
     </ClInclude>
-    <ClInclude Include="include\polarssl\md.h">
+    <ClInclude Include="include\polarssl\sha4.h">
-      <Filter>Header Files</Filter>
-    </ClInclude>
-    <ClInclude Include="include\polarssl\md_wrap.h">
       <Filter>Header Files</Filter>
     </ClInclude>
   </ItemGroup>
@@ -56,6 +71,15 @@
     <ClCompile Include="source\bignum.c">
       <Filter>Source Files</Filter>
     </ClCompile>
+    <ClCompile Include="source\ctr_drbg.c">
+      <Filter>Source Files</Filter>
+    </ClCompile>
+    <ClCompile Include="source\entropy.c">
+      <Filter>Source Files</Filter>
+    </ClCompile>
+    <ClCompile Include="source\entropy_poll.c">
+      <Filter>Source Files</Filter>
+    </ClCompile>
     <ClCompile Include="source\md.c">
       <Filter>Source Files</Filter>
     </ClCompile>
@@ -71,8 +95,8 @@
     <ClCompile Include="source\sha2.c">
       <Filter>Source Files</Filter>
     </ClCompile>
-  </ItemGroup>
+    <ClCompile Include="source\sha4.c">
-  <ItemGroup>
+      <Filter>Source Files</Filter>
-    <None Include="makefile" />
+    </ClCompile>
   </ItemGroup>
 </Project>

lib/libpolarssl/source/ctr_drbg.c

@@ -0,0 +1,582 @@
+/*
+ *  CTR_DRBG implementation based on AES-256 (NIST SP 800-90)
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+/*
+ *  The NIST SP 800-90 DRBGs are described in the following publucation.
+ *
+ *  http://csrc.nist.gov/publications/nistpubs/800-90/SP800-90revised_March2007.pdf
+ */
+
+#include "polarssl/config.h"
+
+#if defined(POLARSSL_CTR_DRBG_C)
+
+#include "polarssl/ctr_drbg.h"
+
+#if defined(POLARSSL_FS_IO)
+#include <stdio.h>
+#endif
+
+/*
+ * Non-public function wrapped by ctr_crbg_init(). Necessary to allow NIST
+ * tests to succeed (which require known length fixed entropy)
+ */
+int ctr_drbg_init_entropy_len(
+                   ctr_drbg_context *ctx,
+                   int (*f_entropy)(void *, unsigned char *, size_t),
+                   void *p_entropy,
+                   const unsigned char *custom,
+                   size_t len,
+                   size_t entropy_len );
+
+int ctr_drbg_init_entropy_len(
+                   ctr_drbg_context *ctx,
+                   int (*f_entropy)(void *, unsigned char *, size_t),
+                   void *p_entropy,
+                   const unsigned char *custom,
+                   size_t len,
+                   size_t entropy_len )
+{
+    int ret;
+    unsigned char key[CTR_DRBG_KEYSIZE];
+
+    memset( ctx, 0, sizeof(ctr_drbg_context) );
+    memset( key, 0, CTR_DRBG_KEYSIZE );
+
+    ctx->f_entropy = f_entropy;
+    ctx->p_entropy = p_entropy;
+
+    ctx->entropy_len = entropy_len;
+    ctx->reseed_interval = CTR_DRBG_RESEED_INTERVAL;
+
+    /*
+     * Initialize with an empty key
+     */
+    aes_setkey_enc( &ctx->aes_ctx, key, CTR_DRBG_KEYBITS );
+
+    if( ( ret = ctr_drbg_reseed( ctx, custom, len ) ) != 0 )
+        return( ret );
+
+    return( 0 );
+}
+
+int ctr_drbg_init( ctr_drbg_context *ctx,
+                   int (*f_entropy)(void *, unsigned char *, size_t),
+                   void *p_entropy,
+                   const unsigned char *custom,
+                   size_t len )
+{
+    return( ctr_drbg_init_entropy_len( ctx, f_entropy, p_entropy, custom, len,
+                                       CTR_DRBG_ENTROPY_LEN ) );
+}
+
+void ctr_drbg_set_prediction_resistance( ctr_drbg_context *ctx, int resistance )
+{
+    ctx->prediction_resistance = resistance;
+}
+
+void ctr_drbg_set_entropy_len( ctr_drbg_context *ctx, size_t len )
+{
+    ctx->entropy_len = len;
+}
+    
+void ctr_drbg_set_reseed_interval( ctr_drbg_context *ctx, int interval )
+{
+    ctx->reseed_interval = interval;
+}
+    
+static int block_cipher_df( unsigned char *output,
+                            const unsigned char *data, size_t data_len )
+{
+    unsigned char buf[CTR_DRBG_MAX_SEED_INPUT + CTR_DRBG_BLOCKSIZE + 16];
+    unsigned char tmp[CTR_DRBG_SEEDLEN];
+    unsigned char key[CTR_DRBG_KEYSIZE];
+    unsigned char chain[CTR_DRBG_BLOCKSIZE];
+    unsigned char *p, *iv;
+    aes_context aes_ctx;
+
+    int i, j, buf_len, use_len;
+
+    if( data_len > CTR_DRBG_MAX_SEED_INPUT )
+        return( POLARSSL_ERR_CTR_DRBG_INPUT_TOO_BIG );
+
+    memset( buf, 0, CTR_DRBG_MAX_SEED_INPUT + CTR_DRBG_BLOCKSIZE + 16 );
+
+    /*
+     * Construct IV (16 bytes) and S in buffer
+     * IV = Counter (in 32-bits) padded to 16 with zeroes
+     * S = Length input string (in 32-bits) || Length of output (in 32-bits) ||
+     *     data || 0x80
+     *     (Total is padded to a multiple of 16-bytes with zeroes)
+     */
+    p = buf + CTR_DRBG_BLOCKSIZE;
+    *p++ = ( data_len >> 24 ) & 0xff;
+    *p++ = ( data_len >> 16 ) & 0xff;
+    *p++ = ( data_len >> 8  ) & 0xff;
+    *p++ = ( data_len       ) & 0xff;
+    p += 3;
+    *p++ = CTR_DRBG_SEEDLEN;
+    memcpy( p, data, data_len );
+    p[data_len] = 0x80;
+
+    buf_len = CTR_DRBG_BLOCKSIZE + 8 + data_len + 1;
+
+    for( i = 0; i < CTR_DRBG_KEYSIZE; i++ )
+        key[i] = i;
+
+    aes_setkey_enc( &aes_ctx, key, CTR_DRBG_KEYBITS );
+
+    /*
+     * Reduce data to POLARSSL_CTR_DRBG_SEEDLEN bytes of data
+     */
+    for( j = 0; j < CTR_DRBG_SEEDLEN; j += CTR_DRBG_BLOCKSIZE )
+    {
+        p = buf;
+        memset( chain, 0, CTR_DRBG_BLOCKSIZE );
+        use_len = buf_len;
+
+        while( use_len > 0 )
+        {
+            for( i = 0; i < CTR_DRBG_BLOCKSIZE; i++ )
+                chain[i] ^= p[i];
+            p += CTR_DRBG_BLOCKSIZE;
+            use_len -= CTR_DRBG_BLOCKSIZE;
+
+            aes_crypt_ecb( &aes_ctx, AES_ENCRYPT, chain, chain );
+        }
+        
+        memcpy( tmp + j, chain, CTR_DRBG_BLOCKSIZE );
+
+        /*
+         * Update IV
+         */
+        buf[3]++;
+    }
+
+    /*
+     * Do final encryption with reduced data
+     */
+    aes_setkey_enc( &aes_ctx, tmp, CTR_DRBG_KEYBITS );
+    iv = tmp + CTR_DRBG_KEYSIZE;
+    p = output;
+
+    for( j = 0; j < CTR_DRBG_SEEDLEN; j += CTR_DRBG_BLOCKSIZE )
+    {
+        aes_crypt_ecb( &aes_ctx, AES_ENCRYPT, iv, iv );
+        memcpy( p, iv, CTR_DRBG_BLOCKSIZE );
+        p += CTR_DRBG_BLOCKSIZE;
+    }
+
+    return( 0 );
+}
+
+static int ctr_drbg_update_internal( ctr_drbg_context *ctx,
+                                    const unsigned char data[CTR_DRBG_SEEDLEN] )
+{
+    unsigned char tmp[CTR_DRBG_SEEDLEN];
+    unsigned char *p = tmp;
+    int i, j;
+
+    memset( tmp, 0, CTR_DRBG_SEEDLEN );
+
+    for( j = 0; j < CTR_DRBG_SEEDLEN; j += CTR_DRBG_BLOCKSIZE )
+    {
+        /*
+         * Increase counter
+         */
+        for( i = CTR_DRBG_BLOCKSIZE; i > 0; i-- )
+            if( ++ctx->counter[i - 1] != 0 )
+                break;
+
+        /*
+         * Crypt counter block
+         */
+        aes_crypt_ecb( &ctx->aes_ctx, AES_ENCRYPT, ctx->counter, p );
+
+        p += CTR_DRBG_BLOCKSIZE;
+    }
+
+    for( i = 0; i < CTR_DRBG_SEEDLEN; i++ )
+        tmp[i] ^= data[i];
+
+    /*
+     * Update key and counter
+     */
+    aes_setkey_enc( &ctx->aes_ctx, tmp, CTR_DRBG_KEYBITS );
+    memcpy( ctx->counter, tmp + CTR_DRBG_KEYSIZE, CTR_DRBG_BLOCKSIZE );
+
+    return( 0 );
+}
+
+void ctr_drbg_update( ctr_drbg_context *ctx,
+                      const unsigned char *additional, size_t add_len )
+{
+    unsigned char add_input[CTR_DRBG_SEEDLEN];
+
+    if( add_len > 0 )
+    {
+        /* MAX_INPUT would be more logical here, but we have to match
+         * block_cipher_df()'s limits since we can't propagate errors */
+        if( add_len > CTR_DRBG_MAX_SEED_INPUT )
+            add_len = CTR_DRBG_MAX_SEED_INPUT;
+
+        block_cipher_df( add_input, additional, add_len );
+        ctr_drbg_update_internal( ctx, add_input );
+    }
+}
+
+int ctr_drbg_reseed( ctr_drbg_context *ctx,
+                     const unsigned char *additional, size_t len )
+{
+    unsigned char seed[CTR_DRBG_MAX_SEED_INPUT];
+    size_t seedlen = 0;
+
+    if( ctx->entropy_len + len > CTR_DRBG_MAX_SEED_INPUT )
+        return( POLARSSL_ERR_CTR_DRBG_INPUT_TOO_BIG );
+
+    memset( seed, 0, CTR_DRBG_MAX_SEED_INPUT );
+
+    /*
+     * Gather enropy_len bytes of entropy to seed state
+     */
+    if( 0 != ctx->f_entropy( ctx->p_entropy, seed,
+                             ctx->entropy_len ) )
+    {
+        return( POLARSSL_ERR_CTR_DRBG_ENTROPY_SOURCE_FAILED );
+    }
+
+    seedlen += ctx->entropy_len;
+
+    /*
+     * Add additional data
+     */
+    if( additional && len )
+    {
+        memcpy( seed + seedlen, additional, len );
+        seedlen += len;
+    }
+
+    /*
+     * Reduce to 384 bits
+     */
+    block_cipher_df( seed, seed, seedlen );
+
+    /*
+     * Update state
+     */
+    ctr_drbg_update_internal( ctx, seed );
+    ctx->reseed_counter = 1;
+
+    return( 0 );
+}
+    
+int ctr_drbg_random_with_add( void *p_rng,
+                              unsigned char *output, size_t output_len,
+                              const unsigned char *additional, size_t add_len )
+{
+    int ret = 0;
+    ctr_drbg_context *ctx = (ctr_drbg_context *) p_rng;
+    unsigned char add_input[CTR_DRBG_SEEDLEN];
+    unsigned char *p = output;
+    unsigned char tmp[CTR_DRBG_BLOCKSIZE];
+    int i;
+    size_t use_len;
+
+    if( output_len > CTR_DRBG_MAX_REQUEST )
+        return( POLARSSL_ERR_CTR_DRBG_REQUEST_TOO_BIG );
+
+    if( add_len > CTR_DRBG_MAX_INPUT )
+        return( POLARSSL_ERR_CTR_DRBG_INPUT_TOO_BIG );
+
+    memset( add_input, 0, CTR_DRBG_SEEDLEN );
+
+    if( ctx->reseed_counter > ctx->reseed_interval ||
+        ctx->prediction_resistance )
+    {
+        if( ( ret = ctr_drbg_reseed( ctx, additional, add_len ) ) != 0 )
+            return( ret );
+
+        add_len = 0;
+    }
+
+    if( add_len > 0 )
+    {
+        block_cipher_df( add_input, additional, add_len );
+        ctr_drbg_update_internal( ctx, add_input );
+    }
+
+    while( output_len > 0 )
+    {
+        /*
+         * Increase counter
+         */
+        for( i = CTR_DRBG_BLOCKSIZE; i > 0; i-- )
+            if( ++ctx->counter[i - 1] != 0 )
+                break;
+
+        /*
+         * Crypt counter block
+         */
+        aes_crypt_ecb( &ctx->aes_ctx, AES_ENCRYPT, ctx->counter, tmp );
+
+        use_len = (output_len > CTR_DRBG_BLOCKSIZE ) ? CTR_DRBG_BLOCKSIZE : output_len;
+        /*
+         * Copy random block to destination
+         */
+        memcpy( p, tmp, use_len );
+        p += use_len;
+        output_len -= use_len;
+    }
+
+    ctr_drbg_update_internal( ctx, add_input );
+
+    ctx->reseed_counter++;
+
+    return( 0 );
+}
+
+int ctr_drbg_random( void *p_rng, unsigned char *output, size_t output_len )
+{
+    return ctr_drbg_random_with_add( p_rng, output, output_len, NULL, 0 );
+}
+
+#if defined(POLARSSL_FS_IO)
+int ctr_drbg_write_seed_file( ctr_drbg_context *ctx, const char *path )
+{
+    int ret;
+    FILE *f;
+    unsigned char buf[ CTR_DRBG_MAX_INPUT ];
+
+    if( ( f = fopen( path, "wb" ) ) == NULL )
+        return( POLARSSL_ERR_CTR_DRBG_FILE_IO_ERROR );
+
+    if( ( ret = ctr_drbg_random( ctx, buf, CTR_DRBG_MAX_INPUT ) ) != 0 )
+    {
+        fclose( f );
+        return( ret );
+    }
+
+    if( fwrite( buf, 1, CTR_DRBG_MAX_INPUT, f ) != CTR_DRBG_MAX_INPUT )
+    {
+        fclose( f );
+        return( POLARSSL_ERR_CTR_DRBG_FILE_IO_ERROR );
+    }
+
+    fclose( f );
+    return( 0 );
+}
+
+int ctr_drbg_update_seed_file( ctr_drbg_context *ctx, const char *path )
+{
+    FILE *f;
+    size_t n;
+    unsigned char buf[ CTR_DRBG_MAX_INPUT ];
+
+    if( ( f = fopen( path, "rb" ) ) == NULL )
+        return( POLARSSL_ERR_CTR_DRBG_FILE_IO_ERROR );
+
+    fseek( f, 0, SEEK_END );
+    n = (size_t) ftell( f );
+    fseek( f, 0, SEEK_SET );
+
+    if( n > CTR_DRBG_MAX_INPUT )
+    {
+        fclose( f );
+        return( POLARSSL_ERR_CTR_DRBG_INPUT_TOO_BIG );
+    }
+
+    if( fread( buf, 1, n, f ) != n )
+    {
+        fclose( f );
+        return( POLARSSL_ERR_CTR_DRBG_FILE_IO_ERROR );
+    }
+
+    ctr_drbg_update( ctx, buf, n );
+    
+    fclose( f );
+    
+    return( ctr_drbg_write_seed_file( ctx, path ) );
+}
+#endif /* POLARSSL_FS_IO */
+
+#if defined(POLARSSL_SELF_TEST)
+
+#include <stdio.h>
+
+unsigned char entropy_source_pr[96] =
+    { 0xc1, 0x80, 0x81, 0xa6, 0x5d, 0x44, 0x02, 0x16,
+      0x19, 0xb3, 0xf1, 0x80, 0xb1, 0xc9, 0x20, 0x02,
+      0x6a, 0x54, 0x6f, 0x0c, 0x70, 0x81, 0x49, 0x8b,
+      0x6e, 0xa6, 0x62, 0x52, 0x6d, 0x51, 0xb1, 0xcb,
+      0x58, 0x3b, 0xfa, 0xd5, 0x37, 0x5f, 0xfb, 0xc9,
+      0xff, 0x46, 0xd2, 0x19, 0xc7, 0x22, 0x3e, 0x95,
+      0x45, 0x9d, 0x82, 0xe1, 0xe7, 0x22, 0x9f, 0x63,
+      0x31, 0x69, 0xd2, 0x6b, 0x57, 0x47, 0x4f, 0xa3,
+      0x37, 0xc9, 0x98, 0x1c, 0x0b, 0xfb, 0x91, 0x31,
+      0x4d, 0x55, 0xb9, 0xe9, 0x1c, 0x5a, 0x5e, 0xe4,
+      0x93, 0x92, 0xcf, 0xc5, 0x23, 0x12, 0xd5, 0x56,
+      0x2c, 0x4a, 0x6e, 0xff, 0xdc, 0x10, 0xd0, 0x68 };
+
+unsigned char entropy_source_nopr[64] =
+    { 0x5a, 0x19, 0x4d, 0x5e, 0x2b, 0x31, 0x58, 0x14,
+      0x54, 0xde, 0xf6, 0x75, 0xfb, 0x79, 0x58, 0xfe,
+      0xc7, 0xdb, 0x87, 0x3e, 0x56, 0x89, 0xfc, 0x9d,
+      0x03, 0x21, 0x7c, 0x68, 0xd8, 0x03, 0x38, 0x20,
+      0xf9, 0xe6, 0x5e, 0x04, 0xd8, 0x56, 0xf3, 0xa9,
+      0xc4, 0x4a, 0x4c, 0xbd, 0xc1, 0xd0, 0x08, 0x46,
+      0xf5, 0x98, 0x3d, 0x77, 0x1c, 0x1b, 0x13, 0x7e,
+      0x4e, 0x0f, 0x9d, 0x8e, 0xf4, 0x09, 0xf9, 0x2e };
+
+unsigned char nonce_pers_pr[16] =
+    { 0xd2, 0x54, 0xfc, 0xff, 0x02, 0x1e, 0x69, 0xd2,
+      0x29, 0xc9, 0xcf, 0xad, 0x85, 0xfa, 0x48, 0x6c };
+
+unsigned char nonce_pers_nopr[16] =
+    { 0x1b, 0x54, 0xb8, 0xff, 0x06, 0x42, 0xbf, 0xf5,
+      0x21, 0xf1, 0x5c, 0x1c, 0x0b, 0x66, 0x5f, 0x3f };
+
+unsigned char result_pr[16] =
+    { 0x34, 0x01, 0x16, 0x56, 0xb4, 0x29, 0x00, 0x8f,
+      0x35, 0x63, 0xec, 0xb5, 0xf2, 0x59, 0x07, 0x23 };
+
+unsigned char result_nopr[16] =
+    { 0xa0, 0x54, 0x30, 0x3d, 0x8a, 0x7e, 0xa9, 0x88,
+      0x9d, 0x90, 0x3e, 0x07, 0x7c, 0x6f, 0x21, 0x8f };
+
+static size_t test_offset;
+static int ctr_drbg_self_test_entropy( void *data, unsigned char *buf,
+                                       size_t len )
+{
+    unsigned char *p = data;
+    memcpy( buf, p + test_offset, len );
+    test_offset += 32;
+    return( 0 );
+}
+
+/*
+ * Checkup routine
+ */
+int ctr_drbg_self_test( int verbose )
+{
+    ctr_drbg_context ctx;
+    unsigned char buf[16];
+
+    /*
+     * Based on a NIST CTR_DRBG test vector (PR = True)
+     */
+    if( verbose != 0 )
+        printf( "  CTR_DRBG (PR = TRUE) : " );
+
+    test_offset = 0;
+    if( ctr_drbg_init_entropy_len( &ctx, ctr_drbg_self_test_entropy, entropy_source_pr, nonce_pers_pr, 16, 32 ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+    ctr_drbg_set_prediction_resistance( &ctx, CTR_DRBG_PR_ON );
+
+    if( ctr_drbg_random( &ctx, buf, CTR_DRBG_BLOCKSIZE ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+
+    if( ctr_drbg_random( &ctx, buf, CTR_DRBG_BLOCKSIZE ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+
+    if( memcmp( buf, result_pr, CTR_DRBG_BLOCKSIZE ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+    
+    if( verbose != 0 )
+        printf( "passed\n" );
+
+    /*
+     * Based on a NIST CTR_DRBG test vector (PR = FALSE)
+     */
+    if( verbose != 0 )
+        printf( "  CTR_DRBG (PR = FALSE): " );
+
+    test_offset = 0;
+    if( ctr_drbg_init_entropy_len( &ctx, ctr_drbg_self_test_entropy, entropy_source_nopr, nonce_pers_nopr, 16, 32 ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+
+    if( ctr_drbg_random( &ctx, buf, 16 ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+
+    if( ctr_drbg_reseed( &ctx, NULL, 0 ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+
+    if( ctr_drbg_random( &ctx, buf, 16 ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+
+    if( memcmp( buf, result_nopr, 16 ) != 0 )
+    {
+        if( verbose != 0 )
+            printf( "failed\n" );
+
+        return( 1 );
+    }
+    
+    if( verbose != 0 )
+        printf( "passed\n" );
+
+    if( verbose != 0 )
+            printf( "\n" );
+
+    return( 0 );
+}
+#endif
+
+#endif

lib/libpolarssl/source/entropy.c

@@ -0,0 +1,261 @@
+/*
+ *  Entropy accumulator implementation
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+
+#include "polarssl/config.h"
+
+#if defined(POLARSSL_ENTROPY_C)
+
+#include "polarssl/entropy.h"
+#include "polarssl/entropy_poll.h"
+
+#if defined(POLARSSL_FS_IO)
+#include <stdio.h>
+#endif
+
+#if defined(POLARSSL_HAVEGE_C)
+#include "polarssl/havege.h"
+#endif
+
+#define ENTROPY_MAX_LOOP    256     /**< Maximum amount to loop before error */
+
+void entropy_init( entropy_context *ctx )
+{
+    memset( ctx, 0, sizeof(entropy_context) );
+
+    sha4_starts( &ctx->accumulator, 0 );
+#if defined(POLARSSL_HAVEGE_C)
+    havege_init( &ctx->havege_data );
+#endif
+
+#if !defined(POLARSSL_NO_DEFAULT_ENTROPY_SOURCES)
+#if !defined(POLARSSL_NO_PLATFORM_ENTROPY)
+    entropy_add_source( ctx, platform_entropy_poll, NULL,
+                        ENTROPY_MIN_PLATFORM );
+#endif
+#if defined(POLARSSL_TIMING_C)
+    entropy_add_source( ctx, hardclock_poll, NULL, ENTROPY_MIN_HARDCLOCK );
+#endif
+#if defined(POLARSSL_HAVEGE_C)
+    entropy_add_source( ctx, havege_poll, &ctx->havege_data,
+                        ENTROPY_MIN_HAVEGE );
+#endif
+#endif /* POLARSSL_NO_DEFAULT_ENTROPY_SOURCES */
+}
+
+int entropy_add_source( entropy_context *ctx,
+                        f_source_ptr f_source, void *p_source,
+                        size_t threshold )
+{
+    int index = ctx->source_count;
+
+    if( index >= ENTROPY_MAX_SOURCES )
+        return( POLARSSL_ERR_ENTROPY_MAX_SOURCES );
+
+    ctx->source[index].f_source = f_source;
+    ctx->source[index].p_source = p_source;
+    ctx->source[index].threshold = threshold;
+
+    ctx->source_count++;
+
+    return( 0 );
+}
+
+/*
+ * Entropy accumulator update
+ */
+static int entropy_update( entropy_context *ctx, unsigned char source_id,
+                           const unsigned char *data, size_t len )
+{
+    unsigned char header[2];
+    unsigned char tmp[ENTROPY_BLOCK_SIZE];
+    size_t use_len = len;
+    const unsigned char *p = data;
+   
+    if( use_len > ENTROPY_BLOCK_SIZE )
+    {
+        sha4( data, len, tmp, 0 );
+
+        p = tmp;
+        use_len = ENTROPY_BLOCK_SIZE;
+    }
+
+    header[0] = source_id;
+    header[1] = use_len & 0xFF;
+
+    sha4_update( &ctx->accumulator, header, 2 );
+    sha4_update( &ctx->accumulator, p, use_len );
+    
+    return( 0 );
+}
+
+int entropy_update_manual( entropy_context *ctx,
+                           const unsigned char *data, size_t len )
+{
+    return entropy_update( ctx, ENTROPY_SOURCE_MANUAL, data, len );
+}
+
+/*
+ * Run through the different sources to add entropy to our accumulator
+ */
+int entropy_gather( entropy_context *ctx )
+{
+    int ret, i;
+    unsigned char buf[ENTROPY_MAX_GATHER];
+    size_t olen;
+    
+    if( ctx->source_count == 0 )
+        return( POLARSSL_ERR_ENTROPY_NO_SOURCES_DEFINED );
+
+    /*
+     * Run through our entropy sources
+     */
+    for( i = 0; i < ctx->source_count; i++ )
+    {
+        olen = 0;
+        if ( ( ret = ctx->source[i].f_source( ctx->source[i].p_source,
+                        buf, ENTROPY_MAX_GATHER, &olen ) ) != 0 )
+        {
+            return( ret );
+        }
+
+        /*
+         * Add if we actually gathered something
+         */
+        if( olen > 0 )
+        {
+            entropy_update( ctx, (unsigned char) i, buf, olen );
+            ctx->source[i].size += olen;
+        }
+    }
+
+    return( 0 );
+}
+
+int entropy_func( void *data, unsigned char *output, size_t len )
+{
+    int ret, count = 0, i, reached;
+    entropy_context *ctx = (entropy_context *) data;
+    unsigned char buf[ENTROPY_BLOCK_SIZE];
+
+    if( len > ENTROPY_BLOCK_SIZE )
+        return( POLARSSL_ERR_ENTROPY_SOURCE_FAILED );
+
+    /*
+     * Always gather extra entropy before a call
+     */
+    do
+    {
+        if( count++ > ENTROPY_MAX_LOOP )
+            return( POLARSSL_ERR_ENTROPY_SOURCE_FAILED );
+
+        if( ( ret = entropy_gather( ctx ) ) != 0 )
+            return( ret );
+
+        reached = 0;
+
+        for( i = 0; i < ctx->source_count; i++ )
+            if( ctx->source[i].size >= ctx->source[i].threshold )
+                reached++;
+    }
+    while( reached != ctx->source_count );
+
+    memset( buf, 0, ENTROPY_BLOCK_SIZE );
+
+    sha4_finish( &ctx->accumulator, buf );
+
+    /*
+     * Reset accumulator and counters and recycle existing entropy
+     */
+    memset( &ctx->accumulator, 0, sizeof( sha4_context ) );
+    sha4_starts( &ctx->accumulator, 0 );
+    sha4_update( &ctx->accumulator, buf, ENTROPY_BLOCK_SIZE );
+
+    /*
+     * Perform second SHA-512 on entropy
+     */
+    sha4( buf, ENTROPY_BLOCK_SIZE, buf, 0 );
+
+    for( i = 0; i < ctx->source_count; i++ )
+        ctx->source[i].size = 0;
+
+    memcpy( output, buf, len );
+
+    return( 0 );
+}
+
+#if defined(POLARSSL_FS_IO)
+int entropy_write_seed_file( entropy_context *ctx, const char *path )
+{
+    int ret = POLARSSL_ERR_ENTROPY_FILE_IO_ERROR;
+    FILE *f;
+    unsigned char buf[ENTROPY_BLOCK_SIZE];
+
+    if( ( f = fopen( path, "wb" ) ) == NULL )
+        return( POLARSSL_ERR_ENTROPY_FILE_IO_ERROR );
+
+    if( ( ret = entropy_func( ctx, buf, ENTROPY_BLOCK_SIZE ) ) != 0 )
+        goto exit;
+
+    if( fwrite( buf, 1, ENTROPY_BLOCK_SIZE, f ) != ENTROPY_BLOCK_SIZE )
+    {
+        ret = POLARSSL_ERR_ENTROPY_FILE_IO_ERROR;
+        goto exit;
+    }
+
+    ret = 0;
+
+exit:
+    fclose( f );
+    return( ret );
+}
+
+int entropy_update_seed_file( entropy_context *ctx, const char *path )
+{
+    FILE *f;
+    size_t n;
+    unsigned char buf[ ENTROPY_MAX_SEED_SIZE ];
+
+    if( ( f = fopen( path, "rb" ) ) == NULL )
+        return( POLARSSL_ERR_ENTROPY_FILE_IO_ERROR );
+
+    fseek( f, 0, SEEK_END );
+    n = (size_t) ftell( f );
+    fseek( f, 0, SEEK_SET );
+
+    if( n > ENTROPY_MAX_SEED_SIZE )
+        n = ENTROPY_MAX_SEED_SIZE;
+
+    if( fread( buf, 1, n, f ) != n )
+    {
+        fclose( f );
+        return( POLARSSL_ERR_ENTROPY_FILE_IO_ERROR );
+    }
+
+    fclose( f );
+
+    entropy_update_manual( ctx, buf, n );
+
+    return( entropy_write_seed_file( ctx, path ) );
+}
+#endif /* POLARSSL_FS_IO */
+
+#endif

lib/libpolarssl/source/entropy_poll.c

@@ -0,0 +1,133 @@
+/*
+ *  Platform-specific and custom entropy polling functions
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+
+#include "polarssl/config.h"
+
+#if defined(POLARSSL_ENTROPY_C)
+
+#include "polarssl/entropy.h"
+#include "polarssl/entropy_poll.h"
+
+#if defined(POLARSSL_TIMING_C)
+#include "polarssl/timing.h"
+#endif
+#if defined(POLARSSL_HAVEGE_C)
+#include "polarssl/havege.h"
+#endif
+
+#if !defined(POLARSSL_NO_PLATFORM_ENTROPY)
+#if defined(_WIN32)
+
+#if !defined(_WIN32_WINNT)
+#define _WIN32_WINNT 0x0400
+#endif
+#include <windows.h>
+#include <wincrypt.h>
+
+int platform_entropy_poll( void *data, unsigned char *output, size_t len,
+                           size_t *olen )
+{
+    HCRYPTPROV provider;
+    ((void) data);
+    *olen = 0;
+
+    if( CryptAcquireContext( &provider, NULL, NULL,
+                              PROV_RSA_FULL, CRYPT_VERIFYCONTEXT ) == FALSE )
+    {
+        return POLARSSL_ERR_ENTROPY_SOURCE_FAILED;
+    }
+
+    if( CryptGenRandom( provider, len, output ) == FALSE )
+        return POLARSSL_ERR_ENTROPY_SOURCE_FAILED;
+
+    CryptReleaseContext( provider, 0 );
+    *olen = len;
+
+    return( 0 );
+}
+#else
+
+#include <stdio.h>
+
+int platform_entropy_poll( void *data,
+                           unsigned char *output, size_t len, size_t *olen )
+{
+    FILE *file;
+    size_t ret;
+    ((void) data);
+
+    *olen = 0;
+
+    file = fopen( "/dev/urandom", "rb" );
+    if( file == NULL )
+        return POLARSSL_ERR_ENTROPY_SOURCE_FAILED;
+    
+    ret = fread( output, 1, len, file );
+    if( ret != len )
+    {
+        fclose( file );
+        return POLARSSL_ERR_ENTROPY_SOURCE_FAILED;
+    }
+
+    fclose( file );
+    *olen = len;
+
+    return( 0 );
+}
+#endif
+#endif
+
+#if defined(POLARSSL_TIMING_C)
+int hardclock_poll( void *data,
+                    unsigned char *output, size_t len, size_t *olen )
+{
+    unsigned long timer = hardclock();
+    ((void) data);
+    *olen = 0;
+
+    if( len < sizeof(unsigned long) )
+        return( 0 );
+
+    memcpy( output, &timer, sizeof(unsigned long) );
+    *olen = sizeof(unsigned long);
+
+    return( 0 );
+}
+#endif
+
+#if defined(POLARSSL_HAVEGE_C)
+int havege_poll( void *data,
+                 unsigned char *output, size_t len, size_t *olen )
+{
+    havege_state *hs = (havege_state *) data;
+    *olen = 0;
+
+    if( havege_random( hs, output, len ) != 0 )
+        return POLARSSL_ERR_ENTROPY_SOURCE_FAILED;
+
+    *olen = len;
+
+    return( 0 );
+}
+#endif
+
+#endif /* POLARSSL_ENTROPY_C */

lib/libpolarssl/source/sha4.c

@@ -0,0 +1,762 @@
+/*
+ *  FIPS-180-2 compliant SHA-384/512 implementation
+ *
+ *  Copyright (C) 2006-2015, ARM Limited, All Rights Reserved
+ *
+ *  This file is part of mbed TLS (https://polarssl.org)
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  This program is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+/*
+ *  The SHA-512 Secure Hash Standard was published by NIST in 2002.
+ *
+ *  http://csrc.nist.gov/publications/fips/fips180-2/fips180-2.pdf
+ */
+
+#include "polarssl/config.h"
+
+#if defined(POLARSSL_SHA4_C)
+
+#include "polarssl/sha4.h"
+
+#if defined(POLARSSL_FS_IO) || defined(POLARSSL_SELF_TEST)
+#include <stdio.h>
+#endif
+
+#if !defined(POLARSSL_SHA4_ALT)
+
+/* Implementation that should never be optimized out by the compiler */
+static void polarssl_zeroize( void *v, size_t n ) {
+    volatile unsigned char *p = v; while( n-- ) *p++ = 0;
+}
+
+/*
+ * 64-bit integer manipulation macros (big endian)
+ */
+#ifndef GET_UINT64_BE
+#define GET_UINT64_BE(n,b,i)                            \
+{                                                       \
+    (n) = ( (uint64_t) (b)[(i)    ] << 56 )       \
+        | ( (uint64_t) (b)[(i) + 1] << 48 )       \
+        | ( (uint64_t) (b)[(i) + 2] << 40 )       \
+        | ( (uint64_t) (b)[(i) + 3] << 32 )       \
+        | ( (uint64_t) (b)[(i) + 4] << 24 )       \
+        | ( (uint64_t) (b)[(i) + 5] << 16 )       \
+        | ( (uint64_t) (b)[(i) + 6] <<  8 )       \
+        | ( (uint64_t) (b)[(i) + 7]       );      \
+}
+#endif
+
+#ifndef PUT_UINT64_BE
+#define PUT_UINT64_BE(n,b,i)                            \
+{                                                       \
+    (b)[(i)    ] = (unsigned char) ( (n) >> 56 );       \
+    (b)[(i) + 1] = (unsigned char) ( (n) >> 48 );       \
+    (b)[(i) + 2] = (unsigned char) ( (n) >> 40 );       \
+    (b)[(i) + 3] = (unsigned char) ( (n) >> 32 );       \
+    (b)[(i) + 4] = (unsigned char) ( (n) >> 24 );       \
+    (b)[(i) + 5] = (unsigned char) ( (n) >> 16 );       \
+    (b)[(i) + 6] = (unsigned char) ( (n) >>  8 );       \
+    (b)[(i) + 7] = (unsigned char) ( (n)       );       \
+}
+#endif
+
+/*
+ * Round constants
+ */
+static const uint64_t K[80] =
+{
+    UL64(0x428A2F98D728AE22),  UL64(0x7137449123EF65CD),
+    UL64(0xB5C0FBCFEC4D3B2F),  UL64(0xE9B5DBA58189DBBC),
+    UL64(0x3956C25BF348B538),  UL64(0x59F111F1B605D019),
+    UL64(0x923F82A4AF194F9B),  UL64(0xAB1C5ED5DA6D8118),
+    UL64(0xD807AA98A3030242),  UL64(0x12835B0145706FBE),
+    UL64(0x243185BE4EE4B28C),  UL64(0x550C7DC3D5FFB4E2),
+    UL64(0x72BE5D74F27B896F),  UL64(0x80DEB1FE3B1696B1),
+    UL64(0x9BDC06A725C71235),  UL64(0xC19BF174CF692694),
+    UL64(0xE49B69C19EF14AD2),  UL64(0xEFBE4786384F25E3),
+    UL64(0x0FC19DC68B8CD5B5),  UL64(0x240CA1CC77AC9C65),
+    UL64(0x2DE92C6F592B0275),  UL64(0x4A7484AA6EA6E483),
+    UL64(0x5CB0A9DCBD41FBD4),  UL64(0x76F988DA831153B5),
+    UL64(0x983E5152EE66DFAB),  UL64(0xA831C66D2DB43210),
+    UL64(0xB00327C898FB213F),  UL64(0xBF597FC7BEEF0EE4),
+    UL64(0xC6E00BF33DA88FC2),  UL64(0xD5A79147930AA725),
+    UL64(0x06CA6351E003826F),  UL64(0x142929670A0E6E70),
+    UL64(0x27B70A8546D22FFC),  UL64(0x2E1B21385C26C926),
+    UL64(0x4D2C6DFC5AC42AED),  UL64(0x53380D139D95B3DF),
+    UL64(0x650A73548BAF63DE),  UL64(0x766A0ABB3C77B2A8),
+    UL64(0x81C2C92E47EDAEE6),  UL64(0x92722C851482353B),
+    UL64(0xA2BFE8A14CF10364),  UL64(0xA81A664BBC423001),
+    UL64(0xC24B8B70D0F89791),  UL64(0xC76C51A30654BE30),
+    UL64(0xD192E819D6EF5218),  UL64(0xD69906245565A910),
+    UL64(0xF40E35855771202A),  UL64(0x106AA07032BBD1B8),
+    UL64(0x19A4C116B8D2D0C8),  UL64(0x1E376C085141AB53),
+    UL64(0x2748774CDF8EEB99),  UL64(0x34B0BCB5E19B48A8),
+    UL64(0x391C0CB3C5C95A63),  UL64(0x4ED8AA4AE3418ACB),
+    UL64(0x5B9CCA4F7763E373),  UL64(0x682E6FF3D6B2B8A3),
+    UL64(0x748F82EE5DEFB2FC),  UL64(0x78A5636F43172F60),
+    UL64(0x84C87814A1F0AB72),  UL64(0x8CC702081A6439EC),
+    UL64(0x90BEFFFA23631E28),  UL64(0xA4506CEBDE82BDE9),
+    UL64(0xBEF9A3F7B2C67915),  UL64(0xC67178F2E372532B),
+    UL64(0xCA273ECEEA26619C),  UL64(0xD186B8C721C0C207),
+    UL64(0xEADA7DD6CDE0EB1E),  UL64(0xF57D4F7FEE6ED178),
+    UL64(0x06F067AA72176FBA),  UL64(0x0A637DC5A2C898A6),
+    UL64(0x113F9804BEF90DAE),  UL64(0x1B710B35131C471B),
+    UL64(0x28DB77F523047D84),  UL64(0x32CAAB7B40C72493),
+    UL64(0x3C9EBE0A15C9BEBC),  UL64(0x431D67C49C100D4C),
+    UL64(0x4CC5D4BECB3E42B6),  UL64(0x597F299CFC657E2A),
+    UL64(0x5FCB6FAB3AD6FAEC),  UL64(0x6C44198C4A475817)
+};
+
+/*
+ * SHA-512 context setup
+ */
+void sha4_starts( sha4_context *ctx, int is384 )
+{
+    ctx->total[0] = 0;
+    ctx->total[1] = 0;
+
+    if( is384 == 0 )
+    {
+        /* SHA-512 */
+        ctx->state[0] = UL64(0x6A09E667F3BCC908);
+        ctx->state[1] = UL64(0xBB67AE8584CAA73B);
+        ctx->state[2] = UL64(0x3C6EF372FE94F82B);
+        ctx->state[3] = UL64(0xA54FF53A5F1D36F1);
+        ctx->state[4] = UL64(0x510E527FADE682D1);
+        ctx->state[5] = UL64(0x9B05688C2B3E6C1F);
+        ctx->state[6] = UL64(0x1F83D9ABFB41BD6B);
+        ctx->state[7] = UL64(0x5BE0CD19137E2179);
+    }
+    else
+    {
+        /* SHA-384 */
+        ctx->state[0] = UL64(0xCBBB9D5DC1059ED8);
+        ctx->state[1] = UL64(0x629A292A367CD507);
+        ctx->state[2] = UL64(0x9159015A3070DD17);
+        ctx->state[3] = UL64(0x152FECD8F70E5939);
+        ctx->state[4] = UL64(0x67332667FFC00B31);
+        ctx->state[5] = UL64(0x8EB44A8768581511);
+        ctx->state[6] = UL64(0xDB0C2E0D64F98FA7);
+        ctx->state[7] = UL64(0x47B5481DBEFA4FA4);
+    }
+
+    ctx->is384 = is384;
+}
+
+static void sha4_process( sha4_context *ctx, const unsigned char data[128] )
+{
+    int i;
+    uint64_t temp1, temp2, W[80];
+    uint64_t A, B, C, D, E, F, G, H;
+
+#define  SHR(x,n) (x >> n)
+#define ROTR(x,n) (SHR(x,n) | (x << (64 - n)))
+
+#define S0(x) (ROTR(x, 1) ^ ROTR(x, 8) ^  SHR(x, 7))
+#define S1(x) (ROTR(x,19) ^ ROTR(x,61) ^  SHR(x, 6))
+
+#define S2(x) (ROTR(x,28) ^ ROTR(x,34) ^ ROTR(x,39))
+#define S3(x) (ROTR(x,14) ^ ROTR(x,18) ^ ROTR(x,41))
+
+#define F0(x,y,z) ((x & y) | (z & (x | y)))
+#define F1(x,y,z) (z ^ (x & (y ^ z)))
+
+#define P(a,b,c,d,e,f,g,h,x,K)                  \
+{                                               \
+    temp1 = h + S3(e) + F1(e,f,g) + K + x;      \
+    temp2 = S2(a) + F0(a,b,c);                  \
+    d += temp1; h = temp1 + temp2;              \
+}
+
+    for( i = 0; i < 16; i++ )
+    {
+        GET_UINT64_BE( W[i], data, i << 3 );
+    }
+
+    for( ; i < 80; i++ )
+    {
+        W[i] = S1(W[i -  2]) + W[i -  7] +
+               S0(W[i - 15]) + W[i - 16];
+    }
+
+    A = ctx->state[0];
+    B = ctx->state[1];
+    C = ctx->state[2];
+    D = ctx->state[3];
+    E = ctx->state[4];
+    F = ctx->state[5];
+    G = ctx->state[6];
+    H = ctx->state[7];
+    i = 0;
+
+    do
+    {
+        P( A, B, C, D, E, F, G, H, W[i], K[i] ); i++;
+        P( H, A, B, C, D, E, F, G, W[i], K[i] ); i++;
+        P( G, H, A, B, C, D, E, F, W[i], K[i] ); i++;
+        P( F, G, H, A, B, C, D, E, W[i], K[i] ); i++;
+        P( E, F, G, H, A, B, C, D, W[i], K[i] ); i++;
+        P( D, E, F, G, H, A, B, C, W[i], K[i] ); i++;
+        P( C, D, E, F, G, H, A, B, W[i], K[i] ); i++;
+        P( B, C, D, E, F, G, H, A, W[i], K[i] ); i++;
+    }
+    while( i < 80 );
+
+    ctx->state[0] += A;
+    ctx->state[1] += B;
+    ctx->state[2] += C;
+    ctx->state[3] += D;
+    ctx->state[4] += E;
+    ctx->state[5] += F;
+    ctx->state[6] += G;
+    ctx->state[7] += H;
+}
+
+/*
+ * SHA-512 process buffer
+ */
+void sha4_update( sha4_context *ctx, const unsigned char *input, size_t ilen )
+{
+    size_t fill;
+    unsigned int left;
+
+    if( ilen <= 0 )
+        return;
+
+    left = (unsigned int) (ctx->total[0] & 0x7F);
+    fill = 128 - left;
+
+    ctx->total[0] += (uint64_t) ilen;
+
+    if( ctx->total[0] < (uint64_t) ilen )
+        ctx->total[1]++;
+
+    if( left && ilen >= fill )
+    {
+        memcpy( (void *) (ctx->buffer + left), input, fill );
+        sha4_process( ctx, ctx->buffer );
+        input += fill;
+        ilen  -= fill;
+        left = 0;
+    }
+
+    while( ilen >= 128 )
+    {
+        sha4_process( ctx, input );
+        input += 128;
+        ilen  -= 128;
+    }
+
+    if( ilen > 0 )
+        memcpy( (void *) (ctx->buffer + left), input, ilen );
+}
+
+static const unsigned char sha4_padding[128] =
+{
+ 0x80, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
+};
+
+/*
+ * SHA-512 final digest
+ */
+void sha4_finish( sha4_context *ctx, unsigned char output[64] )
+{
+    size_t last, padn;
+    uint64_t high, low;
+    unsigned char msglen[16];
+
+    high = ( ctx->total[0] >> 61 )
+         | ( ctx->total[1] <<  3 );
+    low  = ( ctx->total[0] <<  3 );
+
+    PUT_UINT64_BE( high, msglen, 0 );
+    PUT_UINT64_BE( low,  msglen, 8 );
+
+    last = (size_t)( ctx->total[0] & 0x7F );
+    padn = ( last < 112 ) ? ( 112 - last ) : ( 240 - last );
+
+    sha4_update( ctx, sha4_padding, padn );
+    sha4_update( ctx, msglen, 16 );
+
+    PUT_UINT64_BE( ctx->state[0], output,  0 );
+    PUT_UINT64_BE( ctx->state[1], output,  8 );
+    PUT_UINT64_BE( ctx->state[2], output, 16 );
+    PUT_UINT64_BE( ctx->state[3], output, 24 );
+    PUT_UINT64_BE( ctx->state[4], output, 32 );
+    PUT_UINT64_BE( ctx->state[5], output, 40 );
+
+    if( ctx->is384 == 0 )
+    {
+        PUT_UINT64_BE( ctx->state[6], output, 48 );
+        PUT_UINT64_BE( ctx->state[7], output, 56 );
+    }
+}
+
+#endif /* !POLARSSL_SHA4_ALT */
+
+/*
+ * output = SHA-512( input buffer )
+ */
+void sha4( const unsigned char *input, size_t ilen,
+           unsigned char output[64], int is384 )
+{
+    sha4_context ctx;
+
+    sha4_starts( &ctx, is384 );
+    sha4_update( &ctx, input, ilen );
+    sha4_finish( &ctx, output );
+
+    polarssl_zeroize( &ctx, sizeof( sha4_context ) );
+}
+
+#if defined(POLARSSL_FS_IO)
+/*
+ * output = SHA-512( file contents )
+ */
+int sha4_file( const char *path, unsigned char output[64], int is384 )
+{
+    FILE *f;
+    size_t n;
+    sha4_context ctx;
+    unsigned char buf[1024];
+
+    if( ( f = fopen( path, "rb" ) ) == NULL )
+        return( POLARSSL_ERR_SHA4_FILE_IO_ERROR );
+
+    sha4_starts( &ctx, is384 );
+
+    while( ( n = fread( buf, 1, sizeof( buf ), f ) ) > 0 )
+        sha4_update( &ctx, buf, n );
+
+    sha4_finish( &ctx, output );
+
+    polarssl_zeroize( &ctx, sizeof( sha4_context ) );
+
+    if( ferror( f ) != 0 )
+    {
+        fclose( f );
+        return( POLARSSL_ERR_SHA4_FILE_IO_ERROR );
+    }
+
+    fclose( f );
+    return( 0 );
+}
+#endif /* POLARSSL_FS_IO */
+
+/*
+ * SHA-512 HMAC context setup
+ */
+void sha4_hmac_starts( sha4_context *ctx, const unsigned char *key, size_t keylen,
+                       int is384 )
+{
+    size_t i;
+    unsigned char sum[64];
+
+    if( keylen > 128 )
+    {
+        sha4( key, keylen, sum, is384 );
+        keylen = ( is384 ) ? 48 : 64;
+        key = sum;
+    }
+
+    memset( ctx->ipad, 0x36, 128 );
+    memset( ctx->opad, 0x5C, 128 );
+
+    for( i = 0; i < keylen; i++ )
+    {
+        ctx->ipad[i] = (unsigned char)( ctx->ipad[i] ^ key[i] );
+        ctx->opad[i] = (unsigned char)( ctx->opad[i] ^ key[i] );
+    }
+
+    sha4_starts( ctx, is384 );
+    sha4_update( ctx, ctx->ipad, 128 );
+
+    polarssl_zeroize( sum, sizeof( sum ) );
+}
+
+/*
+ * SHA-512 HMAC process buffer
+ */
+void sha4_hmac_update( sha4_context  *ctx,
+                       const unsigned char *input, size_t ilen )
+{
+    sha4_update( ctx, input, ilen );
+}
+
+/*
+ * SHA-512 HMAC final digest
+ */
+void sha4_hmac_finish( sha4_context *ctx, unsigned char output[64] )
+{
+    int is384, hlen;
+    unsigned char tmpbuf[64];
+
+    is384 = ctx->is384;
+    hlen = ( is384 == 0 ) ? 64 : 48;
+
+    sha4_finish( ctx, tmpbuf );
+    sha4_starts( ctx, is384 );
+    sha4_update( ctx, ctx->opad, 128 );
+    sha4_update( ctx, tmpbuf, hlen );
+    sha4_finish( ctx, output );
+
+    polarssl_zeroize( tmpbuf, sizeof( tmpbuf ) );
+}
+
+/*
+ * SHA-512 HMAC context reset
+ */
+void sha4_hmac_reset( sha4_context *ctx )
+{
+    sha4_starts( ctx, ctx->is384 );
+    sha4_update( ctx, ctx->ipad, 128 );
+}
+
+/*
+ * output = HMAC-SHA-512( hmac key, input buffer )
+ */
+void sha4_hmac( const unsigned char *key, size_t keylen,
+                const unsigned char *input, size_t ilen,
+                unsigned char output[64], int is384 )
+{
+    sha4_context ctx;
+
+    sha4_hmac_starts( &ctx, key, keylen, is384 );
+    sha4_hmac_update( &ctx, input, ilen );
+    sha4_hmac_finish( &ctx, output );
+
+    polarssl_zeroize( &ctx, sizeof( sha4_context ) );
+}
+
+#if defined(POLARSSL_SELF_TEST)
+
+/*
+ * FIPS-180-2 test vectors
+ */
+static unsigned char sha4_test_buf[3][113] = 
+{
+    { "abc" },
+    { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmn"
+      "hijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu" },
+    { "" }
+};
+
+static const int sha4_test_buflen[3] =
+{
+    3, 112, 1000
+};
+
+static const unsigned char sha4_test_sum[6][64] =
+{
+    /*
+     * SHA-384 test vectors
+     */
+    { 0xCB, 0x00, 0x75, 0x3F, 0x45, 0xA3, 0x5E, 0x8B,
+      0xB5, 0xA0, 0x3D, 0x69, 0x9A, 0xC6, 0x50, 0x07,
+      0x27, 0x2C, 0x32, 0xAB, 0x0E, 0xDE, 0xD1, 0x63,
+      0x1A, 0x8B, 0x60, 0x5A, 0x43, 0xFF, 0x5B, 0xED,
+      0x80, 0x86, 0x07, 0x2B, 0xA1, 0xE7, 0xCC, 0x23,
+      0x58, 0xBA, 0xEC, 0xA1, 0x34, 0xC8, 0x25, 0xA7 },
+    { 0x09, 0x33, 0x0C, 0x33, 0xF7, 0x11, 0x47, 0xE8,
+      0x3D, 0x19, 0x2F, 0xC7, 0x82, 0xCD, 0x1B, 0x47,
+      0x53, 0x11, 0x1B, 0x17, 0x3B, 0x3B, 0x05, 0xD2,
+      0x2F, 0xA0, 0x80, 0x86, 0xE3, 0xB0, 0xF7, 0x12,
+      0xFC, 0xC7, 0xC7, 0x1A, 0x55, 0x7E, 0x2D, 0xB9,
+      0x66, 0xC3, 0xE9, 0xFA, 0x91, 0x74, 0x60, 0x39 },
+    { 0x9D, 0x0E, 0x18, 0x09, 0x71, 0x64, 0x74, 0xCB,
+      0x08, 0x6E, 0x83, 0x4E, 0x31, 0x0A, 0x4A, 0x1C,
+      0xED, 0x14, 0x9E, 0x9C, 0x00, 0xF2, 0x48, 0x52,
+      0x79, 0x72, 0xCE, 0xC5, 0x70, 0x4C, 0x2A, 0x5B,
+      0x07, 0xB8, 0xB3, 0xDC, 0x38, 0xEC, 0xC4, 0xEB,
+      0xAE, 0x97, 0xDD, 0xD8, 0x7F, 0x3D, 0x89, 0x85 },
+
+    /*
+     * SHA-512 test vectors
+     */
+    { 0xDD, 0xAF, 0x35, 0xA1, 0x93, 0x61, 0x7A, 0xBA,
+      0xCC, 0x41, 0x73, 0x49, 0xAE, 0x20, 0x41, 0x31,
+      0x12, 0xE6, 0xFA, 0x4E, 0x89, 0xA9, 0x7E, 0xA2,
+      0x0A, 0x9E, 0xEE, 0xE6, 0x4B, 0x55, 0xD3, 0x9A,
+      0x21, 0x92, 0x99, 0x2A, 0x27, 0x4F, 0xC1, 0xA8,
+      0x36, 0xBA, 0x3C, 0x23, 0xA3, 0xFE, 0xEB, 0xBD,
+      0x45, 0x4D, 0x44, 0x23, 0x64, 0x3C, 0xE8, 0x0E,
+      0x2A, 0x9A, 0xC9, 0x4F, 0xA5, 0x4C, 0xA4, 0x9F },
+    { 0x8E, 0x95, 0x9B, 0x75, 0xDA, 0xE3, 0x13, 0xDA,
+      0x8C, 0xF4, 0xF7, 0x28, 0x14, 0xFC, 0x14, 0x3F,
+      0x8F, 0x77, 0x79, 0xC6, 0xEB, 0x9F, 0x7F, 0xA1,
+      0x72, 0x99, 0xAE, 0xAD, 0xB6, 0x88, 0x90, 0x18,
+      0x50, 0x1D, 0x28, 0x9E, 0x49, 0x00, 0xF7, 0xE4,
+      0x33, 0x1B, 0x99, 0xDE, 0xC4, 0xB5, 0x43, 0x3A,
+      0xC7, 0xD3, 0x29, 0xEE, 0xB6, 0xDD, 0x26, 0x54,
+      0x5E, 0x96, 0xE5, 0x5B, 0x87, 0x4B, 0xE9, 0x09 },
+    { 0xE7, 0x18, 0x48, 0x3D, 0x0C, 0xE7, 0x69, 0x64,
+      0x4E, 0x2E, 0x42, 0xC7, 0xBC, 0x15, 0xB4, 0x63,
+      0x8E, 0x1F, 0x98, 0xB1, 0x3B, 0x20, 0x44, 0x28,
+      0x56, 0x32, 0xA8, 0x03, 0xAF, 0xA9, 0x73, 0xEB,
+      0xDE, 0x0F, 0xF2, 0x44, 0x87, 0x7E, 0xA6, 0x0A,
+      0x4C, 0xB0, 0x43, 0x2C, 0xE5, 0x77, 0xC3, 0x1B,
+      0xEB, 0x00, 0x9C, 0x5C, 0x2C, 0x49, 0xAA, 0x2E,
+      0x4E, 0xAD, 0xB2, 0x17, 0xAD, 0x8C, 0xC0, 0x9B }
+};
+
+/*
+ * RFC 4231 test vectors
+ */
+static unsigned char sha4_hmac_test_key[7][26] =
+{
+    { "\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B\x0B"
+      "\x0B\x0B\x0B\x0B" },
+    { "Jefe" },
+    { "\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA\xAA"
+      "\xAA\xAA\xAA\xAA" },
+    { "\x01\x02\x03\x04\x05\x06\x07\x08\x09\x0A\x0B\x0C\x0D\x0E\x0F\x10"
+      "\x11\x12\x13\x14\x15\x16\x17\x18\x19" },
+    { "\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C\x0C"
+      "\x0C\x0C\x0C\x0C" },
+    { "" }, /* 0xAA 131 times */
+    { "" }
+};
+
+static const int sha4_hmac_test_keylen[7] =
+{
+    20, 4, 20, 25, 20, 131, 131
+};
+
+static unsigned char sha4_hmac_test_buf[7][153] =
+{
+    { "Hi There" },
+    { "what do ya want for nothing?" },
+    { "\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD"
+      "\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD"
+      "\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD"
+      "\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD"
+      "\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD\xDD" },
+    { "\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD"
+      "\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD"
+      "\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD"
+      "\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD"
+      "\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD\xCD" },
+    { "Test With Truncation" },
+    { "Test Using Larger Than Block-Size Key - Hash Key First" },
+    { "This is a test using a larger than block-size key "
+      "and a larger than block-size data. The key needs to "
+      "be hashed before being used by the HMAC algorithm." }
+};
+
+static const int sha4_hmac_test_buflen[7] =
+{
+    8, 28, 50, 50, 20, 54, 152
+};
+
+static const unsigned char sha4_hmac_test_sum[14][64] =
+{
+    /*
+     * HMAC-SHA-384 test vectors
+     */
+    { 0xAF, 0xD0, 0x39, 0x44, 0xD8, 0x48, 0x95, 0x62,
+      0x6B, 0x08, 0x25, 0xF4, 0xAB, 0x46, 0x90, 0x7F,
+      0x15, 0xF9, 0xDA, 0xDB, 0xE4, 0x10, 0x1E, 0xC6,
+      0x82, 0xAA, 0x03, 0x4C, 0x7C, 0xEB, 0xC5, 0x9C,
+      0xFA, 0xEA, 0x9E, 0xA9, 0x07, 0x6E, 0xDE, 0x7F,
+      0x4A, 0xF1, 0x52, 0xE8, 0xB2, 0xFA, 0x9C, 0xB6 },
+    { 0xAF, 0x45, 0xD2, 0xE3, 0x76, 0x48, 0x40, 0x31,
+      0x61, 0x7F, 0x78, 0xD2, 0xB5, 0x8A, 0x6B, 0x1B,
+      0x9C, 0x7E, 0xF4, 0x64, 0xF5, 0xA0, 0x1B, 0x47,
+      0xE4, 0x2E, 0xC3, 0x73, 0x63, 0x22, 0x44, 0x5E,
+      0x8E, 0x22, 0x40, 0xCA, 0x5E, 0x69, 0xE2, 0xC7,
+      0x8B, 0x32, 0x39, 0xEC, 0xFA, 0xB2, 0x16, 0x49 },
+    { 0x88, 0x06, 0x26, 0x08, 0xD3, 0xE6, 0xAD, 0x8A,
+      0x0A, 0xA2, 0xAC, 0xE0, 0x14, 0xC8, 0xA8, 0x6F,
+      0x0A, 0xA6, 0x35, 0xD9, 0x47, 0xAC, 0x9F, 0xEB,
+      0xE8, 0x3E, 0xF4, 0xE5, 0x59, 0x66, 0x14, 0x4B,
+      0x2A, 0x5A, 0xB3, 0x9D, 0xC1, 0x38, 0x14, 0xB9,
+      0x4E, 0x3A, 0xB6, 0xE1, 0x01, 0xA3, 0x4F, 0x27 },
+    { 0x3E, 0x8A, 0x69, 0xB7, 0x78, 0x3C, 0x25, 0x85,
+      0x19, 0x33, 0xAB, 0x62, 0x90, 0xAF, 0x6C, 0xA7,
+      0x7A, 0x99, 0x81, 0x48, 0x08, 0x50, 0x00, 0x9C,
+      0xC5, 0x57, 0x7C, 0x6E, 0x1F, 0x57, 0x3B, 0x4E,
+      0x68, 0x01, 0xDD, 0x23, 0xC4, 0xA7, 0xD6, 0x79,
+      0xCC, 0xF8, 0xA3, 0x86, 0xC6, 0x74, 0xCF, 0xFB },
+    { 0x3A, 0xBF, 0x34, 0xC3, 0x50, 0x3B, 0x2A, 0x23,
+      0xA4, 0x6E, 0xFC, 0x61, 0x9B, 0xAE, 0xF8, 0x97 },
+    { 0x4E, 0xCE, 0x08, 0x44, 0x85, 0x81, 0x3E, 0x90,
+      0x88, 0xD2, 0xC6, 0x3A, 0x04, 0x1B, 0xC5, 0xB4,
+      0x4F, 0x9E, 0xF1, 0x01, 0x2A, 0x2B, 0x58, 0x8F,
+      0x3C, 0xD1, 0x1F, 0x05, 0x03, 0x3A, 0xC4, 0xC6,
+      0x0C, 0x2E, 0xF6, 0xAB, 0x40, 0x30, 0xFE, 0x82,
+      0x96, 0x24, 0x8D, 0xF1, 0x63, 0xF4, 0x49, 0x52 },
+    { 0x66, 0x17, 0x17, 0x8E, 0x94, 0x1F, 0x02, 0x0D,
+      0x35, 0x1E, 0x2F, 0x25, 0x4E, 0x8F, 0xD3, 0x2C,
+      0x60, 0x24, 0x20, 0xFE, 0xB0, 0xB8, 0xFB, 0x9A,
+      0xDC, 0xCE, 0xBB, 0x82, 0x46, 0x1E, 0x99, 0xC5,
+      0xA6, 0x78, 0xCC, 0x31, 0xE7, 0x99, 0x17, 0x6D,
+      0x38, 0x60, 0xE6, 0x11, 0x0C, 0x46, 0x52, 0x3E },
+
+    /*
+     * HMAC-SHA-512 test vectors
+     */
+    { 0x87, 0xAA, 0x7C, 0xDE, 0xA5, 0xEF, 0x61, 0x9D,
+      0x4F, 0xF0, 0xB4, 0x24, 0x1A, 0x1D, 0x6C, 0xB0,
+      0x23, 0x79, 0xF4, 0xE2, 0xCE, 0x4E, 0xC2, 0x78,
+      0x7A, 0xD0, 0xB3, 0x05, 0x45, 0xE1, 0x7C, 0xDE,
+      0xDA, 0xA8, 0x33, 0xB7, 0xD6, 0xB8, 0xA7, 0x02,
+      0x03, 0x8B, 0x27, 0x4E, 0xAE, 0xA3, 0xF4, 0xE4,
+      0xBE, 0x9D, 0x91, 0x4E, 0xEB, 0x61, 0xF1, 0x70,
+      0x2E, 0x69, 0x6C, 0x20, 0x3A, 0x12, 0x68, 0x54 },
+    { 0x16, 0x4B, 0x7A, 0x7B, 0xFC, 0xF8, 0x19, 0xE2,
+      0xE3, 0x95, 0xFB, 0xE7, 0x3B, 0x56, 0xE0, 0xA3,
+      0x87, 0xBD, 0x64, 0x22, 0x2E, 0x83, 0x1F, 0xD6,
+      0x10, 0x27, 0x0C, 0xD7, 0xEA, 0x25, 0x05, 0x54,
+      0x97, 0x58, 0xBF, 0x75, 0xC0, 0x5A, 0x99, 0x4A,
+      0x6D, 0x03, 0x4F, 0x65, 0xF8, 0xF0, 0xE6, 0xFD,
+      0xCA, 0xEA, 0xB1, 0xA3, 0x4D, 0x4A, 0x6B, 0x4B,
+      0x63, 0x6E, 0x07, 0x0A, 0x38, 0xBC, 0xE7, 0x37 },
+    { 0xFA, 0x73, 0xB0, 0x08, 0x9D, 0x56, 0xA2, 0x84,
+      0xEF, 0xB0, 0xF0, 0x75, 0x6C, 0x89, 0x0B, 0xE9,
+      0xB1, 0xB5, 0xDB, 0xDD, 0x8E, 0xE8, 0x1A, 0x36,
+      0x55, 0xF8, 0x3E, 0x33, 0xB2, 0x27, 0x9D, 0x39,
+      0xBF, 0x3E, 0x84, 0x82, 0x79, 0xA7, 0x22, 0xC8,
+      0x06, 0xB4, 0x85, 0xA4, 0x7E, 0x67, 0xC8, 0x07,
+      0xB9, 0x46, 0xA3, 0x37, 0xBE, 0xE8, 0x94, 0x26,
+      0x74, 0x27, 0x88, 0x59, 0xE1, 0x32, 0x92, 0xFB },
+    { 0xB0, 0xBA, 0x46, 0x56, 0x37, 0x45, 0x8C, 0x69,
+      0x90, 0xE5, 0xA8, 0xC5, 0xF6, 0x1D, 0x4A, 0xF7,
+      0xE5, 0x76, 0xD9, 0x7F, 0xF9, 0x4B, 0x87, 0x2D,
+      0xE7, 0x6F, 0x80, 0x50, 0x36, 0x1E, 0xE3, 0xDB,
+      0xA9, 0x1C, 0xA5, 0xC1, 0x1A, 0xA2, 0x5E, 0xB4,
+      0xD6, 0x79, 0x27, 0x5C, 0xC5, 0x78, 0x80, 0x63,
+      0xA5, 0xF1, 0x97, 0x41, 0x12, 0x0C, 0x4F, 0x2D,
+      0xE2, 0xAD, 0xEB, 0xEB, 0x10, 0xA2, 0x98, 0xDD },
+    { 0x41, 0x5F, 0xAD, 0x62, 0x71, 0x58, 0x0A, 0x53,
+      0x1D, 0x41, 0x79, 0xBC, 0x89, 0x1D, 0x87, 0xA6 },
+    { 0x80, 0xB2, 0x42, 0x63, 0xC7, 0xC1, 0xA3, 0xEB,
+      0xB7, 0x14, 0x93, 0xC1, 0xDD, 0x7B, 0xE8, 0xB4,
+      0x9B, 0x46, 0xD1, 0xF4, 0x1B, 0x4A, 0xEE, 0xC1,
+      0x12, 0x1B, 0x01, 0x37, 0x83, 0xF8, 0xF3, 0x52,
+      0x6B, 0x56, 0xD0, 0x37, 0xE0, 0x5F, 0x25, 0x98,
+      0xBD, 0x0F, 0xD2, 0x21, 0x5D, 0x6A, 0x1E, 0x52,
+      0x95, 0xE6, 0x4F, 0x73, 0xF6, 0x3F, 0x0A, 0xEC,
+      0x8B, 0x91, 0x5A, 0x98, 0x5D, 0x78, 0x65, 0x98 },
+    { 0xE3, 0x7B, 0x6A, 0x77, 0x5D, 0xC8, 0x7D, 0xBA,
+      0xA4, 0xDF, 0xA9, 0xF9, 0x6E, 0x5E, 0x3F, 0xFD,
+      0xDE, 0xBD, 0x71, 0xF8, 0x86, 0x72, 0x89, 0x86,
+      0x5D, 0xF5, 0xA3, 0x2D, 0x20, 0xCD, 0xC9, 0x44,
+      0xB6, 0x02, 0x2C, 0xAC, 0x3C, 0x49, 0x82, 0xB1,
+      0x0D, 0x5E, 0xEB, 0x55, 0xC3, 0xE4, 0xDE, 0x15,
+      0x13, 0x46, 0x76, 0xFB, 0x6D, 0xE0, 0x44, 0x60,
+      0x65, 0xC9, 0x74, 0x40, 0xFA, 0x8C, 0x6A, 0x58 }
+};
+
+/*
+ * Checkup routine
+ */
+int sha4_self_test( int verbose )
+{
+    int i, j, k, buflen;
+    unsigned char buf[1024];
+    unsigned char sha4sum[64];
+    sha4_context ctx;
+
+    for( i = 0; i < 6; i++ )
+    {
+        j = i % 3;
+        k = i < 3;
+
+        if( verbose != 0 )
+            printf( "  SHA-%d test #%d: ", 512 - k * 128, j + 1 );
+
+        sha4_starts( &ctx, k );
+
+        if( j == 2 )
+        {
+            memset( buf, 'a', buflen = 1000 );
+
+            for( j = 0; j < 1000; j++ )
+                sha4_update( &ctx, buf, buflen );
+        }
+        else
+            sha4_update( &ctx, sha4_test_buf[j],
+                               sha4_test_buflen[j] );
+
+        sha4_finish( &ctx, sha4sum );
+
+        if( memcmp( sha4sum, sha4_test_sum[i], 64 - k * 16 ) != 0 )
+        {
+            if( verbose != 0 )
+                printf( "failed\n" );
+
+            return( 1 );
+        }
+
+        if( verbose != 0 )
+            printf( "passed\n" );
+    }
+
+    if( verbose != 0 )
+        printf( "\n" );
+
+    for( i = 0; i < 14; i++ )
+    {
+        j = i % 7;
+        k = i < 7;
+
+        if( verbose != 0 )
+            printf( "  HMAC-SHA-%d test #%d: ", 512 - k * 128, j + 1 );
+
+        if( j == 5 || j == 6 )
+        {
+            memset( buf, '\xAA', buflen = 131 );
+            sha4_hmac_starts( &ctx, buf, buflen, k );
+        }
+        else
+            sha4_hmac_starts( &ctx, sha4_hmac_test_key[j],
+                                    sha4_hmac_test_keylen[j], k );
+
+        sha4_hmac_update( &ctx, sha4_hmac_test_buf[j],
+                                sha4_hmac_test_buflen[j] );
+
+        sha4_hmac_finish( &ctx, sha4sum );
+
+        buflen = ( j == 4 ) ? 16 : 64 - k * 16;
+
+        if( memcmp( sha4sum, sha4_hmac_test_sum[i], buflen ) != 0 )
+        {
+            if( verbose != 0 )
+                printf( "failed\n" );
+
+            return( 1 );
+        }
+
+        if( verbose != 0 )
+            printf( "passed\n" );
+    }
+
+    if( verbose != 0 )
+        printf( "\n" );
+
+    return( 0 );
+}
+
+#endif
+
+#endif

programs/nstool/nstool.vcxproj

@@ -181,16 +181,17 @@
     <ClInclude Include="source\AesCtrWrappedIFile.h" />
     <ClInclude Include="source\AssetProcess.h" />
     <ClInclude Include="source\CnmtProcess.h" />
+    <ClInclude Include="source\common.h" />
     <ClInclude Include="source\ElfSymbolParser.h" />
     <ClInclude Include="source\EsTikProcess.h" />
     <ClInclude Include="source\HashTreeMeta.h" />
     <ClInclude Include="source\HashTreeWrappedIFile.h" />
+    <ClInclude Include="source\KeyConfiguration.h" />
     <ClInclude Include="source\NacpProcess.h" />
     <ClInclude Include="source\NcaProcess.h" />
     <ClInclude Include="source\NpdmProcess.h" />
     <ClInclude Include="source\NroProcess.h" />
     <ClInclude Include="source\NsoProcess.h" />
-    <ClInclude Include="source\nstool.h" />
     <ClInclude Include="source\OffsetAdjustedIFile.h" />
     <ClInclude Include="source\PfsProcess.h" />
     <ClInclude Include="source\PkiCertProcess.h" />
@@ -210,6 +211,7 @@
     <ClCompile Include="source\EsTikProcess.cpp" />
     <ClCompile Include="source\HashTreeMeta.cpp" />
     <ClCompile Include="source\HashTreeWrappedIFile.cpp" />
+    <ClCompile Include="source\KeyConfiguration.cpp" />
     <ClCompile Include="source\main.cpp" />
     <ClCompile Include="source\NacpProcess.cpp" />
     <ClCompile Include="source\NcaProcess.cpp" />

programs/nstool/nstool.vcxproj.filters

@@ -40,6 +40,9 @@
     <ClInclude Include="source\HashTreeWrappedIFile.h">
       <Filter>Header Files</Filter>
     </ClInclude>
+    <ClInclude Include="source\KeyConfiguration.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
     <ClInclude Include="source\NacpProcess.h">
       <Filter>Header Files</Filter>
     </ClInclude>
@@ -55,9 +58,6 @@
     <ClInclude Include="source\NsoProcess.h">
       <Filter>Header Files</Filter>
     </ClInclude>
-    <ClInclude Include="source\nstool.h">
-      <Filter>Header Files</Filter>
-    </ClInclude>
     <ClInclude Include="source\OffsetAdjustedIFile.h">
       <Filter>Header Files</Filter>
     </ClInclude>
@@ -88,6 +88,9 @@
     <ClInclude Include="source\XciProcess.h">
       <Filter>Header Files</Filter>
     </ClInclude>
+    <ClInclude Include="source\common.h">
+      <Filter>Header Files</Filter>
+    </ClInclude>
   </ItemGroup>
   <ItemGroup>
     <ClCompile Include="source\AesCtrWrappedIFile.cpp">
@@ -111,6 +114,9 @@
     <ClCompile Include="source\HashTreeWrappedIFile.cpp">
       <Filter>Source Files</Filter>
     </ClCompile>
+    <ClCompile Include="source\KeyConfiguration.cpp">
+      <Filter>Source Files</Filter>
+    </ClCompile>
     <ClCompile Include="source\main.cpp">
       <Filter>Source Files</Filter>
     </ClCompile>

programs/nstool/source/AesCtrWrappedIFile.cpp

@@ -1,7 +1,6 @@
 #include "AesCtrWrappedIFile.h"
 
-AesCtrWrappedIFile::AesCtrWrappedIFile(fnd::IFile* file, bool ownIfile, const fnd::aes::sAes128Key& key, const fnd::aes::sAesIvCtr& ctr) :
+AesCtrWrappedIFile::AesCtrWrappedIFile(const fnd::SharedPtr<fnd::IFile>& file, const fnd::aes::sAes128Key& key, const fnd::aes::sAesIvCtr& ctr) :
-	mOwnIFile(ownIfile),
 	mFile(file),
 	mKey(key),
 	mBaseCtr(ctr),
@@ -10,17 +9,9 @@ AesCtrWrappedIFile::AesCtrWrappedIFile(fnd::IFile* file, bool ownIfile, const fn
 	mCache.alloc(kCacheSizeAllocSize);
 }
 
-AesCtrWrappedIFile::~AesCtrWrappedIFile()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 size_t AesCtrWrappedIFile::size()
 {
-	return mFile->size();
+	return (*mFile)->size();
 }
 
 void AesCtrWrappedIFile::seek(size_t offset)
@@ -44,8 +35,8 @@ void AesCtrWrappedIFile::read(byte_t* out, size_t len)
 
 		//printf("[%x] AesCtrWrappedIFile::read() CACHE READ: readlen=%" PRIx64 "\n", this, read_len);
 		
-		mFile->seek(read_pos);
+		(*mFile)->seek(read_pos);
-		mFile->read(mCache.data(), kCacheSizeAllocSize);
+		(*mFile)->read(mCache.data(), kCacheSizeAllocSize);
 
 		fnd::aes::AesIncrementCounter(mBaseCtr.iv, read_pos>>4, mCurrentCtr.iv);
 		fnd::aes::AesCtr(mCache.data(), kCacheSizeAllocSize, mKey.key, mCurrentCtr.iv, mCache.data());
@@ -81,8 +72,8 @@ void AesCtrWrappedIFile::write(const byte_t* in, size_t len)
 		fnd::aes::AesIncrementCounter(mBaseCtr.iv, write_pos>>4, mCurrentCtr.iv);
 		fnd::aes::AesCtr(mCache.data(), kCacheSizeAllocSize, mKey.key, mCurrentCtr.iv, mCache.data());
 
-		mFile->seek(write_pos);
+		(*mFile)->seek(write_pos);
-		mFile->write(mCache.data(), kCacheSizeAllocSize);
+		(*mFile)->write(mCache.data(), kCacheSizeAllocSize);
 	}
 
 	seek(mFileOffset + len);
@@ -92,7 +83,7 @@ void AesCtrWrappedIFile::write(const byte_t* in, size_t len)
 	{
 		memcpy(mScratch.data() + mBlockOffset, out + (i * kAesCtrScratchSize), kAesCtrScratchSize);
 		fnd::aes::AesCtr(mScratch.data(), kAesCtrScratchAllocSize, mKey.key, mCurrentCtr.iv, mScratch.data());
-		mFile->write(mScratch.data() + mBlockOffset, kAesCtrScratchSize);
+		(*mFile)->write(mScratch.data() + mBlockOffset, kAesCtrScratchSize);
 	}
 
 	if (len % kAesCtrScratchSize)
@@ -101,7 +92,7 @@ void AesCtrWrappedIFile::write(const byte_t* in, size_t len)
 		size_t write_pos = ((len / kAesCtrScratchSize) * kAesCtrScratchSize); 
 		memcpy(mScratch.data() + mBlockOffset, out + write_pos, write_len);
 		fnd::aes::AesCtr(mScratch.data(), kAesCtrScratchAllocSize, mKey.key, mCurrentCtr.iv, mScratch.data());
-		mFile->write(mScratch.data() + mBlockOffset, write_len);
+		(*mFile)->write(mScratch.data() + mBlockOffset, write_len);
 	}
 	*/
 	seek(mFileOffset + len);

programs/nstool/source/AesCtrWrappedIFile.h

@@ -1,12 +1,12 @@
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <fnd/Vec.h>
 #include <fnd/aes.h>
 
 class AesCtrWrappedIFile : public fnd::IFile
 {
 public:
-	AesCtrWrappedIFile(fnd::IFile* file, bool ownIfile, const fnd::aes::sAes128Key& key, const fnd::aes::sAesIvCtr& ctr);
+	AesCtrWrappedIFile(const fnd::SharedPtr<fnd::IFile>& file, const fnd::aes::sAes128Key& key, const fnd::aes::sAesIvCtr& ctr);
-	~AesCtrWrappedIFile();
 
 	size_t size();
 	void seek(size_t offset);
@@ -19,8 +19,7 @@ private:
 	static const size_t kCacheSize = 0x10000;
 	static const size_t kCacheSizeAllocSize = kCacheSize + fnd::aes::kAesBlockSize;
 
-	bool mOwnIFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	fnd::IFile* mFile;
 	fnd::aes::sAes128Key mKey;
 	fnd::aes::sAesIvCtr mBaseCtr, mCurrentCtr;
 	size_t mFileOffset;

programs/nstool/source/AssetProcess.cpp

@@ -1,3 +1,5 @@
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleFile.h>
 #include <fnd/Vec.h>
 #include "AssetProcess.h"
@@ -5,39 +7,23 @@
 
 
 AssetProcess::AssetProcess() :
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false)
 {
-
-}
-
-AssetProcess::~AssetProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
 }
 
 void AssetProcess::process()
 {
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-
 	importHeader();
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
 		displayHeader();
 	processSections();
 }
 
-void AssetProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void AssetProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
 void AssetProcess::setCliOutputMode(CliOutputMode type)
@@ -74,13 +60,19 @@ void AssetProcess::setRomfsExtractPath(const std::string& path)
 void AssetProcess::importHeader()
 {
 	fnd::Vec<byte_t> scratch;
-	if (mFile->size() < sizeof(nn::hac::sAssetHeader))
+
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+
+	if ((*mFile)->size() < sizeof(nn::hac::sAssetHeader))
 	{
 		throw fnd::Exception(kModuleName, "Corrupt ASET: file too small");
 	}
 
 	scratch.alloc(sizeof(nn::hac::sAssetHeader));
-	mFile->read(scratch.data(), 0, scratch.size());
+	(*mFile)->read(scratch.data(), 0, scratch.size());
 
 	mHdr.fromBytes(scratch.data(), scratch.size());
 }
@@ -89,21 +81,21 @@ void AssetProcess::processSections()
 {
 	if (mHdr.getIconInfo().size > 0 && mIconExtractPath.isSet)
 	{
-		if ((mHdr.getIconInfo().size + mHdr.getIconInfo().offset) > mFile->size()) 
+		if ((mHdr.getIconInfo().size + mHdr.getIconInfo().offset) > (*mFile)->size()) 
 			throw fnd::Exception(kModuleName, "ASET geometry for icon beyond file size");
 
 		fnd::SimpleFile outfile(mIconExtractPath.var, fnd::SimpleFile::Create);
 		fnd::Vec<byte_t> cache;
 
 		cache.alloc(mHdr.getIconInfo().size);
-		mFile->read(cache.data(), mHdr.getIconInfo().offset, cache.size());
+		(*mFile)->read(cache.data(), mHdr.getIconInfo().offset, cache.size());
 		outfile.write(cache.data(), cache.size());
 		outfile.close();
 	}
 
 	if (mHdr.getNacpInfo().size > 0)
 	{
-		if ((mHdr.getNacpInfo().size + mHdr.getNacpInfo().offset) > mFile->size()) 
+		if ((mHdr.getNacpInfo().size + mHdr.getNacpInfo().offset) > (*mFile)->size()) 
 			throw fnd::Exception(kModuleName, "ASET geometry for nacp beyond file size");
 
 		if (mNacpExtractPath.isSet)
@@ -112,12 +104,12 @@ void AssetProcess::processSections()
 			fnd::Vec<byte_t> cache;
 
 			cache.alloc(mHdr.getNacpInfo().size);
-			mFile->read(cache.data(), mHdr.getNacpInfo().offset, cache.size());
+			(*mFile)->read(cache.data(), mHdr.getNacpInfo().offset, cache.size());
 			outfile.write(cache.data(), cache.size());
 			outfile.close();
 		}
 		
-		mNacp.setInputFile(new OffsetAdjustedIFile(mFile, false, mHdr.getNacpInfo().offset, mHdr.getNacpInfo().size), true);
+		mNacp.setInputFile(new OffsetAdjustedIFile(mFile, mHdr.getNacpInfo().offset, mHdr.getNacpInfo().size));
 		mNacp.setCliOutputMode(mCliOutputMode);
 		mNacp.setVerifyMode(mVerify);
 
@@ -126,10 +118,10 @@ void AssetProcess::processSections()
 
 	if (mHdr.getRomfsInfo().size > 0)
 	{
-		if ((mHdr.getRomfsInfo().size + mHdr.getRomfsInfo().offset) > mFile->size()) 
+		if ((mHdr.getRomfsInfo().size + mHdr.getRomfsInfo().offset) > (*mFile)->size()) 
 			throw fnd::Exception(kModuleName, "ASET geometry for romfs beyond file size");
 
-		mRomfs.setInputFile(new OffsetAdjustedIFile(mFile, false, mHdr.getRomfsInfo().offset, mHdr.getRomfsInfo().size), true);
+		mRomfs.setInputFile(new OffsetAdjustedIFile(mFile, mHdr.getRomfsInfo().offset, mHdr.getRomfsInfo().size));
 		mRomfs.setCliOutputMode(mCliOutputMode);
 		mRomfs.setVerifyMode(mVerify);
 
@@ -141,16 +133,16 @@ void AssetProcess::displayHeader()
 {
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_LAYOUT))
 	{
-		printf("[ASET Header]\n");
+		std::cout << "[ASET Header]" << std::endl;
-		printf("  Icon:\n");
+		std::cout << "  Icon:" << std::endl;
-		printf("    Offset:       0x%" PRIx64 "\n", mHdr.getIconInfo().offset);
+		std::cout << "    Offset:       0x" << std::hex << mHdr.getIconInfo().offset << std::endl;
-		printf("    Size:         0x%" PRIx64 "\n", mHdr.getIconInfo().size);
+		std::cout << "    Size:         0x" << std::hex << mHdr.getIconInfo().size << std::endl;
-		printf("  NACP:\n");
+		std::cout << "  NACP:" << std::endl;
-		printf("    Offset:       0x%" PRIx64 "\n", mHdr.getNacpInfo().offset);
+		std::cout << "    Offset:       0x" << std::hex << mHdr.getNacpInfo().offset << std::endl;
-		printf("    Size:         0x%" PRIx64 "\n", mHdr.getNacpInfo().size);
+		std::cout << "    Size:         0x" << std::hex << mHdr.getNacpInfo().size << std::endl;
-		printf("  RomFS:\n");
+		std::cout << "  RomFS:" << std::endl;
-		printf("    Offset:       0x%" PRIx64 "\n", mHdr.getRomfsInfo().offset);
+		std::cout << "    Offset:       0x" << std::hex << mHdr.getRomfsInfo().offset << std::endl;
-		printf("    Size:         0x%" PRIx64 "\n", mHdr.getRomfsInfo().size);
+		std::cout << "    Size:         0x" << std::hex << mHdr.getRomfsInfo().size << std::endl;
 	}	
 }
 		

programs/nstool/source/AssetProcess.h

@@ -2,21 +2,21 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/AssetHeader.h>
 #include "NacpProcess.h"
 #include "RomfsProcess.h"
 
-#include "nstool.h"
+#include "common.h"
 
 class AssetProcess
 {
 public:
 	AssetProcess();
-	~AssetProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -30,8 +30,7 @@ public:
 private:
 	const std::string kModuleName = "AssetProcess";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 

programs/nstool/source/CnmtProcess.cpp

@@ -1,184 +1,27 @@
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleTextOutput.h>
 #include "OffsetAdjustedIFile.h"
 #include "CnmtProcess.h"
 
-const std::string kContentTypeStr[7] =
-{
-	"Meta",
-	"Program",
-	"Data",
-	"Control",
-	"HtmlDocument",
-	"LegalInformation",
-	"DeltaFragment"
-};
-
-const std::string kContentMetaTypeStr[2][0x80] =
-{
-	{
-		"",
-		"SystemProgram",
-		"SystemData",
-		"SystemUpdate",
-		"BootImagePackage",
-		"BootImagePackageSafe"
-	},
-	{
-		"Application",
-		"Patch",
-		"AddOnContent",
-		"Delta"
-	}
-};
-
-const std::string kUpdateTypeStr[3] =
-{
-	"ApplyAsDelta",
-	"Overwrite",
-	"Create"
-};
-
-const std::string kContentMetaAttrStr[3] =
-{
-	"IncludesExFatDriver",
-	"Rebootless"
-};
-
-
-std::string kUnknownStr = "Unknown";
-
-inline const char* getBoolStr(bool isTrue)
-{
-	return isTrue? "TRUE" : "FALSE";
-}
-
-inline const char* getContentTypeStr(byte_t i)
-{
-	return i < 7 ? kContentTypeStr[i].c_str() : kUnknownStr.c_str();
-}
-
-inline const char* getContentMetaTypeStr(byte_t i)
-{
-	return (i < 0x80) ? kContentMetaTypeStr[0][i].c_str() : kContentMetaTypeStr[1][i - 0x80].c_str();
-}
-
-void CnmtProcess::displayCmnt()
-{
-#define _SPLIT_VER(ver) ( (ver>>26) & 0x3f), ( (ver>>20) & 0x3f), ( (ver>>16) & 0xf), (ver & 0xffff)
-#define _HEXDUMP_U(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02X", var[a__a__A]); } while(0)
-#define _HEXDUMP_L(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02x", var[a__a__A]); } while(0)
-
-	printf("[ContentMeta]\n");
-	printf("  TitleId:               0x%016" PRIx64 "\n", (uint64_t)mCnmt.getTitleId());
-	printf("  Version:               v%" PRId32 " (%d.%d.%d.%d)\n", (uint32_t)mCnmt.getTitleVersion(), _SPLIT_VER(mCnmt.getTitleVersion()));
-	printf("  Type:                  %s (%d)\n", getContentMetaTypeStr(mCnmt.getType()), mCnmt.getType());
-	printf("  Attributes:            %x\n", mCnmt.getAttributes());
-	printf("    IncludesExFatDriver: %s\n", getBoolStr(_HAS_BIT(mCnmt.getAttributes(), nn::hac::cnmt::ATTRIBUTE_INCLUDES_EX_FAT_DRIVER)));
-	printf("    Rebootless:          %s\n", getBoolStr(_HAS_BIT(mCnmt.getAttributes(), nn::hac::cnmt::ATTRIBUTE_REBOOTLESS)));
-	printf("  RequiredDownloadSystemVersion: v%" PRId32 " (%d.%d.%d.%d)\n", (uint32_t)mCnmt.getRequiredDownloadSystemVersion(), _SPLIT_VER(mCnmt.getRequiredDownloadSystemVersion()));
-	switch(mCnmt.getType())
-	{
-		case (nn::hac::cnmt::METATYPE_APPLICATION):
-			printf("  ApplicationExtendedHeader:\n");
-			printf("    RequiredSystemVersion: v%" PRId32 " (%d.%d.%d.%d)\n", (uint32_t)mCnmt.getApplicationMetaExtendedHeader().required_system_version, _SPLIT_VER(mCnmt.getApplicationMetaExtendedHeader().required_system_version));
-			printf("    PatchId:               0x%016" PRIx64 "\n", (uint64_t)mCnmt.getApplicationMetaExtendedHeader().patch_id);
-			break;
-		case (nn::hac::cnmt::METATYPE_PATCH):
-			printf("  PatchMetaExtendedHeader:\n");
-			printf("    RequiredSystemVersion: v%" PRId32 " (%d.%d.%d.%d))\n", (uint32_t)mCnmt.getPatchMetaExtendedHeader().required_system_version, _SPLIT_VER(mCnmt.getPatchMetaExtendedHeader().required_system_version));
-			printf("    ApplicationId:         0x%016" PRIx64 "\n", (uint64_t)mCnmt.getPatchMetaExtendedHeader().application_id);
-			break;
-		case (nn::hac::cnmt::METATYPE_ADD_ON_CONTENT):
-			printf("  AddOnContentMetaExtendedHeader:\n");
-			printf("    RequiredSystemVersion: v%" PRId32 " (%d.%d.%d.%d)\n", (uint32_t)mCnmt.getAddOnContentMetaExtendedHeader().required_system_version, _SPLIT_VER(mCnmt.getAddOnContentMetaExtendedHeader().required_system_version));
-			printf("    ApplicationId:         0x%016" PRIx64 "\n", (uint64_t)mCnmt.getAddOnContentMetaExtendedHeader().application_id);
-			break;
-		case (nn::hac::cnmt::METATYPE_DELTA):
-			printf("  DeltaMetaExtendedHeader:\n");
-			printf("    ApplicationId:         0x%016" PRIx64 "\n", (uint64_t)mCnmt.getDeltaMetaExtendedHeader().application_id);
-			break;
-		default:
-			break;
-	}
-	if (mCnmt.getContentInfo().size() > 0)
-	{
-		printf("  ContentInfo:\n");
-		for (size_t i = 0; i < mCnmt.getContentInfo().size(); i++)
-		{
-			const nn::hac::ContentMetaBinary::ContentInfo& info = mCnmt.getContentInfo()[i];
-			printf("    %d\n", (int)i);
-			printf("      Type:         %s (%d)\n", getContentTypeStr(info.type), info.type);
-			printf("      Id:           ");
-			_HEXDUMP_L(info.nca_id, nn::hac::cnmt::kContentIdLen);
-			printf("\n");
-			printf("      Size:         0x%" PRIx64 "\n", (uint64_t)info.size);
-			printf("      Hash:         ");
-			_HEXDUMP_L(info.hash.bytes, sizeof(info.hash));
-			printf("\n");
-		}
-	}
-	if (mCnmt.getContentMetaInfo().size() > 0)
-	{
-		printf("  ContentMetaInfo:\n");
-		for (size_t i = 0; i < mCnmt.getContentMetaInfo().size(); i++)
-		{
-			const nn::hac::ContentMetaBinary::ContentMetaInfo& info = mCnmt.getContentMetaInfo()[i];
-			printf("    %d\n", (int)i);
-			printf("      Id:           0x%016" PRIx64 "\n", (uint64_t)info.id);
-			printf("      Version:      v%" PRId32 " (%d.%d.%d.%d)\n", (uint32_t)info.version, _SPLIT_VER(info.version));
-			printf("      Type:         %s (%d)\n", getContentMetaTypeStr(info.type), info.type);
-			printf("      Attributes:   %x\n", mCnmt.getAttributes());
-			printf("        IncludesExFatDriver: %s\n", getBoolStr(_HAS_BIT(mCnmt.getAttributes(), nn::hac::cnmt::ATTRIBUTE_INCLUDES_EX_FAT_DRIVER)));
-			printf("        Rebootless:          %s\n", getBoolStr(_HAS_BIT(mCnmt.getAttributes(), nn::hac::cnmt::ATTRIBUTE_REBOOTLESS)));
-		}
-	}
-	printf("  Digest:   ");
-	_HEXDUMP_L(mCnmt.getDigest().data, nn::hac::cnmt::kDigestLen);
-	printf("\n");
-
-#undef _HEXDUMP_L
-#undef _HEXDUMP_U
-#undef _SPLIT_VER
-}
-
 CnmtProcess::CnmtProcess() :
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false)
 {
 }
 
-CnmtProcess::~CnmtProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void CnmtProcess::process()
 {
-	fnd::Vec<byte_t> scratch;
+	importCnmt();
-
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-
-	scratch.alloc(mFile->size());
-	mFile->read(scratch.data(), 0, scratch.size());
-
-	mCnmt.fromBytes(scratch.data(), scratch.size());
 
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
-		displayCmnt();
+		displayCnmt();
 }
 
-void CnmtProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void CnmtProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
 void CnmtProcess::setCliOutputMode(CliOutputMode type)
@@ -195,3 +38,212 @@ const nn::hac::ContentMetaBinary& CnmtProcess::getContentMetaBinary() const
 {
 	return mCnmt;
 }
+
+void CnmtProcess::importCnmt()
+{
+	fnd::Vec<byte_t> scratch;
+
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+
+	scratch.alloc((*mFile)->size());
+	(*mFile)->read(scratch.data(), 0, scratch.size());
+
+	mCnmt.fromBytes(scratch.data(), scratch.size());
+}
+
+void CnmtProcess::displayCnmt()
+{
+#define _SPLIT_VER(ver) (uint32_t)((ver>>26) & 0x3f) << "." << (uint32_t)((ver>>20) & 0x3f) << "." << (uint32_t)((ver>>16) & 0xf) << "." << (uint32_t)(ver & 0xffff)
+
+	std::cout << "[ContentMeta]" << std::endl;
+	std::cout << "  TitleId:               0x" << std::hex << std::setw(16) << std::setfill('0') << mCnmt.getTitleId() << std::endl;
+	std::cout << "  Version:               v" << std::dec << mCnmt.getTitleVersion() << " (" << _SPLIT_VER(mCnmt.getTitleVersion()) << ")"<< std::endl;
+	std::cout << "  Type:                  " << getContentMetaTypeStr(mCnmt.getType()) << " (" << std::dec << mCnmt.getType() << ")" << std::endl;
+	std::cout << "  Attributes:            0x" << std::hex << (uint32_t)mCnmt.getAttributes() << std::endl;
+	std::cout << "    IncludesExFatDriver: " << getBoolStr(_HAS_BIT(mCnmt.getAttributes(), nn::hac::cnmt::ATTRIBUTE_INCLUDES_EX_FAT_DRIVER)) << std::endl;
+	std::cout << "    Rebootless:          " << getBoolStr(_HAS_BIT(mCnmt.getAttributes(), nn::hac::cnmt::ATTRIBUTE_REBOOTLESS)) << std::endl;
+	std::cout << "  RequiredDownloadSystemVersion: v" << mCnmt.getRequiredDownloadSystemVersion() << " (" << _SPLIT_VER(mCnmt.getRequiredDownloadSystemVersion()) << ")"<< std::endl;
+	switch(mCnmt.getType())
+	{
+		case (nn::hac::cnmt::METATYPE_APPLICATION):
+			std::cout << "  ApplicationExtendedHeader:" << std::endl;
+			std::cout << "    RequiredSystemVersion: v" << std::dec << mCnmt.getApplicationMetaExtendedHeader().required_system_version << " (" << _SPLIT_VER(mCnmt.getApplicationMetaExtendedHeader().required_system_version) << ")"<< std::endl;
+			std::cout << "    PatchId:               0x" << std::hex << std::setw(16) << std::setfill('0') << mCnmt.getApplicationMetaExtendedHeader().patch_id << std::endl;
+			break;
+		case (nn::hac::cnmt::METATYPE_PATCH):
+			std::cout << "  PatchMetaExtendedHeader:" << std::endl;
+			std::cout << "    RequiredSystemVersion: v" << std::dec << mCnmt.getPatchMetaExtendedHeader().required_system_version << " (" << _SPLIT_VER(mCnmt.getPatchMetaExtendedHeader().required_system_version) << ")"<< std::endl;
+			std::cout << "    ApplicationId:         0x" << std::hex << std::setw(16) << std::setfill('0') << mCnmt.getPatchMetaExtendedHeader().application_id << std::endl;
+			break;
+		case (nn::hac::cnmt::METATYPE_ADD_ON_CONTENT):
+			std::cout << "  AddOnContentMetaExtendedHeader:" << std::endl;
+			std::cout << "    RequiredApplicationVersion: v" << std::dec << mCnmt.getAddOnContentMetaExtendedHeader().required_application_version << " (" << _SPLIT_VER(mCnmt.getAddOnContentMetaExtendedHeader().required_application_version) << ")" << std::endl;
+			std::cout << "    ApplicationId:         0x" << std::hex << std::setw(16) << std::setfill('0') << mCnmt.getAddOnContentMetaExtendedHeader().application_id << std::endl;
+			break;
+		case (nn::hac::cnmt::METATYPE_DELTA):
+			std::cout << "  DeltaMetaExtendedHeader:" << std::endl;
+			std::cout << "    ApplicationId:         0x" << std::hex << std::setw(16) << std::setfill('0') << mCnmt.getDeltaMetaExtendedHeader().application_id << std::endl;
+			break;
+		default:
+			break;
+	}
+	if (mCnmt.getContentInfo().size() > 0)
+	{
+		printf("  ContentInfo:\n");
+		for (size_t i = 0; i < mCnmt.getContentInfo().size(); i++)
+		{
+			const nn::hac::ContentMetaBinary::ContentInfo& info = mCnmt.getContentInfo()[i];
+			std::cout << "    " << std::dec << i << std::endl;
+			std::cout << "      Type:         " << getContentTypeStr(info.type) << " (" << std::dec << info.type << ")" << std::endl;
+			std::cout << "      Id:           " << fnd::SimpleTextOutput::arrayToString(info.nca_id, nn::hac::cnmt::kContentIdLen, false, "") << std::endl;
+			std::cout << "      Size:         0x" << std::hex << info.size << std::endl;
+			std::cout << "      Hash:         " << fnd::SimpleTextOutput::arrayToString(info.hash.bytes, sizeof(info.hash), false, "") << std::endl;
+		}
+	}
+	if (mCnmt.getContentMetaInfo().size() > 0)
+	{
+		std::cout << "  ContentMetaInfo:" << std::endl;
+		for (size_t i = 0; i < mCnmt.getContentMetaInfo().size(); i++)
+		{
+			const nn::hac::ContentMetaBinary::ContentMetaInfo& info = mCnmt.getContentMetaInfo()[i];
+			std::cout << "    " << std::dec << i << std::endl;
+			std::cout << "      Id:           0x" << std::hex << std::setw(16) << std::setfill('0') << info.id << std::endl;
+			std::cout << "      Version:      v" << std::dec << info.version << " (" << _SPLIT_VER(info.version) << ")"<< std::endl;
+			std::cout << "      Type:         " << getContentMetaTypeStr(info.type) << " (" << std::dec << info.type << ")" << std::endl; 
+			std::cout << "      Attributes:   0x" << std::hex << (uint32_t)info.attributes << std::endl;
+			std::cout << "        IncludesExFatDriver: " << getBoolStr(_HAS_BIT(info.attributes, nn::hac::cnmt::ATTRIBUTE_INCLUDES_EX_FAT_DRIVER)) << std::endl;
+			std::cout << "        Rebootless:          " << getBoolStr(_HAS_BIT(info.attributes, nn::hac::cnmt::ATTRIBUTE_REBOOTLESS)) << std::endl;
+		}
+	}
+
+	std::cout << "  Digest:   " << fnd::SimpleTextOutput::arrayToString(mCnmt.getDigest().data, nn::hac::cnmt::kDigestLen, false, "") << std::endl;
+
+#undef _SPLIT_VER
+}
+
+const char* CnmtProcess::getBoolStr(bool state) const
+{
+	return state? "TRUE" : "FALSE";
+}
+
+const char* CnmtProcess::getContentTypeStr(nn::hac::cnmt::ContentType type) const
+{
+	const char* str = nullptr;
+
+	switch (type)
+	{
+	case (nn::hac::cnmt::TYPE_META):
+		str = "Meta";
+		break;
+	case (nn::hac::cnmt::TYPE_PROGRAM):
+		str = "Program";
+		break;
+	case (nn::hac::cnmt::TYPE_DATA):
+		str = "Data";
+		break;
+	case (nn::hac::cnmt::TYPE_CONTROL):
+		str = "Control";
+		break;
+	case (nn::hac::cnmt::TYPE_HTML_DOCUMENT):
+		str = "HtmlDocument";
+		break;
+	case (nn::hac::cnmt::TYPE_LEGAL_INFORMATION):
+		str = "LegalInformation";
+		break;
+	case (nn::hac::cnmt::TYPE_DELTA_FRAGMENT):
+		str = "DeltaFragment";
+		break;
+	default:
+		str = "Unknown";
+		break;
+	}
+
+	return str;
+}
+
+const char* CnmtProcess::getContentMetaTypeStr(nn::hac::cnmt::ContentMetaType type) const
+{
+	const char* str = nullptr;
+
+	switch (type)
+	{
+	case (nn::hac::cnmt::METATYPE_SYSTEM_PROGRAM):
+		str = "SystemProgram";
+		break;
+	case (nn::hac::cnmt::METATYPE_SYSTEM_DATA):
+		str = "SystemData";
+		break;
+	case (nn::hac::cnmt::METATYPE_SYSTEM_UPDATE):
+		str = "SystemUpdate";
+		break;
+	case (nn::hac::cnmt::METATYPE_BOOT_IMAGE_PACKAGE):
+		str = "BootImagePackage";
+		break;
+	case (nn::hac::cnmt::METATYPE_BOOT_IMAGE_PACKAGE_SAFE):
+		str = "BootImagePackageSafe";
+		break;
+	case (nn::hac::cnmt::METATYPE_APPLICATION):
+		str = "Application";
+		break;
+	case (nn::hac::cnmt::METATYPE_PATCH):
+		str = "Patch";
+		break;
+	case (nn::hac::cnmt::METATYPE_ADD_ON_CONTENT):
+		str = "AddOnContent";
+		break;
+	case (nn::hac::cnmt::METATYPE_DELTA):
+		str = "Delta";
+		break;
+	default:
+		str = "Unknown";
+		break;
+	}
+
+	return str;
+}
+
+const char* CnmtProcess::getUpdateTypeStr(nn::hac::cnmt::UpdateType type) const
+{
+	const char* str = nullptr;
+
+	switch (type)
+	{
+	case (nn::hac::cnmt::UPDATETYPE_APPLY_AS_DELTA):
+		str = "ApplyAsDelta";
+		break;
+	case (nn::hac::cnmt::UPDATETYPE_OVERWRITE):
+		str = "Overwrite";
+		break;
+	case (nn::hac::cnmt::UPDATETYPE_CREATE):
+		str = "Create";
+		break;
+	default:
+		str = "Unknown";
+		break;
+	}
+
+	return str;
+}
+
+const char* CnmtProcess::getContentMetaAttrStr(nn::hac::cnmt::ContentMetaAttribute attr) const
+{
+	const char* str = nullptr;
+
+	switch (attr)
+	{
+	case (nn::hac::cnmt::ATTRIBUTE_INCLUDES_EX_FAT_DRIVER):
+		str = "IncludesExFatDriver";
+		break;
+	case (nn::hac::cnmt::ATTRIBUTE_REBOOTLESS):
+		str = "Rebootless";
+		break;
+	default:
+		str = "Unknown";
+		break;
+	}
+
+	return str;
+}

programs/nstool/source/CnmtProcess.h

@@ -2,19 +2,19 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/ContentMetaBinary.h>
 
-#include "nstool.h"
+#include "common.h"
 
 class CnmtProcess
 {
 public:
 	CnmtProcess();
-	~CnmtProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -23,12 +23,18 @@ public:
 private:
 	const std::string kModuleName = "CnmtProcess";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 
 	nn::hac::ContentMetaBinary mCnmt;
 
-	void displayCmnt();
+	void importCnmt();
+	void displayCnmt();
+
+	const char* getBoolStr(bool state) const;
+	const char* getContentTypeStr(nn::hac::cnmt::ContentType type) const;
+	const char* getContentMetaTypeStr(nn::hac::cnmt::ContentMetaType type) const;
+	const char* getUpdateTypeStr(nn::hac::cnmt::UpdateType type) const;
+	const char* getContentMetaAttrStr(nn::hac::cnmt::ContentMetaAttribute attr) const;
 };

programs/nstool/source/ElfSymbolParser.cpp

@@ -22,38 +22,38 @@ bool ElfSymbolParser::operator!=(const ElfSymbolParser& other) const
 
 void ElfSymbolParser::parseData(const byte_t *dyn_sym, size_t dyn_sym_size, const byte_t *dyn_str, size_t dyn_str_size, bool is64Bit)
 {
-	//printf("ElfSymbolParser::parseData()");
+	size_t dynSymSize = is64Bit ? sizeof(fnd::Elf64_Sym) : sizeof(fnd::Elf32_Sym);
-	size_t dynSymSize = is64Bit ? sizeof(nn::hac::sElfSymbol64Bit) : sizeof(nn::hac::sElfSymbol32Bit);
 
 	sElfSymbol symbol;
 	for (size_t i = 0; i < dyn_sym_size; i += dynSymSize)
 	{
-		//printf("pos %x\n", i);
-
 		uint32_t name_pos;
 
 		if (is64Bit)
 		{
-			name_pos = ((nn::hac::sElfSymbol64Bit*)(dyn_sym + i))->name.get();
+			name_pos = le_word(((fnd::Elf64_Sym*)(dyn_sym + i))->st_name);
-			symbol.shn_index = (nn::hac::elf::SpecialSectionIndex)((nn::hac::sElfSymbol64Bit*)(dyn_sym + i))->special_section_index.get();
+			symbol.shn_index = le_hword(((fnd::Elf64_Sym*)(dyn_sym + i))->st_shndx);
-			symbol.symbol_type = (nn::hac::elf::SymbolType)((((nn::hac::sElfSymbol64Bit*)(dyn_sym + i))->info) & nn::hac::elf::STT_HIPROC);
+			symbol.symbol_type = fnd::elf::get_elf_st_type(((fnd::Elf64_Sym*)(dyn_sym + i))->st_info);
-			symbol.symbol_binding = (nn::hac::elf::SymbolBinding)(((((nn::hac::sElfSymbol64Bit*)(dyn_sym + i))->info) >> 4) & nn::hac::elf::STB_HIPROC);
+			symbol.symbol_binding = fnd::elf::get_elf_st_bind(((fnd::Elf64_Sym*)(dyn_sym + i))->st_info);
 		}
 		else
 		{
-			name_pos = ((nn::hac::sElfSymbol64Bit*)(dyn_sym + i))->name.get();
+			name_pos = le_word(((fnd::Elf32_Sym*)(dyn_sym + i))->st_name);
-			symbol.shn_index = (nn::hac::elf::SpecialSectionIndex)((nn::hac::sElfSymbol32Bit*)(dyn_sym + i))->special_section_index.get();
+			symbol.shn_index = le_hword(((fnd::Elf32_Sym*)(dyn_sym + i))->st_shndx);
-			symbol.symbol_type = (nn::hac::elf::SymbolType)((((nn::hac::sElfSymbol32Bit*)(dyn_sym + i))->info.get()) & nn::hac::elf::STT_HIPROC);
+			symbol.symbol_type = fnd::elf::get_elf_st_type(((fnd::Elf32_Sym*)(dyn_sym + i))->st_info);
-			symbol.symbol_binding = (nn::hac::elf::SymbolBinding)(((((nn::hac::sElfSymbol32Bit*)(dyn_sym + i))->info.get()) >> 4) & nn::hac::elf::STB_HIPROC);
+			symbol.symbol_binding = fnd::elf::get_elf_st_bind(((fnd::Elf32_Sym*)(dyn_sym + i))->st_info);
 		}
 
-		for (; dyn_str[name_pos] == 0x00 && name_pos < dyn_str_size; name_pos++);
+		if (name_pos >= dyn_str_size)
+		{
+			throw fnd::Exception(kModuleName, "Out of bounds symbol name offset");
+		}
+
+		//for (; dyn_str[name_pos] == 0x00 && name_pos < dyn_str_size; name_pos++);
 		
-		//printf("name_pos = 0x%x\n", name_pos);
 		symbol.name = std::string((char*)&dyn_str[name_pos]);
 		mSymbolList.addElement(symbol);
 	}
-	//printf("ElfSymbolParser::parseData() end\n");
 }
 
 const fnd::List<ElfSymbolParser::sElfSymbol>& ElfSymbolParser::getSymbolList() const

programs/nstool/source/ElfSymbolParser.h

@@ -1,16 +1,16 @@
 #pragma once
 #include <string>
 #include <fnd/List.h>
-#include <nn/hac/elf.h>
+#include <fnd/elf.h>
 
 class ElfSymbolParser
 {
 public:
 	struct sElfSymbol
 	{
-		nn::hac::elf::SpecialSectionIndex shn_index;
+		uint16_t shn_index;
-		nn::hac::elf::SymbolType symbol_type;
+		byte_t symbol_type;
-		nn::hac::elf::SymbolBinding symbol_binding;
+		byte_t symbol_binding;
 		std::string name;
 
 		void operator=(const sElfSymbol& other)
@@ -42,6 +42,7 @@ public:
 
 	const fnd::List<sElfSymbol>& getSymbolList() const;
 private:
+	const std::string kModuleName = "ElfSymbolParser";
 
 	// data
 	fnd::List<sElfSymbol> mSymbolList;

programs/nstool/source/EsTikProcess.cpp

@@ -1,6 +1,5 @@
 #include <iostream>
 #include <iomanip>
-
 #include <fnd/SimpleTextOutput.h>
 #include <nn/pki/SignUtils.h>
 #include "OffsetAdjustedIFile.h"
@@ -10,21 +9,12 @@
 
 
 EsTikProcess::EsTikProcess() :
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false)
 {
 }
 
-EsTikProcess::~EsTikProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void EsTikProcess::process()
 {
 	importTicket();
@@ -36,15 +26,14 @@ void EsTikProcess::process()
 		displayTicket();
 }
 
-void EsTikProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void EsTikProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
-void EsTikProcess::setKeyset(const sKeyset* keyset)
+void EsTikProcess::setKeyCfg(const KeyConfiguration& keycfg)
 {
-	mKeyset = keyset;
+	mKeyCfg = keycfg;
 }
 
 void EsTikProcess::setCertificateChain(const fnd::List<nn::pki::SignedData<nn::pki::CertificateBody>>& certs)
@@ -64,14 +53,16 @@ void EsTikProcess::setVerifyMode(bool verify)
 
 void EsTikProcess::importTicket()
 {
-	if (mFile == nullptr)
+	fnd::Vec<byte_t> scratch;
+
+
+	if (*mFile == nullptr)
 	{
 		throw fnd::Exception(kModuleName, "No file reader set.");
 	}
 
-	fnd::Vec<byte_t> scratch;
+	scratch.alloc((*mFile)->size());
-	scratch.alloc(mFile->size());
+	(*mFile)->read(scratch.data(), 0, scratch.size());
-	mFile->read(scratch.data(), 0, scratch.size());
 	mTik.fromBytes(scratch.data(), scratch.size());
 }
 
@@ -94,7 +85,7 @@ void EsTikProcess::verifyTicket()
 
 	try 
 	{
-		pki_validator.setRootKey(mKeyset->pki.root_sign_key);
+		pki_validator.setKeyCfg(mKeyCfg);
 		pki_validator.addCertificates(mCerts);
 		pki_validator.validateSignature(mTik.getBody().getIssuer(), mTik.getSignature().getSignType(), mTik.getSignature().getSignature(), tik_hash);
 	}
@@ -106,9 +97,7 @@ void EsTikProcess::verifyTicket()
 
 void EsTikProcess::displayTicket()
 {
-#define _SPLIT_VER(ver) ( (ver>>10) & 0x3f), ( (ver>>4) & 0x3f), ( (ver>>0) & 0xf)
+#define _SPLIT_VER(ver) (uint32_t)((ver>>10) & 0x3f) << "." << (uint32_t)((ver>>4) & 0x3f) << "." << (uint32_t)((ver>>0) & 0xf)
-#define _HEXDUMP_U(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02X", var[a__a__A]); } while(0)
-#define _HEXDUMP_L(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02x", var[a__a__A]); } while(0)
 
 	const nn::es::TicketBody_V2& body = mTik.getBody();	
 
@@ -123,14 +112,26 @@ void EsTikProcess::displayTicket()
 	std::cout << "  Title Key:" << std::endl;
 	std::cout << "    EncMode:        " << getTitleKeyPersonalisationStr(body.getTitleKeyEncType()) << std::endl;
 	std::cout << "    KeyGeneration:  " << std::dec << (uint32_t)body.getCommonKeyId() << std::endl;
-	std::cout << "    Data:" << std::endl;
+	if (body.getTitleKeyEncType() == nn::es::ticket::RSA2048)
-	size_t size = body.getTitleKeyEncType() == nn::es::ticket::RSA2048 ? fnd::rsa::kRsa2048Size : fnd::aes::kAes128KeySize;
+	{
-	fnd::SimpleTextOutput::hexDump(body.getEncTitleKey(), size, 0x10, 6);
+		std::cout << "    Data:" << std::endl;
+		for (size_t i = 0; i < 0x10; i++)
+			std::cout << "      " << fnd::SimpleTextOutput::arrayToString(body.getEncTitleKey() + 0x10*i, 0x10, true, ":") << std::endl;
+	}
+	else if (body.getTitleKeyEncType() == nn::es::ticket::AES128_CBC)
+	{
+		std::cout << "    Data:" << std::endl;
+		std::cout << "      " << fnd::SimpleTextOutput::arrayToString(body.getEncTitleKey(), 0x10, true, ":") << std::endl;
+	}
+	else
+	{
+		std::cout << "    Data:           <cannot display>" << std::endl;
+	}
 
-	printf("  Version:          v%d.%d.%d", _SPLIT_VER(body.getTicketVersion()));
+	std::cout << "  Version:          v" << _SPLIT_VER(body.getTicketVersion());
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-		printf(" (%d)", body.getTicketVersion());
+		std::cout << " (" << (uint32_t)body.getTicketVersion() << ")";
-	printf("\n");
+	std::cout << std::endl;
 	
 	std::cout << "  License Type:     " << getLicenseTypeStr(body.getLicenseType()) << std::endl; 
 	
@@ -163,9 +164,6 @@ void EsTikProcess::displayTicket()
 	std::cout << "  SectionNum:             0x" << std::hex << body.getSectionNum() << std::endl;
 	std::cout << "  SectionEntrySize:       0x" << std::hex << body.getSectionEntrySize() << std::endl;
 
-	
-#undef _HEXDUMP_L
-#undef _HEXDUMP_U
 #undef _SPLIT_VER
 }
 

programs/nstool/source/EsTikProcess.h

@@ -2,22 +2,23 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <fnd/Vec.h>
 #include <nn/pki/SignedData.h>
 #include <nn/pki/CertificateBody.h>
 #include <nn/es/TicketBody_V2.h>
-#include "nstool.h"
+#include "KeyConfiguration.h"
+#include "common.h"
 
 class EsTikProcess
 {
 public:
 	EsTikProcess();
-	~EsTikProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
-	void setKeyset(const sKeyset* keyset);
+	void setKeyCfg(const KeyConfiguration& keycfg);
 	void setCertificateChain(const fnd::List<nn::pki::SignedData<nn::pki::CertificateBody>>& certs);
 	void setCliOutputMode(CliOutputMode mode);
 	void setVerifyMode(bool verify);
@@ -25,9 +26,8 @@ public:
 private:
 	const std::string kModuleName = "EsTikProcess";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
+	KeyConfiguration mKeyCfg;
-	const sKeyset* mKeyset;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 	

programs/nstool/source/HashTreeWrappedIFile.cpp

@@ -1,9 +1,8 @@
-#include "nstool.h"
+#include "common.h"
 #include "HashTreeWrappedIFile.h"
 #include "OffsetAdjustedIFile.h"
 
-HashTreeWrappedIFile::HashTreeWrappedIFile(fnd::IFile* file, bool ownIFile, const HashTreeMeta& hdr) :
+HashTreeWrappedIFile::HashTreeWrappedIFile(const fnd::SharedPtr<fnd::IFile>& file, const HashTreeMeta& hdr) :
-	mOwnIFile(ownIFile),
 	mFile(file),
 	mData(nullptr),
 	mDataHashLayer(),
@@ -12,18 +11,9 @@ HashTreeWrappedIFile::HashTreeWrappedIFile(fnd::IFile* file, bool ownIFile, cons
 	initialiseDataLayer(hdr);
 }
 
-HashTreeWrappedIFile::~HashTreeWrappedIFile()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}	
-	delete mData;
-}
-
 size_t HashTreeWrappedIFile::size()
 {
-	return mData->size();
+	return (*mData)->size();
 }
 
 void HashTreeWrappedIFile::seek(size_t offset)
@@ -118,7 +108,7 @@ void HashTreeWrappedIFile::initialiseDataLayer(const HashTreeMeta& hdr)
 		cur.alloc(align(layer.size, layer.block_size));
 
 		// read layer
-		mFile->read(cur.data(), layer.offset, layer.size);
+		(*mFile)->read(cur.data(), layer.offset, layer.size);
 		
 		// validate blocks
 		size_t validate_size;
@@ -145,7 +135,7 @@ void HashTreeWrappedIFile::initialiseDataLayer(const HashTreeMeta& hdr)
 	}
 
 	// generate reader for data layer
-	mData = new OffsetAdjustedIFile(mFile, SHARED_IFILE, hdr.getDataLayer().offset, hdr.getDataLayer().size);
+	mData = new OffsetAdjustedIFile(mFile, hdr.getDataLayer().offset, hdr.getDataLayer().size);
 	mDataOffset = 0;
 	mDataBlockSize = hdr.getDataLayer().block_size;
 
@@ -160,17 +150,17 @@ void HashTreeWrappedIFile::initialiseDataLayer(const HashTreeMeta& hdr)
 
 void HashTreeWrappedIFile::readData(size_t block_offset, size_t block_num)
 {
-	mData->seek(block_offset * mDataBlockSize);
+	(*mData)->seek(block_offset * mDataBlockSize);
 	fnd::sha::sSha256Hash hash;
 
 	// determine read size
 	size_t read_len = 0;
-	if ((block_offset + block_num) == getBlockNum(mData->size()))
+	if ((block_offset + block_num) == getBlockNum((*mData)->size()))
 	{
-		read_len = (block_num-1) * mDataBlockSize + getRemanderBlockReadSize(mData->size());
+		read_len = (block_num-1) * mDataBlockSize + getRemanderBlockReadSize((*mData)->size());
 		memset(mCache.data(), 0, block_num * mDataBlockSize);
 	}
-	else if ((block_offset + block_num) < getBlockNum(mData->size()))
+	else if ((block_offset + block_num) < getBlockNum((*mData)->size()))
 	{
 		read_len = block_num * mDataBlockSize;
 	}
@@ -180,7 +170,7 @@ void HashTreeWrappedIFile::readData(size_t block_offset, size_t block_num)
 	}
 
 	// read
-	mData->read(mCache.data(), block_offset * mDataBlockSize, read_len);
+	(*mData)->read(mCache.data(), block_offset * mDataBlockSize, read_len);
 
 	if (block_num > mCacheBlockNum)
 	{

programs/nstool/source/HashTreeWrappedIFile.h

@@ -1,6 +1,7 @@
 #pragma once
 #include <sstream>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <fnd/Vec.h>
 #include <fnd/sha.h>
 #include "HashTreeMeta.h"
@@ -9,8 +10,7 @@
 class HashTreeWrappedIFile : public fnd::IFile
 {
 public:
-	HashTreeWrappedIFile(fnd::IFile* file, bool ownIFile, const HashTreeMeta& hdr);
+	HashTreeWrappedIFile(const fnd::SharedPtr<fnd::IFile>& file, const HashTreeMeta& hdr);
-	~HashTreeWrappedIFile();
 
 	size_t size();
 	void seek(size_t offset);
@@ -23,11 +23,10 @@ private:
 	static const size_t kDefaultCacheSize = 0x10000;
 	std::stringstream mErrorSs;
 
-	bool mOwnIFile;
+	fnd::SharedPtr<fnd::IFile> mFile;	
-	fnd::IFile* mFile;	
 
 	// data file
-	fnd::IFile* mData;
+	fnd::SharedPtr<fnd::IFile> mData;
 	size_t mDataOffset;
 	size_t mDataBlockSize;
 	fnd::List<fnd::sha::sSha256Hash> mDataHashLayer;

programs/nstool/source/KeyConfiguration.cpp

@@ -0,0 +1,376 @@
+#include "KeyConfiguration.h"
+#include <fnd/ResourceFileReader.h>
+#include <fnd/SimpleTextOutput.h>
+#include <nn/hac/AesKeygen.h>
+#include <nn/hac/NcaUtils.h>
+
+KeyConfiguration::KeyConfiguration()
+{
+	clearGeneralKeyConfiguration();
+	clearNcaExternalKeys();
+}
+
+KeyConfiguration::KeyConfiguration(const KeyConfiguration& other)
+{
+	*this = other;
+}
+
+void KeyConfiguration::operator=(const KeyConfiguration& other)
+{
+	mAcidSignKey = other.mAcidSignKey;	
+	mPkg2SignKey = other.mPkg2SignKey;
+	mNcaHeader0SignKey = other.mNcaHeader0SignKey;
+	mXciHeaderSignKey = other.mXciHeaderSignKey;
+
+	mNcaHeaderKey = other.mNcaHeaderKey;
+	mXciHeaderKey = other.mXciHeaderKey;
+
+	for (size_t i = 0; i < kMasterKeyNum; i++)
+	{
+		mPkg2Key[i] = other.mPkg2Key[i];
+		mPkg1Key[i] = other.mPkg1Key[i];
+		mNcaKeyAreaEncryptionKey[0][i] = other.mNcaKeyAreaEncryptionKey[0][i];
+		mNcaKeyAreaEncryptionKey[1][i] = other.mNcaKeyAreaEncryptionKey[1][i];
+		mNcaKeyAreaEncryptionKey[2][i] = other.mNcaKeyAreaEncryptionKey[2][i];
+		mNcaKeyAreaEncryptionKeyHw[0][i] = other.mNcaKeyAreaEncryptionKeyHw[0][i];
+		mNcaKeyAreaEncryptionKeyHw[1][i] = other.mNcaKeyAreaEncryptionKeyHw[1][i];
+		mNcaKeyAreaEncryptionKeyHw[2][i] = other.mNcaKeyAreaEncryptionKeyHw[2][i];
+		mETicketCommonKey[i] = other.mETicketCommonKey[i];
+	}
+
+	mPkiRootKeyList = other.mPkiRootKeyList;
+	
+	mNcaExternalContentKeyList = other.mNcaExternalContentKeyList;
+}
+
+void KeyConfiguration::importHactoolGenericKeyfile(const std::string& path)
+{
+	clearGeneralKeyConfiguration();
+
+	fnd::ResourceFileReader res;
+	try
+	{
+		res.processFile(path);
+	}
+	catch (const fnd::Exception&)
+	{
+		throw fnd::Exception(kModuleName, "Failed to open key file: " + path);
+	}
+
+	// internally used sources
+	fnd::aes::sAes128Key master_key[kMasterKeyNum] = { kNullAesKey };
+	fnd::aes::sAes128Key package2_key_source = kNullAesKey;
+	fnd::aes::sAes128Key ticket_titlekek_source = kNullAesKey;
+	fnd::aes::sAes128Key key_area_key_source[kNcaKeakNum] = { kNullAesKey, kNullAesKey, kNullAesKey };
+	fnd::aes::sAes128Key aes_kek_generation_source = kNullAesKey;
+	fnd::aes::sAes128Key aes_key_generation_source = kNullAesKey;
+	fnd::aes::sAes128Key nca_header_kek_source = kNullAesKey;
+	fnd::aes::sAesXts128Key nca_header_key_source = kNullAesXtsKey;
+	fnd::rsa::sRsa4096Key pki_root_sign_key = kNullRsa4096Key;
+
+#define _CONCAT_2_STRINGS(str1, str2) ((str1) + "_" + (str2))
+#define _CONCAT_3_STRINGS(str1, str2, str3) _CONCAT_2_STRINGS(_CONCAT_2_STRINGS(str1, str2), str3)
+
+	std::string key,val;
+	fnd::Vec<byte_t> dec_array;
+
+#define _SAVE_KEYDATA(key_name, array, len) \
+	key = (key_name); \
+	val = res[key]; \
+	if (val.empty() == false) { \
+		fnd::SimpleTextOutput::stringToArray(val, dec_array); \
+		if (dec_array.size() != len) \
+			throw fnd::Exception(kModuleName, "Key: \"" + key_name + "\" has incorrect length"); \
+		memcpy(array, dec_array.data(), len); \
+	}
+
+	for (size_t nameidx = 0; nameidx < kNameVariantNum; nameidx++)
+	{
+		// import sources
+		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kPkg2Base[nameidx], kKeyStr, kSourceStr), package2_key_source.key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kTicketCommonKeyBase[nameidx], kSourceStr), ticket_titlekek_source.key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyBase[nameidx], kNcaKeyAreaKeyIndexStr[0], kSourceStr), key_area_key_source[0].key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyBase[nameidx], kNcaKeyAreaKeyIndexStr[1], kSourceStr), key_area_key_source[1].key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyBase[nameidx], kNcaKeyAreaKeyIndexStr[2], kSourceStr), key_area_key_source[2].key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kKekGenBase[nameidx], kSourceStr), aes_kek_generation_source.key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kKeyGenBase[nameidx], kSourceStr), aes_key_generation_source.key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kXciHeaderBase[nameidx], kKekStr, kSourceStr), nca_header_kek_source.key, 0x10);
+		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kXciHeaderBase[nameidx], kKeyStr, kSourceStr), nca_header_key_source.key, 0x20);
+
+		// Store Key Variants/Derivatives
+		for (size_t mkeyidx = 0; mkeyidx < kMasterKeyNum; mkeyidx++)
+		{
+			
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kMasterBase[nameidx], kKeyStr, kKeyIndex[mkeyidx]), master_key[mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kPkg1Base[nameidx], kKeyStr, kKeyIndex[mkeyidx]), mPkg1Key[mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kPkg2Base[nameidx], kKeyStr, kKeyIndex[mkeyidx]), mPkg2Key[mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_2_STRINGS(kTicketCommonKeyBase[nameidx], kKeyIndex[mkeyidx]), mETicketCommonKey[mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyBase[nameidx], kNcaKeyAreaKeyIndexStr[0], kKeyIndex[mkeyidx]), mNcaKeyAreaEncryptionKey[0][mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyBase[nameidx], kNcaKeyAreaKeyIndexStr[1], kKeyIndex[mkeyidx]), mNcaKeyAreaEncryptionKey[1][mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyBase[nameidx], kNcaKeyAreaKeyIndexStr[2], kKeyIndex[mkeyidx]), mNcaKeyAreaEncryptionKey[2][mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyHwBase[nameidx], kNcaKeyAreaKeyIndexStr[0], kKeyIndex[mkeyidx]), mNcaKeyAreaEncryptionKeyHw[0][mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyHwBase[nameidx], kNcaKeyAreaKeyIndexStr[1], kKeyIndex[mkeyidx]), mNcaKeyAreaEncryptionKeyHw[1][mkeyidx].key, 0x10);
+			_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaKeyAreaEncKeyHwBase[nameidx], kNcaKeyAreaKeyIndexStr[2], kKeyIndex[mkeyidx]), mNcaKeyAreaEncryptionKeyHw[2][mkeyidx].key, 0x10);
+		}
+		
+		// store nca header key
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kNcaHeaderBase[nameidx], kKeyStr), mNcaHeaderKey.key[0], 0x20);
+
+		// store xci header key
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kXciHeaderBase[nameidx], kKeyStr), mXciHeaderKey.key, 0x10);
+
+		// store rsa keys
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kNcaHeaderBase[nameidx], kRsaKeyPrivate), mNcaHeader0SignKey.priv_exponent, fnd::rsa::kRsa2048Size);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kNcaHeaderBase[nameidx], kRsaKeyModulus), mNcaHeader0SignKey.modulus, fnd::rsa::kRsa2048Size);
+		
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kXciHeaderBase[nameidx], kRsaKeyPrivate), mXciHeaderSignKey.priv_exponent, fnd::rsa::kRsa2048Size);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kXciHeaderBase[nameidx], kRsaKeyModulus), mXciHeaderSignKey.modulus, fnd::rsa::kRsa2048Size);
+
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kAcidBase[nameidx], kRsaKeyPrivate), mAcidSignKey.priv_exponent, fnd::rsa::kRsa2048Size);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kAcidBase[nameidx], kRsaKeyModulus), mAcidSignKey.modulus, fnd::rsa::kRsa2048Size);
+
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPkg2Base[nameidx], kRsaKeyPrivate), mPkg2SignKey.priv_exponent, fnd::rsa::kRsa2048Size);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPkg2Base[nameidx], kRsaKeyModulus), mPkg2SignKey.modulus, fnd::rsa::kRsa2048Size);
+
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPkiRootBase[nameidx], kRsaKeyPrivate), pki_root_sign_key.priv_exponent, fnd::rsa::kRsa4096Size);
+		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPkiRootBase[nameidx], kRsaKeyModulus), pki_root_sign_key.modulus, fnd::rsa::kRsa4096Size);
+	}
+
+#undef _SAVE_KEYDATA
+#undef _CONCAT_3_STRINGS
+#undef _CONCAT_2_STRINGS
+
+	// Derive keys 
+	for (size_t i = 0; i < kMasterKeyNum; i++)
+	{
+		if (master_key[i] != kNullAesKey)
+		{
+			if (aes_kek_generation_source != kNullAesKey && aes_key_generation_source != kNullAesKey)
+			{
+				if (i == 0 && nca_header_kek_source != kNullAesKey && nca_header_key_source != kNullAesXtsKey)
+				{
+					if (mNcaHeaderKey == kNullAesXtsKey)
+					{
+						fnd::aes::sAes128Key nca_header_kek;
+						nn::hac::AesKeygen::generateKey(nca_header_kek.key, aes_kek_generation_source.key, nca_header_kek_source.key, aes_key_generation_source.key, master_key[i].key);
+						nn::hac::AesKeygen::generateKey(mNcaHeaderKey.key[0], nca_header_key_source.key[0], nca_header_kek.key);
+						nn::hac::AesKeygen::generateKey(mNcaHeaderKey.key[1], nca_header_key_source.key[1], nca_header_kek.key);
+					}
+				}
+
+				for (size_t j = 0; j < nn::hac::nca::kKeyAreaEncryptionKeyNum; j++)
+				{
+					if (key_area_key_source[j] != kNullAesKey && mNcaKeyAreaEncryptionKey[j][i] == kNullAesKey)
+					{
+						nn::hac::AesKeygen::generateKey(mNcaKeyAreaEncryptionKey[j][i].key, aes_kek_generation_source.key, key_area_key_source[j].key, aes_key_generation_source.key, master_key[i].key);
+					}
+				}
+			}
+
+			if (ticket_titlekek_source != kNullAesKey && mETicketCommonKey[i] == kNullAesKey)
+			{
+				nn::hac::AesKeygen::generateKey(mETicketCommonKey[i].key, ticket_titlekek_source.key, master_key[i].key);
+			}
+			if (package2_key_source != kNullAesKey && mPkg2Key[i] == kNullAesKey)
+			{
+				nn::hac::AesKeygen::generateKey(mPkg2Key[i].key, package2_key_source.key, master_key[i].key);
+			}
+		}
+	}
+
+	// populate pki root keys
+	if (pki_root_sign_key != kNullRsa4096Key)
+	{
+		sPkiRootKey tmp;
+
+		tmp.name = nn::pki::sign::kRootIssuerStr;
+		tmp.key_type = nn::pki::sign::SIGN_ALGO_RSA4096;
+		tmp.rsa4096_key = pki_root_sign_key;
+
+		mPkiRootKeyList.addElement(tmp);
+	}
+}
+
+
+void KeyConfiguration::clearGeneralKeyConfiguration()
+{
+	mAcidSignKey = kNullRsa2048Key;
+	mPkg2SignKey = kNullRsa2048Key;
+	mNcaHeader0SignKey = kNullRsa2048Key;
+	mXciHeaderSignKey = kNullRsa2048Key;
+	mPkiRootKeyList.clear();
+
+	mNcaHeaderKey = kNullAesXtsKey;
+	mXciHeaderKey = kNullAesKey;
+
+	for (size_t i = 0; i < kMasterKeyNum; i++)
+	{
+		mPkg1Key[i] = kNullAesKey;
+		mPkg2Key[i] = kNullAesKey;
+		mETicketCommonKey[i] = kNullAesKey;
+		for (size_t j = 0; j < kNcaKeakNum; j++)
+		{
+			mNcaKeyAreaEncryptionKey[j][i] = kNullAesKey;
+			mNcaKeyAreaEncryptionKey[j][i] = kNullAesKey;
+		}
+	}
+}
+
+void KeyConfiguration::clearNcaExternalKeys()
+{
+	mNcaExternalContentKeyList.clear();
+}
+
+bool KeyConfiguration::getNcaHeaderKey(fnd::aes::sAesXts128Key& key) const
+{
+	return copyOutKeyResourceIfExists(mNcaHeaderKey, key, kNullAesXtsKey);
+}
+
+bool KeyConfiguration::getNcaHeader0SignKey(fnd::rsa::sRsa2048Key& key) const
+{
+	return copyOutKeyResourceIfExists(mNcaHeader0SignKey, key, kNullRsa2048Key);
+}
+
+bool KeyConfiguration::getAcidSignKey(fnd::rsa::sRsa2048Key& key) const
+{
+	return copyOutKeyResourceIfExists(mAcidSignKey, key, kNullRsa2048Key);
+}
+
+bool KeyConfiguration::getNcaKeyAreaEncryptionKey(byte_t masterkey_index, byte_t keak_type, fnd::aes::sAes128Key& key) const
+{
+	if (keak_type >= kNcaKeakNum || masterkey_index >= kMasterKeyNum)
+	{
+		return false;
+	}
+	return copyOutKeyResourceIfExists(mNcaKeyAreaEncryptionKey[keak_type][masterkey_index], key, kNullAesKey);
+}
+
+bool KeyConfiguration::getNcaKeyAreaEncryptionKeyHw(byte_t masterkey_index, byte_t keak_type, fnd::aes::sAes128Key& key) const
+{
+	if (keak_type >= kNcaKeakNum || masterkey_index >= kMasterKeyNum)
+	{
+		return false;
+	}
+	return copyOutKeyResourceIfExists(mNcaKeyAreaEncryptionKeyHw[keak_type][masterkey_index], key, kNullAesKey);
+}
+
+void KeyConfiguration::addNcaExternalContentKey(const byte_t rights_id[nn::hac::nca::kRightsIdLen], const fnd::aes::sAes128Key& key)
+{
+	sNcaExternalContentKey tmp;
+	memcpy(tmp.rights_id.data, rights_id, nn::hac::nca::kRightsIdLen);
+	tmp.key = key;
+
+	if (mNcaExternalContentKeyList.hasElement(tmp))
+		return;
+
+	mNcaExternalContentKeyList.addElement(tmp);
+}
+
+bool KeyConfiguration::getNcaExternalContentKey(const byte_t rights_id[nn::hac::nca::kRightsIdLen], fnd::aes::sAes128Key& key) const
+{
+	sRightsId id;
+	bool res_exists = false;
+
+	memcpy(id.data, rights_id, nn::hac::nca::kRightsIdLen);
+	for (size_t i = 0; i < mNcaExternalContentKeyList.size(); i++)
+	{
+		if (mNcaExternalContentKeyList[i].rights_id == id)
+		{
+			res_exists = true;
+			key = mNcaExternalContentKeyList[i].key;
+			break;
+		}
+	}
+
+	return res_exists;
+}
+
+bool KeyConfiguration::getPkg1Key(byte_t masterkey_index, fnd::aes::sAes128Key& key) const
+{
+	if (masterkey_index >= kMasterKeyNum)
+	{
+		return false;
+	}
+	return copyOutKeyResourceIfExists(mPkg1Key[masterkey_index], key, kNullAesKey);
+}
+
+bool KeyConfiguration::getPkg2Key(byte_t masterkey_index, fnd::aes::sAes128Key& key) const
+{
+	if (masterkey_index >= kMasterKeyNum)
+	{
+		return false;
+	}
+	return copyOutKeyResourceIfExists(mPkg2Key[masterkey_index], key, kNullAesKey);
+}
+
+bool KeyConfiguration::getPkg2SignKey(fnd::rsa::sRsa2048Key& key) const
+{
+	return copyOutKeyResourceIfExists(mPkg2SignKey, key, kNullRsa2048Key);
+}
+
+bool KeyConfiguration::getXciHeaderSignKey(fnd::rsa::sRsa2048Key& key) const
+{
+	return copyOutKeyResourceIfExists(mXciHeaderSignKey, key, kNullRsa2048Key);
+}
+
+bool KeyConfiguration::getXciHeaderKey(fnd::aes::sAes128Key& key) const
+{
+	return copyOutKeyResourceIfExists(mXciHeaderKey, key, kNullAesKey);
+}
+
+bool KeyConfiguration::getETicketCommonKey(byte_t masterkey_index, fnd::aes::sAes128Key& key) const
+{
+	if (masterkey_index >= kMasterKeyNum)
+	{
+		return false;
+	}
+	return copyOutKeyResourceIfExists(mETicketCommonKey[masterkey_index], key, kNullAesKey);
+}
+
+bool KeyConfiguration::getPkiRootSignKey(const std::string& root_name, fnd::rsa::sRsa4096Key& key) const
+{
+	bool res_exists = false;
+	for (size_t i = 0; i < mPkiRootKeyList.size(); i++)
+	{
+		if (root_name == mPkiRootKeyList[i].name && mPkiRootKeyList[i].key_type == nn::pki::sign::SIGN_ALGO_RSA4096)
+		{
+			res_exists = true;
+			key = mPkiRootKeyList[i].rsa4096_key;
+			break;
+		}
+	}
+
+	return res_exists;
+}
+
+bool KeyConfiguration::getPkiRootSignKey(const std::string& root_name, fnd::rsa::sRsa2048Key& key) const
+{
+	bool res_exists = false;
+	for (size_t i = 0; i < mPkiRootKeyList.size(); i++)
+	{
+		if (root_name == mPkiRootKeyList[i].name && mPkiRootKeyList[i].key_type == nn::pki::sign::SIGN_ALGO_RSA2048)
+		{
+			res_exists = true;
+			key = mPkiRootKeyList[i].rsa2048_key;
+			break;
+		}
+	}
+
+	return res_exists;
+}
+
+bool KeyConfiguration::getPkiRootSignKey(const std::string& root_name, fnd::ecdsa::sEcdsa240Key& key) const
+{
+	bool res_exists = false;
+	for (size_t i = 0; i < mPkiRootKeyList.size(); i++)
+	{
+		if (root_name == mPkiRootKeyList[i].name && mPkiRootKeyList[i].key_type == nn::pki::sign::SIGN_ALGO_ECDSA240)
+		{
+			res_exists = true;
+			key = mPkiRootKeyList[i].ecdsa240_key;
+			break;
+		}
+	}
+
+	return res_exists;
+}

programs/nstool/source/KeyConfiguration.h

@@ -0,0 +1,209 @@
+#pragma once
+#include <string>
+#include <cstring>
+#include <fnd/types.h>
+#include <fnd/aes.h>
+#include <fnd/rsa.h>
+#include <fnd/ecdsa.h>
+#include <nn/hac/nca.h>
+#include <nn/pki/SignedData.h>
+#include <nn/es/TicketBody_V2.h>
+
+class KeyConfiguration
+{
+public:
+	KeyConfiguration();
+	KeyConfiguration(const KeyConfiguration& other);
+
+	void operator=(const KeyConfiguration& other);
+
+	void importHactoolGenericKeyfile(const std::string& path);
+	//void importHactoolTitleKeyfile(const std::string& path);
+	
+	void clearGeneralKeyConfiguration();
+	void clearNcaExternalKeys();
+
+	// nca keys
+	bool getNcaHeaderKey(fnd::aes::sAesXts128Key& key) const;
+	bool getNcaHeader0SignKey(fnd::rsa::sRsa2048Key& key) const;
+	bool getAcidSignKey(fnd::rsa::sRsa2048Key& key) const;
+	bool getNcaKeyAreaEncryptionKey(byte_t masterkey_index, byte_t keak_type, fnd::aes::sAes128Key& key) const;
+	bool getNcaKeyAreaEncryptionKeyHw(byte_t masterkey_index, byte_t keak_type, fnd::aes::sAes128Key& key) const;
+	
+	// external content keys
+	void addNcaExternalContentKey(const byte_t rights_id[nn::hac::nca::kRightsIdLen], const fnd::aes::sAes128Key& key);
+	bool getNcaExternalContentKey(const byte_t rights_id[nn::hac::nca::kRightsIdLen], fnd::aes::sAes128Key& key) const;
+
+	// pkg1/pkg2
+	bool getPkg1Key(byte_t masterkey_index, fnd::aes::sAes128Key& key) const;
+	bool getPkg2Key(byte_t masterkey_index, fnd::aes::sAes128Key& key) const;
+	bool getPkg2SignKey(fnd::rsa::sRsa2048Key& key) const;
+
+	// xci keys
+	bool getXciHeaderSignKey(fnd::rsa::sRsa2048Key& key) const;
+	bool getXciHeaderKey(fnd::aes::sAes128Key& key) const;
+
+	// ticket
+	bool getETicketCommonKey(byte_t masterkey_index, fnd::aes::sAes128Key& key) const;
+
+	// pki
+	bool getPkiRootSignKey(const std::string& root_name, fnd::rsa::sRsa4096Key& key) const;
+	bool getPkiRootSignKey(const std::string& root_name, fnd::rsa::sRsa2048Key& key) const;
+	bool getPkiRootSignKey(const std::string& root_name, fnd::ecdsa::sEcdsa240Key& key) const;
+private:
+	const std::string kModuleName = "KeyConfiguration";
+	const fnd::aes::sAes128Key kNullAesKey = {{0}};
+	const fnd::aes::sAesXts128Key kNullAesXtsKey = {{{0}}};
+	const fnd::rsa::sRsa4096Key kNullRsa4096Key = {{0}, {0}, {0}};
+	const fnd::rsa::sRsa2048Key kNullRsa2048Key = {{0}, {0}, {0}};
+	static const size_t kMasterKeyNum = 0x20;
+	static const size_t kNcaKeakNum = nn::hac::nca::kKeyAreaEncryptionKeyNum;
+
+	// keynames
+	enum NameVariantIndex
+	{
+		NNTOOLS,
+		LEGACY_HACTOOL,
+		LEGACY_0
+	};
+	static const size_t kNameVariantNum = 3;
+	const std::string kMasterBase[kNameVariantNum] = { "master", "master", "master" };
+	const std::string kPkg1Base[kNameVariantNum] = { "package1", "package1", "package1" };
+	const std::string kPkg2Base[kNameVariantNum] = { "package2", "package2", "package2" };
+	const std::string kXciHeaderBase[kNameVariantNum] = { "xci_header", "xci_header", "xci_header" };
+	const std::string kNcaHeaderBase[kNameVariantNum] = { "nca_header", "header", "nca_header" };
+	const std::string kAcidBase[kNameVariantNum] = { "acid", "acid", "acid" };
+	const std::string kPkiRootBase[kNameVariantNum] = { "pki_root", "pki_root", "pki_root" };
+	const std::string kTicketCommonKeyBase[kNameVariantNum] = { "ticket_commonkey", "titlekek", "ticket_commonkey" };
+	const std::string kNcaKeyAreaEncKeyBase[kNameVariantNum] = { "nca_key_area_key", "key_area_key", "nca_body_keak" };
+	const std::string kNcaKeyAreaEncKeyHwBase[kNameVariantNum] = { "nca_key_area_key_hw", "key_area_hw_key", "nca_key_area_key_hw" };
+	const std::string kKekGenBase[kNameVariantNum] = { "aes_kek_generation", "aes_kek_generation", "aes_kek_generation" };
+	const std::string kKeyGenBase[kNameVariantNum] = { "aes_key_generation", "aes_key_generation", "aes_key_generation" };
+
+	// misc str
+	const std::string kKeyStr = "key";
+	const std::string kKekStr = "kek";
+	const std::string kSourceStr = "source";
+	const std::string kRsaKeyModulus = "sign_key_modulus";
+	const std::string kRsaKeyPrivate = "sign_key_private";
+	const std::string kNcaKeyAreaKeyIndexStr[kNcaKeakNum] = { "application", "ocean", "system" };	
+	const std::string kKeyIndex[kMasterKeyNum] = {"00","01","02","03","04","05","06","07","08","09","0a","0b","0c","0d","0e","0f","10","11","12","13","14","15","16","17","18","19","1a","1b","1c","1d","1e","1f"};
+
+	struct sRightsId
+	{
+		byte_t data[nn::hac::nca::kRightsIdLen];
+
+		void operator=(const sRightsId& other)
+		{
+			memcpy(this->data, other.data, nn::hac::nca::kRightsIdLen);
+		}
+
+		bool operator==(const sRightsId& other) const
+		{
+			return memcmp(this->data, other.data, nn::hac::nca::kRightsIdLen) == 0;
+		}
+
+		bool operator!=(const sRightsId& other) const
+		{
+			return !(operator==(other));
+		}
+	};
+
+	struct sNcaExternalContentKey
+	{
+		sRightsId rights_id;
+		fnd::aes::sAes128Key key;
+
+		void operator=(const sNcaExternalContentKey& other)
+		{
+			rights_id = other.rights_id;
+			key = other.key;
+		}
+
+		bool operator==(const sNcaExternalContentKey& other) const
+		{
+			return (rights_id == other.rights_id) \
+				&& (key == other.key);
+		}
+
+		bool operator!=(const sNcaExternalContentKey& other) const
+		{
+			return !(operator==(other));
+		}
+	};
+
+	struct sPkiRootKey
+	{
+		std::string name;
+		nn::pki::sign::SignatureAlgo key_type;
+		fnd::rsa::sRsa4096Key rsa4096_key;
+		fnd::rsa::sRsa2048Key rsa2048_key;
+		fnd::ecdsa::sEcdsa240Key ecdsa240_key;
+
+		void operator=(const sPkiRootKey& other)
+		{
+			name = other.name;
+			key_type = other.key_type;
+			rsa4096_key = other.rsa4096_key;
+			rsa2048_key = other.rsa2048_key;
+			ecdsa240_key = other.ecdsa240_key;
+		}
+
+		bool operator==(const sPkiRootKey& other) const
+		{
+			return (name == other.name) \
+				&& (key_type == other.key_type) \
+				&& (rsa4096_key == other.rsa4096_key) \
+				&& (rsa2048_key == other.rsa2048_key) \
+				&& (ecdsa240_key == other.ecdsa240_key);
+		}
+
+		bool operator!=(const sPkiRootKey& other) const
+		{
+			return !(operator==(other));
+		}
+	};
+	
+
+	/* general key config */
+	// acid
+	fnd::rsa::sRsa2048Key mAcidSignKey;
+
+	// pkg1 and pkg2
+	fnd::aes::sAes128Key mPkg1Key[kMasterKeyNum];
+	fnd::rsa::sRsa2048Key mPkg2SignKey;
+	fnd::aes::sAes128Key mPkg2Key[kMasterKeyNum];
+
+	// nca
+	fnd::rsa::sRsa2048Key mNcaHeader0SignKey;
+	fnd::aes::sAesXts128Key mNcaHeaderKey;
+	fnd::aes::sAes128Key mNcaKeyAreaEncryptionKey[kNcaKeakNum][kMasterKeyNum];
+	fnd::aes::sAes128Key mNcaKeyAreaEncryptionKeyHw[kNcaKeakNum][kMasterKeyNum];
+
+	// xci
+	fnd::rsa::sRsa2048Key mXciHeaderSignKey;
+	fnd::aes::sAes128Key mXciHeaderKey;
+
+	// ticket
+	fnd::aes::sAes128Key mETicketCommonKey[kMasterKeyNum];
+
+	// pki
+	fnd::List<sPkiRootKey> mPkiRootKeyList;
+
+	/* Nca External Keys */
+	fnd::List<sNcaExternalContentKey> mNcaExternalContentKeyList;
+
+	template <class T>
+	bool copyOutKeyResourceIfExists(const T& src, T& dst, const T& null_sample) const
+	{
+		bool resource_exists = false;
+
+		if (src != null_sample)
+		{
+			resource_exists = true;
+			dst = src;
+		}	
+
+		return resource_exists;
+	}
+};

programs/nstool/source/NacpProcess.cpp

@@ -1,11 +1,185 @@
 #include <sstream>
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleTextOutput.h>
 #include "OffsetAdjustedIFile.h"
 #include "NacpProcess.h"
 
-const char* getLanguageStr(nn::hac::nacp::Language var)
+NacpProcess::NacpProcess() :
+	mFile(),
+	mCliOutputMode(_BIT(OUTPUT_BASIC)),
+	mVerify(false)
+{
+}
+
+void NacpProcess::process()
+{
+	importNacp();
+
+	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
+		displayNacp();
+}
+
+void NacpProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
+{
+	mFile = file;
+}
+
+void NacpProcess::setCliOutputMode(CliOutputMode type)
+{
+	mCliOutputMode = type;
+}
+
+void NacpProcess::setVerifyMode(bool verify)
+{
+	mVerify = verify;
+}
+
+const nn::hac::ApplicationControlPropertyBinary& NacpProcess::getApplicationControlPropertyBinary() const
+{
+	return mNacp;
+}
+
+void NacpProcess::importNacp()
+{
+	fnd::Vec<byte_t> scratch;
+
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+
+	scratch.alloc((*mFile)->size());
+	(*mFile)->read(scratch.data(), 0, scratch.size());
+
+	mNacp.fromBytes(scratch.data(), scratch.size());
+}
+
+void NacpProcess::displayNacp()
+{
+	std::cout << "[ApplicationControlProperty]" << std::endl;
+	std::cout << "  Menu Description:" << std::endl;
+	std::cout << "    DisplayVersion:               " << mNacp.getDisplayVersion() << std::endl;
+	if (mNacp.getIsbn().empty() == false || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+		std::cout << "    ISBN:                         " << mNacp.getIsbn() << std::endl;
+	for (size_t i = 0; i < mNacp.getTitle().size(); i++)
+	{
+		std::cout << "    " << getLanguageStr(mNacp.getTitle()[i].language) << " Title:" << std::endl;
+		std::cout << "      Name:                       " << mNacp.getTitle()[i].name << std::endl;
+		std::cout << "      Publisher:                  " << mNacp.getTitle()[i].publisher << std::endl;
+	}
+	std::cout << "  Logo:" << std::endl;
+	std::cout << "    Type:                         " << getLogoTypeStr(mNacp.getLogoType()) << std::endl;
+	std::cout << "    Handling:                     " << getLogoHandlingStr(mNacp.getLogoHandling()) << std::endl;
+	std::cout << "  AddOnContent:" << std::endl;
+	std::cout << "    BaseId:                       0x" << std::hex << std::setw(16) << std::setfill('0') << mNacp.getAocBaseId() << std::endl;
+	std::cout << "    RegistrationType:             " << getAocRegistrationTypeStr(mNacp.getAocRegistrationType()) << std::endl;
+	std::cout << "    RuntimeInstallMode:           " << getRuntimeAocInstallModeStr(mNacp.getRuntimeAocInstallMode()) << std::endl;
+	std::cout << "  Play Log:" << std::endl;
+	std::cout << "    PlayLogPolicy:                " << getPlayLogPolicyStr(mNacp.getPlayLogPolicy()) << std::endl;
+	std::cout << "    PlayLogQueryCapability:       " << getPlayLogQueryCapabilityStr(mNacp.getPlayLogQueryCapability()) << std::endl;
+	if (mNacp.getPlayLogQueryableApplicationId().size() > 0)
+	{
+		std::cout << "    PlayLogQueryableApplicationId:" << std::endl;
+		for (size_t i = 0; i < mNacp.getPlayLogQueryableApplicationId().size(); i++)
+		{
+			std::cout << "      0x" << std::hex << std::setw(16) << std::setfill('0') << mNacp.getPlayLogQueryableApplicationId()[i] << std::endl;
+		}
+	}
+	std::cout << "  Parental Controls:" << std::endl;
+	std::cout << "    ParentalControlFlag:          " << getParentalControlFlagStr(mNacp.getParentalControlFlag()) << std::endl;
+	for (size_t i = 0; i < mNacp.getRatingAge().size(); i++)
+	{
+		std::cout << "    Age Restriction:" << std::endl;
+		std::cout << "      Agency:  " << getOrganisationStr(mNacp.getRatingAge()[i].organisation) << std::endl;
+		std::cout << "      Age:     " << std::dec << (uint32_t)mNacp.getRatingAge()[i].age << std::endl;
+	}
+	
+	if (mNacp.getBcatPassphase().empty() == false || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "  BCAT:" << std::endl;
+		std::cout << "    BcatPassphase:                " << mNacp.getBcatPassphase() << std::endl;
+		std::cout << "    DeliveryCacheStorageSize:     0x" << std::hex << mNacp.getBcatDeliveryCacheStorageSize() << std::endl;
+	}
+	if (mNacp.getLocalCommunicationId().size() > 0)
+	{
+		std::cout << "  Local Area Communication:" << std::endl;
+		std::cout << "    LocalCommunicationId:" << std::endl;
+		for (size_t i = 0; i < mNacp.getLocalCommunicationId().size(); i++)
+		{
+			std::cout << "      0x" << std::hex << std::setw(16) << std::setfill('0') << mNacp.getLocalCommunicationId()[i] << std::endl;
+		}
+	}
+	std::cout << "  SaveData:" << std::endl;
+	std::cout << "    SaveDatawOwnerId:             0x" << std::hex << std::setw(16) << std::setfill('0') << mNacp.getSaveDatawOwnerId() << std::endl;
+	if (mNacp.getUserAccountSaveDataSize().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    UserAccountSaveData:" << std::endl;
+		std::cout << "      Size:                       " << getSaveDataSizeStr(mNacp.getUserAccountSaveDataSize().size) << std::endl;
+		std::cout << "      JournalSize:                " << getSaveDataSizeStr(mNacp.getUserAccountSaveDataSize().journal_size) << std::endl;
+	}
+	if (mNacp.getDeviceSaveDataSize().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    DeviceSaveData:" << std::endl;
+		std::cout << "      Size:                       " << getSaveDataSizeStr(mNacp.getDeviceSaveDataSize().size) << std::endl;
+		std::cout << "      JournalSize:                " << getSaveDataSizeStr(mNacp.getDeviceSaveDataSize().journal_size) << std::endl;
+	}
+	if (mNacp.getUserAccountSaveDataMax().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    UserAccountSaveDataMax:" << std::endl;
+		std::cout << "      Size:                       " << getSaveDataSizeStr(mNacp.getUserAccountSaveDataMax().size) << std::endl;
+		std::cout << "      JournalSize:                " << getSaveDataSizeStr(mNacp.getUserAccountSaveDataMax().journal_size) << std::endl;
+	}
+	if (mNacp.getDeviceSaveDataMax().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    DeviceSaveDataMax:" << std::endl;
+		std::cout << "      Size:                       " << getSaveDataSizeStr(mNacp.getDeviceSaveDataMax().size) << std::endl;
+		std::cout << "      JournalSize:                " << getSaveDataSizeStr(mNacp.getDeviceSaveDataMax().journal_size) << std::endl;
+	}
+	if (mNacp.getTemporaryStorageSize() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    TemporaryStorageSize:         " << getSaveDataSizeStr(mNacp.getTemporaryStorageSize()) << std::endl;
+	}
+	if (mNacp.getCacheStorageSize().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    CacheStorage:" << std::endl;
+		std::cout << "      Size:                       " << getSaveDataSizeStr(mNacp.getCacheStorageSize().size) << std::endl;
+		std::cout << "      JournalSize:                " << getSaveDataSizeStr(mNacp.getCacheStorageSize().journal_size) << std::endl;
+		std::cout << "      MaxDataAndJournalSize:      " << getSaveDataSizeStr(mNacp.getCacheStorageDataAndJournalSizeMax()) << std::endl;
+		std::cout << "      StorageIndexMax:            0x" << std::hex << mNacp.getCacheStorageIndexMax() << std::endl;
+	}
+	std::cout << "  Other Flags:" << std::endl;
+	std::cout << "    StartupUserAccount:           " << getStartupUserAccountStr(mNacp.getStartupUserAccount()) << std::endl;
+	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    TouchScreenUsageMode:         " << getTouchScreenUsageModeStr(mNacp.getTouchScreenUsageMode()) << std::endl;
+	}
+	std::cout << "    AttributeFlag:                " << getAttributeFlagStr(mNacp.getAttributeFlag()) << std::endl;
+	std::cout << "    CrashReportMode:              " << getCrashReportModeStr(mNacp.getCrashReportMode()) << std::endl;
+	std::cout << "    HDCP:                         " << getHdcpStr(mNacp.getHdcp()) << std::endl;
+	std::cout << "    ScreenshotMode:               " << getScreenshotModeStr(mNacp.getScreenshotMode()) << std::endl;
+	std::cout << "    VideoCaptureMode:             " << getVideoCaptureModeStr(mNacp.getVideoCaptureMode()) << std::endl;
+	std::cout << "    DataLossConfirmation:         " << getDataLossConfirmationStr(mNacp.getDataLossConfirmation()) << std::endl;
+	std::cout << "    RepairFlag:                   " << getRepairFlagStr(mNacp.getRepairFlag()) << std::endl;
+	std::cout << "    ProgramIndex:                 0x" << std::hex << std::setw(2) << std::setfill('0') << (uint32_t)mNacp.getProgramIndex() << std::endl;
+	if (mNacp.getApplicationErrorCodeCategory().empty() == false || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "    ApplicationErrorCodeCategory: " << mNacp.getApplicationErrorCodeCategory() << std::endl;
+	}
+	if (mNacp.getSeedForPsuedoDeviceId() > 0 || mNacp.getPresenceGroupId() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+	{
+		std::cout << "  Other Ids:" << std::endl;
+		if (mNacp.getSeedForPsuedoDeviceId() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+			std::cout << "    SeedForPsuedoDeviceId:        0x" << std::hex << std::setw(16) << std::setfill('0') << mNacp.getSeedForPsuedoDeviceId() << std::endl;
+		if (mNacp.getPresenceGroupId() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
+			std::cout << "    PresenceGroupId:              0x" << std::hex << std::setw(16) << std::setfill('0') << mNacp.getPresenceGroupId() << std::endl;
+	}
+}
+
+const char* NacpProcess::getLanguageStr(nn::hac::nacp::Language var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::LANG_AmericanEnglish):
@@ -56,12 +230,14 @@ const char* getLanguageStr(nn::hac::nacp::Language var)
 	default:
 		str = "Unknown";
 	}
+	
 	return str;
 }
 
-const char* getStartupUserAccountStr(nn::hac::nacp::StartupUserAccount var)
+const char* NacpProcess::getStartupUserAccountStr(nn::hac::nacp::StartupUserAccount var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::USER_None):
@@ -76,12 +252,14 @@ const char* getStartupUserAccountStr(nn::hac::nacp::StartupUserAccount var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getTouchScreenUsageModeStr(nn::hac::nacp::TouchScreenUsageMode var)
+const char* NacpProcess::getTouchScreenUsageModeStr(nn::hac::nacp::TouchScreenUsageMode var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::TOUCH_None):
@@ -96,12 +274,14 @@ const char* getTouchScreenUsageModeStr(nn::hac::nacp::TouchScreenUsageMode var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getAocRegistrationTypeStr(nn::hac::nacp::AocRegistrationType var)
+const char* NacpProcess::getAocRegistrationTypeStr(nn::hac::nacp::AocRegistrationType var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::AOC_AllOnLaunch):
@@ -113,12 +293,14 @@ const char* getAocRegistrationTypeStr(nn::hac::nacp::AocRegistrationType var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getAttributeFlagStr(nn::hac::nacp::AttributeFlag var)
+const char* NacpProcess::getAttributeFlagStr(nn::hac::nacp::AttributeFlag var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::ATTR_None):
@@ -133,12 +315,14 @@ const char* getAttributeFlagStr(nn::hac::nacp::AttributeFlag var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getParentalControlFlagStr(nn::hac::nacp::ParentalControlFlag var)
+const char* NacpProcess::getParentalControlFlagStr(nn::hac::nacp::ParentalControlFlag var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::PC_None):
@@ -150,12 +334,14 @@ const char* getParentalControlFlagStr(nn::hac::nacp::ParentalControlFlag var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getScreenshotModeStr(nn::hac::nacp::ScreenshotMode var)
+const char* NacpProcess::getScreenshotModeStr(nn::hac::nacp::ScreenshotMode var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::SCRN_Allow):
@@ -167,12 +353,14 @@ const char* getScreenshotModeStr(nn::hac::nacp::ScreenshotMode var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getVideoCaptureModeStr(nn::hac::nacp::VideoCaptureMode var)
+const char* NacpProcess::getVideoCaptureModeStr(nn::hac::nacp::VideoCaptureMode var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::VCAP_Disable):
@@ -187,12 +375,14 @@ const char* getVideoCaptureModeStr(nn::hac::nacp::VideoCaptureMode var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getDataLossConfirmationStr(nn::hac::nacp::DataLossConfirmation var)
+const char* NacpProcess::getDataLossConfirmationStr(nn::hac::nacp::DataLossConfirmation var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::DLOSS_None):
@@ -204,12 +394,14 @@ const char* getDataLossConfirmationStr(nn::hac::nacp::DataLossConfirmation var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getPlayLogPolicyStr(nn::hac::nacp::PlayLogPolicy var)
+const char* NacpProcess::getPlayLogPolicyStr(nn::hac::nacp::PlayLogPolicy var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::PLP_All):
@@ -224,12 +416,14 @@ const char* getPlayLogPolicyStr(nn::hac::nacp::PlayLogPolicy var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getOrganisationStr(nn::hac::nacp::Organisation var)
+const char* NacpProcess::getOrganisationStr(nn::hac::nacp::Organisation var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::ORGN_CERO):
@@ -271,12 +465,14 @@ const char* getOrganisationStr(nn::hac::nacp::Organisation var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getLogoTypeStr(nn::hac::nacp::LogoType var)
+const char* NacpProcess::getLogoTypeStr(nn::hac::nacp::LogoType var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::LOGO_LicensedByNintendo):
@@ -291,12 +487,14 @@ const char* getLogoTypeStr(nn::hac::nacp::LogoType var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getLogoHandlingStr(nn::hac::nacp::LogoHandling var)
+const char* NacpProcess::getLogoHandlingStr(nn::hac::nacp::LogoHandling var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::LHND_Auto):
@@ -308,12 +506,14 @@ const char* getLogoHandlingStr(nn::hac::nacp::LogoHandling var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getRuntimeAocInstallModeStr(nn::hac::nacp::RuntimeAocInstallMode var)
+const char* NacpProcess::getRuntimeAocInstallModeStr(nn::hac::nacp::RuntimeAocInstallMode var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::RTAOC_Deny):
@@ -325,12 +525,14 @@ const char* getRuntimeAocInstallModeStr(nn::hac::nacp::RuntimeAocInstallMode var
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getCrashReportModeStr(nn::hac::nacp::CrashReportMode var)
+const char* NacpProcess::getCrashReportModeStr(nn::hac::nacp::CrashReportMode var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::CREP_Deny):
@@ -342,12 +544,14 @@ const char* getCrashReportModeStr(nn::hac::nacp::CrashReportMode var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getHdcpStr(nn::hac::nacp::Hdcp var)
+const char* NacpProcess::getHdcpStr(nn::hac::nacp::Hdcp var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::HDCP_None):
@@ -359,12 +563,14 @@ const char* getHdcpStr(nn::hac::nacp::Hdcp var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getPlayLogQueryCapabilityStr(nn::hac::nacp::PlayLogQueryCapability var)
+const char* NacpProcess::getPlayLogQueryCapabilityStr(nn::hac::nacp::PlayLogQueryCapability var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::PLQC_None):
@@ -379,12 +585,14 @@ const char* getPlayLogQueryCapabilityStr(nn::hac::nacp::PlayLogQueryCapability v
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-const char* getRepairFlagStr(nn::hac::nacp::RepairFlag var)
+const char* NacpProcess::getRepairFlagStr(nn::hac::nacp::RepairFlag var) const
 {
 	const char* str = nullptr;
+
 	switch(var)
 	{
 	case (nn::hac::nacp::REPF_None):
@@ -396,10 +604,11 @@ const char* getRepairFlagStr(nn::hac::nacp::RepairFlag var)
 	default:
 		str = "Unknown";
 	}
+
 	return str;
 }
 
-std::string getSaveDataSizeStr(int64_t size)
+std::string NacpProcess::getSaveDataSizeStr(int64_t size) const
 {
 	static const int64_t kKiloByte = 1024;
 	static const int64_t kMegaByte = 1024 * 1024;
@@ -422,179 +631,3 @@ std::string getSaveDataSizeStr(int64_t size)
 
 	return sstr.str();
 }
-
-NacpProcess::NacpProcess() :
-	mFile(nullptr),
-	mOwnIFile(false),
-	mCliOutputMode(_BIT(OUTPUT_BASIC)),
-	mVerify(false)
-{
-}
-
-NacpProcess::~NacpProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
-void NacpProcess::process()
-{
-	fnd::Vec<byte_t> scratch;
-
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-
-	scratch.alloc(mFile->size());
-	mFile->read(scratch.data(), 0, scratch.size());
-
-	mNacp.fromBytes(scratch.data(), scratch.size());
-
-	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
-		displayNacp();
-}
-
-void NacpProcess::setInputFile(fnd::IFile* file, bool ownIFile)
-{
-	mFile = file;
-	mOwnIFile = ownIFile;
-}
-
-void NacpProcess::setCliOutputMode(CliOutputMode type)
-{
-	mCliOutputMode = type;
-}
-
-void NacpProcess::setVerifyMode(bool verify)
-{
-	mVerify = verify;
-}
-
-const nn::hac::ApplicationControlPropertyBinary& NacpProcess::getApplicationControlPropertyBinary() const
-{
-	return mNacp;
-}
-
-void NacpProcess::displayNacp()
-{
-	printf("[ApplicationControlProperty]\n");
-	printf("  Menu Description:\n");
-	printf("    DisplayVersion:               %s\n", mNacp.getDisplayVersion().c_str());
-	if (mNacp.getIsbn().empty() == false || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-		printf("    ISBN:                         %s\n", mNacp.getIsbn().c_str());
-	for (size_t i = 0; i < mNacp.getTitle().size(); i++)
-	{
-		printf("    %s Title:\n", getLanguageStr(mNacp.getTitle()[i].language));
-		printf("      Name:                       %s\n", mNacp.getTitle()[i].name.c_str());
-		printf("      Publisher:                  %s\n", mNacp.getTitle()[i].publisher.c_str());
-	}
-	printf("  Logo:\n");
-	printf("    Type:                         %s\n", getLogoTypeStr(mNacp.getLogoType()));
-	printf("    Handling:                     %s\n", getLogoHandlingStr(mNacp.getLogoHandling()));
-	printf("  AddOnContent:\n");
-	printf("    BaseId:                       0x%016" PRIx64 "\n", mNacp.getAocBaseId());
-	printf("    RegistrationType:             %s\n", getAocRegistrationTypeStr(mNacp.getAocRegistrationType()));
-	printf("    RuntimeInstallMode:           %s\n", getRuntimeAocInstallModeStr(mNacp.getRuntimeAocInstallMode()));
-	printf("  Play Log:\n");
-	printf("    PlayLogPolicy:                %s\n", getPlayLogPolicyStr(mNacp.getPlayLogPolicy()));
-	printf("    PlayLogQueryCapability:       %s\n", getPlayLogQueryCapabilityStr(mNacp.getPlayLogQueryCapability()));
-	if (mNacp.getPlayLogQueryableApplicationId().size() > 0)
-	{
-		printf("    PlayLogQueryableApplicationId:\n");
-		for (size_t i = 0; i < mNacp.getPlayLogQueryableApplicationId().size(); i++)
-		{
-			printf("      0x%016" PRIx64 "\n", mNacp.getPlayLogQueryableApplicationId()[i]);
-		}
-	}
-	printf("  Parental Controls:\n");
-	printf("    ParentalControlFlag:          %s\n", getParentalControlFlagStr(mNacp.getParentalControlFlag()));
-	for (size_t i = 0; i < mNacp.getRatingAge().size(); i++)
-	{
-		printf("    Age Restriction:\n");
-		printf("      Agency:  %s\n", getOrganisationStr(mNacp.getRatingAge()[i].organisation));
-		printf("      Age:     %d\n", mNacp.getRatingAge()[i].age);
-	}
-	
-	if (mNacp.getBcatPassphase().empty() == false || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("  BCAT:\n");
-		printf("    BcatPassphase:                %s\n", mNacp.getBcatPassphase().c_str());
-		printf("    DeliveryCacheStorageSize:     0x%016" PRIx64 "\n", mNacp.getBcatDeliveryCacheStorageSize());
-	}
-	if (mNacp.getLocalCommunicationId().size() > 0)
-	{
-		printf("  Local Area Communication:\n");
-		printf("    LocalCommunicationId:\n");
-		for (size_t i = 0; i < mNacp.getLocalCommunicationId().size(); i++)
-		{
-			printf("      0x%016" PRIx64 "\n", mNacp.getLocalCommunicationId()[i]);
-		}
-	}
-	printf("  SaveData:\n");
-	printf("    SaveDatawOwnerId:             0x%016" PRIx64 "\n", mNacp.getSaveDatawOwnerId());
-	if (mNacp.getUserAccountSaveDataSize().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    UserAccountSaveData:\n");
-		printf("      Size:                       %s\n", getSaveDataSizeStr(mNacp.getUserAccountSaveDataSize().size).c_str());
-		printf("      JournalSize:                %s\n", getSaveDataSizeStr(mNacp.getUserAccountSaveDataSize().journal_size).c_str());
-	}
-	if (mNacp.getDeviceSaveDataSize().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    DeviceSaveData:\n");
-		printf("      Size:                       %s\n", getSaveDataSizeStr(mNacp.getDeviceSaveDataSize().size).c_str());
-		printf("      JournalSize:                %s\n", getSaveDataSizeStr(mNacp.getDeviceSaveDataSize().journal_size).c_str());
-	}
-	if (mNacp.getUserAccountSaveDataMax().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    UserAccountSaveDataMax:\n");
-		printf("      Size:                       %s\n", getSaveDataSizeStr(mNacp.getUserAccountSaveDataMax().size).c_str());
-		printf("      JournalSize:                %s\n", getSaveDataSizeStr(mNacp.getUserAccountSaveDataMax().journal_size).c_str());
-	}
-	if (mNacp.getDeviceSaveDataMax().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    DeviceSaveDataMax:\n");
-		printf("      Size:                       %s\n", getSaveDataSizeStr(mNacp.getDeviceSaveDataMax().size).c_str());
-		printf("      JournalSize:                %s\n", getSaveDataSizeStr(mNacp.getDeviceSaveDataMax().journal_size).c_str());
-	}
-	if (mNacp.getTemporaryStorageSize() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    TemporaryStorageSize:         %s\n", getSaveDataSizeStr(mNacp.getTemporaryStorageSize()).c_str());
-	}
-	if (mNacp.getCacheStorageSize().journal_size > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    CacheStorage:\n");
-		printf("      Size:                       %s\n", getSaveDataSizeStr(mNacp.getCacheStorageSize().size).c_str());
-		printf("      JournalSize:                %s\n", getSaveDataSizeStr(mNacp.getCacheStorageSize().journal_size).c_str());
-		printf("      MaxDataAndJournalSize:      %s\n", getSaveDataSizeStr(mNacp.getCacheStorageDataAndJournalSizeMax()).c_str());
-		printf("      StorageIndexMax:            0x%" PRIx16 "\n", mNacp.getCacheStorageIndexMax());
-	}
-	printf("  Other Flags:\n");
-	printf("    StartupUserAccount:           %s\n", getStartupUserAccountStr(mNacp.getStartupUserAccount()));
-	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    TouchScreenUsageMode:         %s\n", getTouchScreenUsageModeStr(mNacp.getTouchScreenUsageMode()));
-	}
-	printf("    AttributeFlag:                %s\n", getAttributeFlagStr(mNacp.getAttributeFlag()));
-	printf("    CrashReportMode:              %s\n", getCrashReportModeStr(mNacp.getCrashReportMode()));
-	printf("    HDCP:                         %s\n", getHdcpStr(mNacp.getHdcp()));
-	printf("    ScreenshotMode:               %s\n", getScreenshotModeStr(mNacp.getScreenshotMode()));
-	printf("    VideoCaptureMode:             %s\n", getVideoCaptureModeStr(mNacp.getVideoCaptureMode()));
-	printf("    DataLossConfirmation:         %s\n", getDataLossConfirmationStr(mNacp.getDataLossConfirmation()));
-	printf("    RepairFlag:                   %s\n", getRepairFlagStr(mNacp.getRepairFlag()));
-	printf("    ProgramIndex:                 0x%02x\n", mNacp.getProgramIndex());
-	if (mNacp.getApplicationErrorCodeCategory().empty() == false || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("    ApplicationErrorCodeCategory: %s\n", mNacp.getApplicationErrorCodeCategory().c_str());
-	}
-	if (mNacp.getSeedForPsuedoDeviceId() > 0 || mNacp.getPresenceGroupId() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-	{
-		printf("  Other Ids:\n");
-		if (mNacp.getSeedForPsuedoDeviceId() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-			printf("    SeedForPsuedoDeviceId:        0x%016" PRIx64 "\n", mNacp.getSeedForPsuedoDeviceId());
-		if (mNacp.getPresenceGroupId() > 0 || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-			printf("    PresenceGroupId:              0x%016" PRIx64 "\n", mNacp.getPresenceGroupId());
-	}
-}

programs/nstool/source/NacpProcess.h

@@ -2,19 +2,19 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/ApplicationControlPropertyBinary.h>
 
-#include "nstool.h"
+#include "common.h"
 
 class NacpProcess
 {
 public:
 	NacpProcess();
-	~NacpProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -23,12 +23,31 @@ public:
 private:
 	const std::string kModuleName = "NacpProcess";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 
 	nn::hac::ApplicationControlPropertyBinary mNacp;
 
+	void importNacp();
 	void displayNacp();
+	const char* getLanguageStr(nn::hac::nacp::Language var) const;
+	const char* getStartupUserAccountStr(nn::hac::nacp::StartupUserAccount var) const;
+	const char* getTouchScreenUsageModeStr(nn::hac::nacp::TouchScreenUsageMode var) const;
+	const char* getAocRegistrationTypeStr(nn::hac::nacp::AocRegistrationType var) const;
+	const char* getAttributeFlagStr(nn::hac::nacp::AttributeFlag var) const;
+	const char* getParentalControlFlagStr(nn::hac::nacp::ParentalControlFlag var) const;
+	const char* getScreenshotModeStr(nn::hac::nacp::ScreenshotMode var) const;
+	const char* getVideoCaptureModeStr(nn::hac::nacp::VideoCaptureMode var) const;
+	const char* getDataLossConfirmationStr(nn::hac::nacp::DataLossConfirmation var) const;
+	const char* getPlayLogPolicyStr(nn::hac::nacp::PlayLogPolicy var) const;
+	const char* getOrganisationStr(nn::hac::nacp::Organisation var) const;
+	const char* getLogoTypeStr(nn::hac::nacp::LogoType var) const;
+	const char* getLogoHandlingStr(nn::hac::nacp::LogoHandling var) const;
+	const char* getRuntimeAocInstallModeStr(nn::hac::nacp::RuntimeAocInstallMode var) const;
+	const char* getCrashReportModeStr(nn::hac::nacp::CrashReportMode var) const;
+	const char* getHdcpStr(nn::hac::nacp::Hdcp var) const;
+	const char* getPlayLogQueryCapabilityStr(nn::hac::nacp::PlayLogQueryCapability var) const;
+	const char* getRepairFlagStr(nn::hac::nacp::RepairFlag var) const;
+	std::string getSaveDataSizeStr(int64_t size) const;
 };

programs/nstool/source/NcaProcess.h

@@ -1,24 +1,25 @@
 #pragma once
 #include <string>
 #include <fnd/types.h>
-#include <fnd/SimpleFile.h>
+#include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/NcaHeader.h>
 #include "HashTreeMeta.h"
+#include "KeyConfiguration.h"
 
 
-#include "nstool.h"
+#include "common.h"
 
 class NcaProcess
 {
 public:
 	NcaProcess();
-	~NcaProcess();
 
 	void process();
 
 	// generic
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
-	void setKeyset(const sKeyset* keyset);
+	void setKeyCfg(const KeyConfiguration& keycfg);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -34,9 +35,8 @@ private:
 	const std::string kNpdmExefsPath = "main.npdm";
 
 	// user options
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
+	KeyConfiguration mKeyCfg;
-	const sKeyset* mKeyset;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 
@@ -84,15 +84,14 @@ private:
 				return !(*this == other);
 			}
 		};
-		fnd::List<sKeyAreaKey> keak_list;
+		fnd::List<sKeyAreaKey> kak_list;
 
 		sOptional<fnd::aes::sAes128Key> aes_ctr;
-		sOptional<fnd::aes::sAesXts128Key> aes_xts;
+	} mContentKey;
-	} mBodyKeys;
 	
 	struct sPartitionInfo
 	{
-		fnd::IFile* reader;
+		fnd::SharedPtr<fnd::IFile> reader;
 		std::string fail_reason;
 		size_t offset;
 		size_t size;
@@ -105,9 +104,20 @@ private:
 		fnd::aes::sAesIvCtr aes_ctr;
 	} mPartitions[nn::hac::nca::kPartitionNum];
 
+	void importHeader();
 	void generateNcaBodyEncryptionKeys();
 	void generatePartitionConfiguration();
 	void validateNcaSignatures();
 	void displayHeader();
 	void processPartitions();
+
+	const char* getFormatVersionStr(nn::hac::NcaHeader::FormatVersion format_ver) const;
+	const char* getDistributionTypeStr(nn::hac::nca::DistributionType dist_type) const;
+	const char* getContentTypeStr(nn::hac::nca::ContentType cont_type) const;
+	const char* getEncryptionTypeStr(nn::hac::nca::EncryptionType enc_type) const;
+	const char* getHashTypeStr(nn::hac::nca::HashType hash_type) const;
+	const char* getFormatTypeStr(nn::hac::nca::FormatType format_type) const;
+	const char* getKaekIndexStr(nn::hac::nca::KeyAreaEncryptionKeyIndex keak_index) const;
+	const char* getContentTypeForMountStr(nn::hac::nca::ContentType cont_type) const;
+	const char* getProgramPartitionNameStr(size_t i) const;
 };

programs/nstool/source/NpdmProcess.h

@@ -2,20 +2,21 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/NpdmBinary.h>
+#include "KeyConfiguration.h"
 
-#include "nstool.h"
+#include "common.h"
 
 class NpdmProcess
 {
 public:
 	NpdmProcess();
-	~NpdmProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
-	void setKeyset(const sKeyset* keyset);
+	void setKeyCfg(const KeyConfiguration& keycfg);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -24,14 +25,15 @@ public:
 private:
 	const std::string kModuleName = "NpdmProcess";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
+	KeyConfiguration mKeyCfg;
-	const sKeyset* mKeyset;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 
 	nn::hac::NpdmBinary mNpdm;
 
+	void importNpdm();
+
 	void validateAcidSignature(const nn::hac::AccessControlInfoDescBinary& acid);
 	void validateAciFromAcid(const nn::hac::AccessControlInfoBinary& aci, const nn::hac::AccessControlInfoDescBinary& acid);
 
@@ -41,4 +43,14 @@ private:
 	void displayFac(const nn::hac::FileSystemAccessControlBinary& fac);
 	void displaySac(const nn::hac::ServiceAccessControlBinary& sac);
 	void displayKernelCap(const nn::hac::KernelCapabilityBinary& kern);
+
+	const char* getInstructionTypeStr(nn::hac::npdm::InstructionType type) const;
+	const char* getProcAddressSpaceTypeStr(nn::hac::npdm::ProcAddrSpaceType type) const;
+	const char* getAcidFlagStr(nn::hac::aci::Flag flag) const;
+	const char* getMiscFlagStr(nn::hac::MiscFlagsHandler::Flags flag) const;
+	const char* getFsaRightStr(nn::hac::fac::FsAccessFlag flag) const;
+	const char* getSaveDataOwnerAccessModeStr(nn::hac::fac::SaveDataOwnerIdAccessType type) const;
+	const char* getSystemCallStr(byte_t syscall_id) const;
+	const char* getMemMapPermStr(nn::hac::MemoryMappingHandler::MemoryPerm type) const;
+	const char* getMemMapTypeStr(nn::hac::MemoryMappingHandler::MappingType type) const;
 };

programs/nstool/source/NroProcess.cpp

@@ -1,3 +1,5 @@
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleTextOutput.h>
 #include <fnd/Vec.h>
 #include <fnd/lz4.h>
@@ -6,28 +8,14 @@
 #include "NroProcess.h"
 
 NroProcess::NroProcess():
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false)
 {
 }
 
-NroProcess::~NroProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void NroProcess::process()
 {
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-
 	importHeader();
 	importCodeSegments();
 
@@ -40,10 +28,9 @@ void NroProcess::process()
 		mAssetProc.process();
 }
 
-void NroProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void NroProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
 void NroProcess::setCliOutputMode(CliOutputMode type)
@@ -99,22 +86,28 @@ const RoMetadataProcess& NroProcess::getRoMetadataProcess() const
 void NroProcess::importHeader()
 {
 	fnd::Vec<byte_t> scratch;
-	if (mFile->size() < sizeof(nn::hac::sNroHeader))
+
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+
+	if ((*mFile)->size() < sizeof(nn::hac::sNroHeader))
 	{
 		throw fnd::Exception(kModuleName, "Corrupt NRO: file too small");
 	}
 
 	scratch.alloc(sizeof(nn::hac::sNroHeader));
-	mFile->read(scratch.data(), 0, scratch.size());
+	(*mFile)->read(scratch.data(), 0, scratch.size());
 
 	mHdr.fromBytes(scratch.data(), scratch.size());
 
 	// setup homebrew extension
 	nn::hac::sNroHeader* raw_hdr = (nn::hac::sNroHeader*)scratch.data();
-	if (((le_uint64_t*)raw_hdr->reserved_0)->get() == nn::hac::nro::kNroHomebrewStructMagic && mFile->size() > mHdr.getNroSize())
+	if (((le_uint64_t*)raw_hdr->reserved_0)->get() == nn::hac::nro::kNroHomebrewStructMagic && (*mFile)->size() > mHdr.getNroSize())
 	{
 		mIsHomebrewNro = true;
-		mAssetProc.setInputFile(new OffsetAdjustedIFile(mFile, false, mHdr.getNroSize(), mFile->size() - mHdr.getNroSize()), true);
+		mAssetProc.setInputFile(new OffsetAdjustedIFile(mFile, mHdr.getNroSize(), (*mFile)->size() - mHdr.getNroSize()));
 		mAssetProc.setCliOutputMode(mCliOutputMode);
 		mAssetProc.setVerifyMode(mVerify);
 	}
@@ -125,50 +118,43 @@ void NroProcess::importHeader()
 void NroProcess::importCodeSegments()
 {
 	mTextBlob.alloc(mHdr.getTextInfo().size);
-	mFile->read(mTextBlob.data(), mHdr.getTextInfo().memory_offset, mTextBlob.size());
+	(*mFile)->read(mTextBlob.data(), mHdr.getTextInfo().memory_offset, mTextBlob.size());
 	mRoBlob.alloc(mHdr.getRoInfo().size);
-	mFile->read(mRoBlob.data(), mHdr.getRoInfo().memory_offset, mRoBlob.size());
+	(*mFile)->read(mRoBlob.data(), mHdr.getRoInfo().memory_offset, mRoBlob.size());
 	mDataBlob.alloc(mHdr.getDataInfo().size);
-	mFile->read(mDataBlob.data(), mHdr.getDataInfo().memory_offset, mDataBlob.size());
+	(*mFile)->read(mDataBlob.data(), mHdr.getDataInfo().memory_offset, mDataBlob.size());
 }
 
 void NroProcess::displayHeader()
 {
-#define _HEXDUMP_L(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02x", var[a__a__A]); } while(0)
+	std::cout << "[NRO Header]" << std::endl;
-	printf("[NRO Header]\n");
+	std::cout << "  RoCrt:       " << fnd::SimpleTextOutput::arrayToString(mHdr.getRoCrt().data, nn::hac::nro::kRoCrtSize, false, "") << std::endl;
-	printf("  RoCrt:       ");
+	std::cout << "  ModuleId:    " << fnd::SimpleTextOutput::arrayToString(mHdr.getModuleId().data, nn::hac::nro::kModuleIdSize, false, "") << std::endl;
-	_HEXDUMP_L(mHdr.getRoCrt().data, nn::hac::nro::kRoCrtSize);
+	std::cout << "  NroSize:     0x" << std::hex << mHdr.getNroSize() << std::endl;
-	printf("\n");
+	std::cout << "  Program Sections:" << std::endl;
-	printf("  ModuleId:    ");
+	std::cout << "     .text:" << std::endl;
-	_HEXDUMP_L(mHdr.getModuleId().data, nn::hac::nro::kModuleIdSize);
+	std::cout << "      Offset:     0x" << std::hex << mHdr.getTextInfo().memory_offset << std::endl;
-	printf("\n");
+	std::cout << "      Size:       0x" << std::hex << mHdr.getTextInfo().size << std::endl;
-	printf("  NroSize:     0x%" PRIx32 "\n", mHdr.getNroSize());
+	std::cout << "    .ro:" << std::endl;
-	printf("  Program Sections:\n");
+	std::cout << "      Offset:     0x" << std::hex << mHdr.getRoInfo().memory_offset << std::endl;
-	printf("     .text:\n");
+	std::cout << "      Size:       0x" << std::hex << mHdr.getRoInfo().size << std::endl;
-	printf("      Offset:     0x%" PRIx32 "\n", mHdr.getTextInfo().memory_offset);
-	printf("      Size:       0x%" PRIx32 "\n", mHdr.getTextInfo().size);
-	printf("    .ro:\n");
-	printf("      Offset:     0x%" PRIx32 "\n", mHdr.getRoInfo().memory_offset);
-	printf("      Size:       0x%" PRIx32 "\n", mHdr.getRoInfo().size);
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 	{
-		printf("    .api_info:\n");
+		std::cout << "    .api_info:" << std::endl;
-		printf("      Offset:     0x%" PRIx32 "\n",  mHdr.getRoEmbeddedInfo().memory_offset);
+		std::cout << "      Offset:     0x" << std::hex <<  mHdr.getRoEmbeddedInfo().memory_offset << std::endl;
-		printf("      Size:       0x%" PRIx32 "\n", mHdr.getRoEmbeddedInfo().size);
+		std::cout << "      Size:       0x" << std::hex << mHdr.getRoEmbeddedInfo().size << std::endl;
-		printf("    .dynstr:\n");
+		std::cout << "    .dynstr:" << std::endl;
-		printf("      Offset:     0x%" PRIx32 "\n", mHdr.getRoDynStrInfo().memory_offset);
+		std::cout << "      Offset:     0x" << std::hex << mHdr.getRoDynStrInfo().memory_offset << std::endl;
-		printf("      Size:       0x%" PRIx32 "\n", mHdr.getRoDynStrInfo().size);
+		std::cout << "      Size:       0x" << std::hex << mHdr.getRoDynStrInfo().size << std::endl;
-		printf("    .dynsym:\n");
+		std::cout << "    .dynsym:" << std::endl;
-		printf("      Offset:     0x%" PRIx32 "\n", mHdr.getRoDynSymInfo().memory_offset);
+		std::cout << "      Offset:     0x" << std::hex << mHdr.getRoDynSymInfo().memory_offset << std::endl;
-		printf("      Size:       0x%" PRIx32 "\n", mHdr.getRoDynSymInfo().size);
+		std::cout << "      Size:       0x" << std::hex << mHdr.getRoDynSymInfo().size << std::endl;
 	}
-	printf("    .data:\n");
+	std::cout << "    .data:" << std::endl;
-	printf("      Offset:     0x%" PRIx32 "\n", mHdr.getDataInfo().memory_offset);
+	std::cout << "      Offset:     0x" << std::hex << mHdr.getDataInfo().memory_offset << std::endl;
-	printf("      Size:       0x%" PRIx32 "\n", mHdr.getDataInfo().size);
+	std::cout << "      Size:       0x" << std::hex << mHdr.getDataInfo().size << std::endl;
-	printf("    .bss:\n");
+	std::cout << "    .bss:" << std::endl;
-	printf("      Size:       0x%" PRIx32 "\n", mHdr.getBssSize());
+	std::cout << "      Size:       0x" << std::hex << mHdr.getBssSize() << std::endl;
-	
-#undef _HEXDUMP_L
 }
 
 void NroProcess::processRoMeta()

programs/nstool/source/NroProcess.h

@@ -3,22 +3,22 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/npdm.h>
 #include <nn/hac/NroHeader.h>
 #include "AssetProcess.h"
 
-#include "nstool.h"
+#include "common.h"
 #include "RoMetadataProcess.h"
 
 class NroProcess
 {
 public:
 	NroProcess();
-	~NroProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -36,9 +36,7 @@ public:
 private:
 	const std::string kModuleName = "NroProcess";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
-
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 

programs/nstool/source/NsoProcess.cpp

@@ -1,3 +1,5 @@
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleTextOutput.h>
 #include <fnd/Vec.h>
 #include <fnd/lz4.h>
@@ -5,28 +7,14 @@
 #include "NsoProcess.h"
 
 NsoProcess::NsoProcess():
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false)
 {
 }
 
-NsoProcess::~NsoProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void NsoProcess::process()
 {
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-
 	importHeader();
 	importCodeSegments();
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
@@ -35,10 +23,9 @@ void NsoProcess::process()
 	processRoMeta();
 }
 
-void NsoProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void NsoProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
 void NsoProcess::setCliOutputMode(CliOutputMode type)
@@ -74,13 +61,19 @@ const RoMetadataProcess& NsoProcess::getRoMetadataProcess() const
 void NsoProcess::importHeader()
 {
 	fnd::Vec<byte_t> scratch;
-	if (mFile->size() < sizeof(nn::hac::sNsoHeader))
+
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+
+	if ((*mFile)->size() < sizeof(nn::hac::sNsoHeader))
 	{
 		throw fnd::Exception(kModuleName, "Corrupt NSO: file too small");
 	}
 
 	scratch.alloc(sizeof(nn::hac::sNsoHeader));
-	mFile->read(scratch.data(), 0, scratch.size());
+	(*mFile)->read(scratch.data(), 0, scratch.size());
 
 	mHdr.fromBytes(scratch.data(), scratch.size());
 }
@@ -95,7 +88,7 @@ void NsoProcess::importCodeSegments()
 	if (mHdr.getTextSegmentInfo().is_compressed)
 	{
 		scratch.alloc(mHdr.getTextSegmentInfo().file_layout.size);
-		mFile->read(scratch.data(), mHdr.getTextSegmentInfo().file_layout.offset, scratch.size());
+		(*mFile)->read(scratch.data(), mHdr.getTextSegmentInfo().file_layout.offset, scratch.size());
 		mTextBlob.alloc(mHdr.getTextSegmentInfo().memory_layout.size);
 		fnd::lz4::decompressData(scratch.data(), (uint32_t)scratch.size(), mTextBlob.data(), (uint32_t)mTextBlob.size(), decompressed_len);
 		if (decompressed_len != mTextBlob.size())
@@ -106,7 +99,7 @@ void NsoProcess::importCodeSegments()
 	else
 	{
 		mTextBlob.alloc(mHdr.getTextSegmentInfo().file_layout.size);
-		mFile->read(mTextBlob.data(), mHdr.getTextSegmentInfo().file_layout.offset, mTextBlob.size());
+		(*mFile)->read(mTextBlob.data(), mHdr.getTextSegmentInfo().file_layout.offset, mTextBlob.size());
 	}
 	if (mHdr.getTextSegmentInfo().is_hashed)
 	{
@@ -121,7 +114,7 @@ void NsoProcess::importCodeSegments()
 	if (mHdr.getRoSegmentInfo().is_compressed)
 	{
 		scratch.alloc(mHdr.getRoSegmentInfo().file_layout.size);
-		mFile->read(scratch.data(), mHdr.getRoSegmentInfo().file_layout.offset, scratch.size());
+		(*mFile)->read(scratch.data(), mHdr.getRoSegmentInfo().file_layout.offset, scratch.size());
 		mRoBlob.alloc(mHdr.getRoSegmentInfo().memory_layout.size);
 		fnd::lz4::decompressData(scratch.data(), (uint32_t)scratch.size(), mRoBlob.data(), (uint32_t)mRoBlob.size(), decompressed_len);
 		if (decompressed_len != mRoBlob.size())
@@ -132,7 +125,7 @@ void NsoProcess::importCodeSegments()
 	else
 	{
 		mRoBlob.alloc(mHdr.getRoSegmentInfo().file_layout.size);
-		mFile->read(mRoBlob.data(), mHdr.getRoSegmentInfo().file_layout.offset, mRoBlob.size());
+		(*mFile)->read(mRoBlob.data(), mHdr.getRoSegmentInfo().file_layout.offset, mRoBlob.size());
 	}
 	if (mHdr.getRoSegmentInfo().is_hashed)
 	{
@@ -147,7 +140,7 @@ void NsoProcess::importCodeSegments()
 	if (mHdr.getDataSegmentInfo().is_compressed)
 	{
 		scratch.alloc(mHdr.getDataSegmentInfo().file_layout.size);
-		mFile->read(scratch.data(), mHdr.getDataSegmentInfo().file_layout.offset, scratch.size());
+		(*mFile)->read(scratch.data(), mHdr.getDataSegmentInfo().file_layout.offset, scratch.size());
 		mDataBlob.alloc(mHdr.getDataSegmentInfo().memory_layout.size);
 		fnd::lz4::decompressData(scratch.data(), (uint32_t)scratch.size(), mDataBlob.data(), (uint32_t)mDataBlob.size(), decompressed_len);
 		if (decompressed_len != mDataBlob.size())
@@ -158,7 +151,7 @@ void NsoProcess::importCodeSegments()
 	else
 	{
 		mDataBlob.alloc(mHdr.getDataSegmentInfo().file_layout.size);
-		mFile->read(mDataBlob.data(), mHdr.getDataSegmentInfo().file_layout.offset, mDataBlob.size());
+		(*mFile)->read(mDataBlob.data(), mHdr.getDataSegmentInfo().file_layout.offset, mDataBlob.size());
 	}
 	if (mHdr.getDataSegmentInfo().is_hashed)
 	{
@@ -172,72 +165,61 @@ void NsoProcess::importCodeSegments()
 
 void NsoProcess::displayNsoHeader()
 {
-#define _HEXDUMP_L(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02x", var[a__a__A]); } while(0)
+	std::cout << "[NSO Header]" << std::endl;
-
+	std::cout << "  ModuleId:           " << fnd::SimpleTextOutput::arrayToString(mHdr.getModuleId().data, nn::hac::nso::kModuleIdSize, false, "") << std::endl;
-	printf("[NSO Header]\n");
-	printf("  ModuleId:           ");
-	_HEXDUMP_L(mHdr.getModuleId().data, nn::hac::nso::kModuleIdSize);
-	printf("\n");
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_LAYOUT))
 	{
-		printf("  Program Segments:\n");
+		std::cout << "  Program Segments:" << std::endl;
-		printf("     .module_name:\n");
+		std::cout << "     .module_name:" << std::endl;
-		printf("      FileOffset:     0x%" PRIx32 "\n", mHdr.getModuleNameInfo().offset);
+		std::cout << "      FileOffset:     0x" << std::hex << mHdr.getModuleNameInfo().offset << std::endl;
-		printf("      FileSize:       0x%" PRIx32 "\n", mHdr.getModuleNameInfo().size);
+		std::cout << "      FileSize:       0x" << std::hex << mHdr.getModuleNameInfo().size << std::endl;
-		printf("    .text:\n");
+		std::cout << "    .text:" << std::endl;
-		printf("      FileOffset:     0x%" PRIx32 "\n", mHdr.getTextSegmentInfo().file_layout.offset);
+		std::cout << "      FileOffset:     0x" << std::hex << mHdr.getTextSegmentInfo().file_layout.offset << std::endl;
-		printf("      FileSize:       0x%" PRIx32 "%s\n", mHdr.getTextSegmentInfo().file_layout.size, mHdr.getTextSegmentInfo().is_compressed? " (COMPRESSED)" : "");
+		std::cout << "      FileSize:       0x" << std::hex << mHdr.getTextSegmentInfo().file_layout.size << (mHdr.getTextSegmentInfo().is_compressed? " (COMPRESSED)" : "") << std::endl;
-		printf("    .ro:\n");
+		std::cout << "    .ro:" << std::endl;
-		printf("      FileOffset:     0x%" PRIx32 "\n", mHdr.getRoSegmentInfo().file_layout.offset);
+		std::cout << "      FileOffset:     0x" << std::hex << mHdr.getRoSegmentInfo().file_layout.offset << std::endl;
-		printf("      FileSize:       0x%" PRIx32 "%s\n", mHdr.getRoSegmentInfo().file_layout.size, mHdr.getRoSegmentInfo().is_compressed? " (COMPRESSED)" : "");
+		std::cout << "      FileSize:       0x" << std::hex << mHdr.getRoSegmentInfo().file_layout.size << (mHdr.getRoSegmentInfo().is_compressed? " (COMPRESSED)" : "") << std::endl;
-		printf("    .data:\n");
+		std::cout << "    .data:" << std::endl;
-		printf("      FileOffset:     0x%" PRIx32 "\n", mHdr.getDataSegmentInfo().file_layout.offset);
+		std::cout << "      FileOffset:     0x" << std::hex << mHdr.getDataSegmentInfo().file_layout.offset << std::endl;
-		printf("      FileSize:       0x%" PRIx32 "%s\n", mHdr.getDataSegmentInfo().file_layout.size, mHdr.getDataSegmentInfo().is_compressed? " (COMPRESSED)" : "");
+		std::cout << "      FileSize:       0x" << std::hex << mHdr.getDataSegmentInfo().file_layout.size << (mHdr.getDataSegmentInfo().is_compressed? " (COMPRESSED)" : "") << std::endl;
 	}
-	printf("  Program Sections:\n");
+	std::cout << "  Program Sections:" << std::endl;
-	printf("     .text:\n");
+	std::cout << "     .text:" << std::endl;
-	printf("      MemoryOffset:   0x%" PRIx32 "\n", mHdr.getTextSegmentInfo().memory_layout.offset);
+	std::cout << "      MemoryOffset:   0x" << std::hex << mHdr.getTextSegmentInfo().memory_layout.offset << std::endl;
-	printf("      MemorySize:     0x%" PRIx32 "\n", mHdr.getTextSegmentInfo().memory_layout.size);
+	std::cout << "      MemorySize:     0x" << std::hex << mHdr.getTextSegmentInfo().memory_layout.size << std::endl;
 	if (mHdr.getTextSegmentInfo().is_hashed && _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 	{
-		printf("      Hash:           ");
+		std::cout << "      Hash:           " << fnd::SimpleTextOutput::arrayToString(mHdr.getTextSegmentInfo().hash.bytes, 32, false, "") << std::endl;
-		_HEXDUMP_L(mHdr.getTextSegmentInfo().hash.bytes, 32);
-		printf("\n");
 	}
-	printf("    .ro:\n");
+	std::cout << "    .ro:" << std::endl;
-	printf("      MemoryOffset:   0x%" PRIx32 "\n", mHdr.getRoSegmentInfo().memory_layout.offset);
+	std::cout << "      MemoryOffset:   0x" << std::hex << mHdr.getRoSegmentInfo().memory_layout.offset << std::endl;
-	printf("      MemorySize:     0x%" PRIx32 "\n", mHdr.getRoSegmentInfo().memory_layout.size);
+	std::cout << "      MemorySize:     0x" << std::hex << mHdr.getRoSegmentInfo().memory_layout.size << std::endl;
 	if (mHdr.getRoSegmentInfo().is_hashed && _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 	{
-		printf("      Hash:           ");
+		std::cout << "      Hash:           " << fnd::SimpleTextOutput::arrayToString(mHdr.getRoSegmentInfo().hash.bytes, 32, false, "") << std::endl;
-		_HEXDUMP_L(mHdr.getRoSegmentInfo().hash.bytes, 32);
-		printf("\n");
 	}
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 	{
-		printf("    .api_info:\n");
+		std::cout << "    .api_info:" << std::endl;
-		printf("      MemoryOffset:   0x%" PRIx32 "\n",  mHdr.getRoEmbeddedInfo().offset);
+		std::cout << "      MemoryOffset:   0x" << std::hex <<  mHdr.getRoEmbeddedInfo().offset << std::endl;
-		printf("      MemorySize:     0x%" PRIx32 "\n", mHdr.getRoEmbeddedInfo().size);
+		std::cout << "      MemorySize:     0x" << std::hex << mHdr.getRoEmbeddedInfo().size << std::endl;
-		printf("    .dynstr:\n");
+		std::cout << "    .dynstr:" << std::endl;
-		printf("      MemoryOffset:   0x%" PRIx32 "\n", mHdr.getRoDynStrInfo().offset);
+		std::cout << "      MemoryOffset:   0x" << std::hex << mHdr.getRoDynStrInfo().offset << std::endl;
-		printf("      MemorySize:     0x%" PRIx32 "\n", mHdr.getRoDynStrInfo().size);
+		std::cout << "      MemorySize:     0x" << std::hex << mHdr.getRoDynStrInfo().size << std::endl;
-		printf("    .dynsym:\n");
+		std::cout << "    .dynsym:" << std::endl;
-		printf("      MemoryOffset:   0x%" PRIx32 "\n", mHdr.getRoDynSymInfo().offset);
+		std::cout << "      MemoryOffset:   0x" << std::hex << mHdr.getRoDynSymInfo().offset << std::endl;
-		printf("      MemorySize:     0x%" PRIx32 "\n", mHdr.getRoDynSymInfo().size);
+		std::cout << "      MemorySize:     0x" << std::hex << mHdr.getRoDynSymInfo().size << std::endl;
 	}
 	
-	printf("    .data:\n");
+	std::cout << "    .data:" << std::endl;
-	printf("      MemoryOffset:   0x%" PRIx32 "\n", mHdr.getDataSegmentInfo().memory_layout.offset);
+	std::cout << "      MemoryOffset:   0x" << std::hex << mHdr.getDataSegmentInfo().memory_layout.offset << std::endl;
-	printf("      MemorySize:     0x%" PRIx32 "\n", mHdr.getDataSegmentInfo().memory_layout.size);
+	std::cout << "      MemorySize:     0x" << std::hex << mHdr.getDataSegmentInfo().memory_layout.size << std::endl;
 	if (mHdr.getDataSegmentInfo().is_hashed && _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 	{
-		printf("      Hash:           ");
+		std::cout << "      Hash:           " << fnd::SimpleTextOutput::arrayToString(mHdr.getDataSegmentInfo().hash.bytes, 32, false, "") << std::endl;
-		_HEXDUMP_L(mHdr.getDataSegmentInfo().hash.bytes, 32);
-		printf("\n");
 	}
-	printf("    .bss:\n");
+	std::cout << "    .bss:" << std::endl;
-	printf("      MemorySize:     0x%" PRIx32 "\n", mHdr.getBssSize());
+	std::cout << "      MemorySize:     0x" << std::hex << mHdr.getBssSize() << std::endl;
-#undef _HEXDUMP_L
 }
 
 void NsoProcess::processRoMeta()

programs/nstool/source/NsoProcess.h

@@ -3,21 +3,21 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/npdm.h>
 #include <nn/hac/NsoHeader.h>
 
-#include "nstool.h"
+#include "common.h"
 #include "RoMetadataProcess.h"
 
 class NsoProcess
 {
 public:
 	NsoProcess();
-	~NsoProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -29,9 +29,7 @@ public:
 private:
 	const std::string kModuleName = "NsoProcess";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
-
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 	nn::hac::npdm::InstructionType mInstructionType;

programs/nstool/source/OffsetAdjustedIFile.cpp

@@ -1,21 +1,11 @@
 #include "OffsetAdjustedIFile.h"
 
-OffsetAdjustedIFile::OffsetAdjustedIFile(fnd::IFile* file, bool ownIFile, size_t offset, size_t size) :
+OffsetAdjustedIFile::OffsetAdjustedIFile(const fnd::SharedPtr<fnd::IFile>& file, size_t offset, size_t size) :
-	mOwnIFile(ownIFile),
 	mFile(file),
 	mBaseOffset(offset),
 	mCurrentOffset(0),
 	mSize(size)
 {
-
-}
-
-OffsetAdjustedIFile::~OffsetAdjustedIFile()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
 }
 
 size_t OffsetAdjustedIFile::size()
@@ -31,8 +21,8 @@ void OffsetAdjustedIFile::seek(size_t offset)
 void OffsetAdjustedIFile::read(byte_t* out, size_t len)
 {
 	// assert proper position in file
-	mFile->seek(mCurrentOffset + mBaseOffset);
+	(*mFile)->seek(mCurrentOffset + mBaseOffset);
-	mFile->read(out, len);
+	(*mFile)->read(out, len);
 	seek(mCurrentOffset + len);
 }
 
@@ -45,8 +35,8 @@ void OffsetAdjustedIFile::read(byte_t* out, size_t offset, size_t len)
 void OffsetAdjustedIFile::write(const byte_t* out, size_t len)
 {
 	// assert proper position in file
-	mFile->seek(mCurrentOffset + mBaseOffset);
+	(*mFile)->seek(mCurrentOffset + mBaseOffset);
-	mFile->write(out, len);
+	(*mFile)->write(out, len);
 	seek(mCurrentOffset + len);
 }
 

programs/nstool/source/OffsetAdjustedIFile.h

@@ -1,10 +1,10 @@
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 
 class OffsetAdjustedIFile : public fnd::IFile
 {
 public:
-	OffsetAdjustedIFile(fnd::IFile* file, bool ownIFile, size_t offset, size_t size);
+	OffsetAdjustedIFile(const fnd::SharedPtr<fnd::IFile>& file, size_t offset, size_t size);
-	~OffsetAdjustedIFile();
 
 	size_t size();
 	void seek(size_t offset);
@@ -13,8 +13,7 @@ public:
 	void write(const byte_t* out, size_t len);
 	void write(const byte_t* out, size_t offset, size_t len);
 private:
-	bool mOwnIFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	fnd::IFile* mFile;
 	size_t mBaseOffset, mCurrentOffset;
 	size_t mSize;
 };

programs/nstool/source/PfsProcess.cpp

@@ -1,10 +1,11 @@
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleFile.h>
 #include <fnd/io.h>
 #include "PfsProcess.h"
 
 PfsProcess::PfsProcess() :
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false),
 	mExtractPath(),
@@ -15,36 +16,9 @@ PfsProcess::PfsProcess() :
 {
 }
 
-PfsProcess::~PfsProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void PfsProcess::process()
 {
-	fnd::Vec<byte_t> scratch;
+	importHeader();
-
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-	
-	// open minimum header to get full header size
-	scratch.alloc(sizeof(nn::hac::sPfsHeader));
-	mFile->read(scratch.data(), 0, scratch.size());
-	if (validateHeaderMagic(((nn::hac::sPfsHeader*)scratch.data())) == false)
-	{
-		throw fnd::Exception(kModuleName, "Corrupt Header");
-	}
-	size_t pfsHeaderSize = determineHeaderSize(((nn::hac::sPfsHeader*)scratch.data()));
-	
-	// open minimum header to get full header size
-	scratch.alloc(pfsHeaderSize);
-	mFile->read(scratch.data(), 0, scratch.size());
-	mPfs.fromBytes(scratch.data(), scratch.size());
 
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
 	{
@@ -58,10 +32,9 @@ void PfsProcess::process()
 		extractFs();
 }
 
-void PfsProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void PfsProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
 void PfsProcess::setCliOutputMode(CliOutputMode type)
@@ -95,32 +68,64 @@ const nn::hac::PfsHeader& PfsProcess::getPfsHeader() const
 	return mPfs;
 }
 
+void PfsProcess::importHeader()
+{
+	fnd::Vec<byte_t> scratch;
+
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+	
+	// open minimum header to get full header size
+	scratch.alloc(sizeof(nn::hac::sPfsHeader));
+	(*mFile)->read(scratch.data(), 0, scratch.size());
+	if (validateHeaderMagic(((nn::hac::sPfsHeader*)scratch.data())) == false)
+	{
+		throw fnd::Exception(kModuleName, "Corrupt Header");
+	}
+	size_t pfsHeaderSize = determineHeaderSize(((nn::hac::sPfsHeader*)scratch.data()));
+	
+	// open minimum header to get full header size
+	scratch.alloc(pfsHeaderSize);
+	(*mFile)->read(scratch.data(), 0, scratch.size());
+	mPfs.fromBytes(scratch.data(), scratch.size());
+}
+
 void PfsProcess::displayHeader()
 {
-	printf("[PartitionFS]\n");
+	std::cout << "[PartitionFS]" << std::endl;
-	printf("  Type:        %s\n", mPfs.getFsType() == mPfs.TYPE_PFS0? "PFS0" : "HFS0");
+	std::cout << "  Type:        " << getFsTypeStr(mPfs.getFsType()) << std::endl;
-	printf("  FileNum:     %" PRId64 "\n", (uint64_t)mPfs.getFileList().size());
+	std::cout << "  FileNum:     " << std::dec << mPfs.getFileList().size() << std::endl;
 	if (mMountName.empty() == false)
-		printf("  MountPoint:  %s%s\n", mMountName.c_str(), mMountName.at(mMountName.length()-1) != '/' ? "/" : "");
+	{
+		std::cout << "  MountPoint:  " << mMountName;
+		if (mMountName.at(mMountName.length()-1) != '/')
+			std::cout << "/";
+		std::cout << std::endl;
+	}
 }
 
 void PfsProcess::displayFs()
 {	
 	for (size_t i = 0; i < mPfs.getFileList().size(); i++)
 	{
-		printf("    %s", mPfs.getFileList()[i].name.c_str());
+		const nn::hac::PfsHeader::sFile& file = mPfs.getFileList()[i];
+		std::cout << "    " << file.name;
 		if (_HAS_BIT(mCliOutputMode, OUTPUT_LAYOUT))
 		{
-			if (mPfs.getFsType() == mPfs.TYPE_PFS0)
+			switch (mPfs.getFsType())
-				printf(" (offset=0x%" PRIx64 ", size=0x%" PRIx64 ")\n", (uint64_t)mPfs.getFileList()[i].offset, (uint64_t)mPfs.getFileList()[i].size);
+			{
-			else
+			case (nn::hac::PfsHeader::TYPE_PFS0):
-				printf(" (offset=0x%" PRIx64 ", size=0x%" PRIx64 ", hash_protected_size=0x%" PRIx64 ")\n", (uint64_t)mPfs.getFileList()[i].offset, (uint64_t)mPfs.getFileList()[i].size, (uint64_t)mPfs.getFileList()[i].hash_protected_size);
+				std::cout << std::hex << " (offset=0x" << file.offset << ", size=0x" << file.size << ")";
-		}
+				break;
-		else
+			case (nn::hac::PfsHeader::TYPE_HFS0):
-		{
+				std::cout << std::hex << " (offset=0x" << file.offset << ", size=0x" << file.size << ", hash_protected_size=0x" << file.hash_protected_size << ")";
-			printf("\n");
+				break;
-		}
+			}
 			
+		}
+		std::cout << std::endl;
 	}
 }
 
@@ -147,7 +152,7 @@ void PfsProcess::validateHfs()
 	for (size_t i = 0; i < file.size(); i++)
 	{
 		mCache.alloc(file[i].hash_protected_size);
-		mFile->read(mCache.data(), file[i].offset, file[i].hash_protected_size);
+		(*mFile)->read(mCache.data(), file[i].offset, file[i].hash_protected_size);
 		fnd::sha::Sha256(mCache.data(), file[i].hash_protected_size, hash.bytes);
 		if (hash != file[i].hash)
 		{
@@ -178,12 +183,32 @@ void PfsProcess::extractFs()
 			printf("extract=[%s]\n", file_path.c_str());
 
 		outFile.open(file_path, outFile.Create);
-		mFile->seek(file[i].offset);
+		(*mFile)->seek(file[i].offset);
 		for (size_t j = 0; j < ((file[i].size / kCacheSize) + ((file[i].size % kCacheSize) != 0)); j++)
 		{
-			mFile->read(mCache.data(), _MIN(file[i].size - (kCacheSize * j),kCacheSize));
+			(*mFile)->read(mCache.data(), _MIN(file[i].size - (kCacheSize * j),kCacheSize));
 			outFile.write(mCache.data(), _MIN(file[i].size - (kCacheSize * j),kCacheSize));
 		}		
 		outFile.close();
 	}
 }
+
+const char* PfsProcess::getFsTypeStr(nn::hac::PfsHeader::FsType type) const
+{
+	const char* str = nullptr;
+
+	switch (type)
+	{
+	case (nn::hac::PfsHeader::TYPE_PFS0):
+		str = "PFS0";
+		break;
+	case (nn::hac::PfsHeader::TYPE_HFS0):
+		str = "HFS0";
+		break;
+	default:
+		str = "Unknown";
+		break;
+	}
+
+	return str;
+}

programs/nstool/source/PfsProcess.h

@@ -2,20 +2,20 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <nn/hac/PfsHeader.h>
 
-#include "nstool.h"
+#include "common.h"
 
 class PfsProcess
 {
 public:
 	PfsProcess();
-	~PfsProcess();
 
 	void process();
 
 	// generic
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -30,8 +30,7 @@ private:
 	const std::string kModuleName = "PfsProcess";
 	static const size_t kCacheSize = 0x10000;
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 
@@ -44,10 +43,13 @@ private:
 
 	nn::hac::PfsHeader mPfs;
 
+	void importHeader();
 	void displayHeader();
 	void displayFs();
 	size_t determineHeaderSize(const nn::hac::sPfsHeader* hdr);
 	bool validateHeaderMagic(const nn::hac::sPfsHeader* hdr);
 	void validateHfs();
 	void extractFs();
+
+	const char* getFsTypeStr(nn::hac::PfsHeader::FsType type) const;
 };

programs/nstool/source/PkiCertProcess.cpp

@@ -1,6 +1,5 @@
 #include <iostream>
 #include <iomanip>
-
 #include <fnd/SimpleTextOutput.h>
 #include <nn/pki/SignUtils.h>
 #include "OffsetAdjustedIFile.h"
@@ -8,29 +7,16 @@
 #include "PkiValidator.h"
 
 PkiCertProcess::PkiCertProcess() :
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false)
 {
 }
 
-PkiCertProcess::~PkiCertProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void PkiCertProcess::process()
 {
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-
 	importCerts();
+
 	if (mVerify)
 		validateCerts();
 
@@ -38,15 +24,14 @@ void PkiCertProcess::process()
 		displayCerts();
 }
 
-void PkiCertProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void PkiCertProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
-void PkiCertProcess::setKeyset(const sKeyset* keyset)
+void PkiCertProcess::setKeyCfg(const KeyConfiguration& keycfg)
 {
-	mKeyset = keyset;
+	mKeyCfg = keycfg;
 }
 
 void PkiCertProcess::setCliOutputMode(CliOutputMode mode)
@@ -63,8 +48,13 @@ void PkiCertProcess::importCerts()
 {
 	fnd::Vec<byte_t> scratch;
 
-	scratch.alloc(mFile->size());
+	if (*mFile == nullptr)
-	mFile->read(scratch.data(), 0, scratch.size());
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+
+	scratch.alloc((*mFile)->size());
+	(*mFile)->read(scratch.data(), 0, scratch.size());
 
 	nn::pki::SignedData<nn::pki::CertificateBody> cert;
 	for (size_t f_pos = 0; f_pos < scratch.size(); f_pos += cert.getBytes().size())
@@ -80,7 +70,7 @@ void PkiCertProcess::validateCerts()
 	
 	try
 	{
-		pki.setRootKey(mKeyset->pki.root_sign_key);
+		pki.setKeyCfg(mKeyCfg);
 		pki.addCertificates(mCert);
 	}
 	catch (const fnd::Exception& e)
@@ -100,15 +90,11 @@ void PkiCertProcess::displayCerts()
 
 void PkiCertProcess::displayCert(const nn::pki::SignedData<nn::pki::CertificateBody>& cert)
 {
-#define _SPLIT_VER(ver) ( (ver>>26) & 0x3f), ( (ver>>20) & 0x3f), ( (ver>>16) & 0xf), (ver & 0xffff)
-#define _HEXDUMP_U(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02X", var[a__a__A]); } while(0)
-#define _HEXDUMP_L(var, len) do { for (size_t a__a__A = 0; a__a__A < len; a__a__A++) printf("%02x", var[a__a__A]); } while(0)
-
 	std::cout << "[NNPKI Certificate]" << std::endl;
 
 	std::cout << "  SignType       " << getSignTypeStr(cert.getSignature().getSignType());
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-		std::cout << " (0x" << std::hex << cert.getSignature().getSignType() << ") (" << getEndiannessStr(cert.getSignature().isLittleEndian());
+		std::cout << " (0x" << std::hex << cert.getSignature().getSignType() << ") (" << getEndiannessStr(cert.getSignature().isLittleEndian()) << ")";
 	std::cout << std::endl;
 
 	std::cout << "  Issuer:        " << cert.getBody().getIssuer() << std::endl;
@@ -130,9 +116,9 @@ void PkiCertProcess::displayCert(const nn::pki::SignedData<nn::pki::CertificateB
 	else if (cert.getBody().getPublicKeyType() == nn::pki::cert::RSA2048)
 	{
 		std::cout << "  PublicKey:" << std::endl;
-		std::cout << "    Public Exponent:" << std::endl;
-		fnd::SimpleTextOutput::hexDump(cert.getBody().getRsa2048PublicKey().modulus, getHexDumpLen(fnd::rsa::kRsa2048Size), 0x10, 6);
 		std::cout << "    Modulus:" << std::endl;
+		fnd::SimpleTextOutput::hexDump(cert.getBody().getRsa2048PublicKey().modulus, getHexDumpLen(fnd::rsa::kRsa2048Size), 0x10, 6);
+		std::cout << "    Public Exponent:" << std::endl;
 		fnd::SimpleTextOutput::hexDump(cert.getBody().getRsa2048PublicKey().public_exponent, fnd::rsa::kRsaPublicExponentSize, 0x10, 6);
 	}
 	else if (cert.getBody().getPublicKeyType() == nn::pki::cert::ECDSA240)
@@ -143,12 +129,6 @@ void PkiCertProcess::displayCert(const nn::pki::SignedData<nn::pki::CertificateB
 		std::cout << "    S:" << std::endl;
 		fnd::SimpleTextOutput::hexDump(cert.getBody().getEcdsa240PublicKey().s, getHexDumpLen(fnd::ecdsa::kEcdsa240Size), 0x10, 6);
 	}
-	
-
-
-#undef _HEXDUMP_L
-#undef _HEXDUMP_U
-#undef _SPLIT_VER
 }
 
 size_t PkiCertProcess::getHexDumpLen(size_t max_size) const

programs/nstool/source/PkiCertProcess.h

@@ -2,22 +2,23 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <fnd/List.h>
 #include <fnd/Vec.h>
 #include <nn/pki/SignedData.h>
 #include <nn/pki/CertificateBody.h>
-#include "nstool.h"
+#include "KeyConfiguration.h"
+#include "common.h"
 
 class PkiCertProcess
 {
 public:
 	PkiCertProcess();
-	~PkiCertProcess();
 
 	void process();
 
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
-	void setKeyset(const sKeyset* keyset);
+	void setKeyCfg(const KeyConfiguration& keycfg);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -25,9 +26,8 @@ private:
 	const std::string kModuleName = "PkiCertProcess";
 	static const size_t kSmallHexDumpLen = 0x10;
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
+	KeyConfiguration mKeyCfg;
-	const sKeyset* mKeyset;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 

programs/nstool/source/PkiValidator.cpp

@@ -1,15 +1,15 @@
-#include "PkiValidator.h"
 #include <iostream>
 #include <iomanip>
 #include <sstream>
 #include <nn/pki/SignUtils.h>
+#include "PkiValidator.h"
 
 PkiValidator::PkiValidator()
 {
 	clearCertificates();
 }
 
-void PkiValidator::setRootKey(const fnd::rsa::sRsa4096Key& root_key)
+void PkiValidator::setKeyCfg(const KeyConfiguration& keycfg)
 {
 	// save a copy of the certificate bank
 	fnd::List<nn::pki::SignedData<nn::pki::CertificateBody>> old_certs = mCertificateBank;
@@ -18,7 +18,7 @@ void PkiValidator::setRootKey(const fnd::rsa::sRsa4096Key& root_key)
 	mCertificateBank.clear();
 
 	// overwrite the root key
-	mRootKey = root_key;
+	mKeyCfg = keycfg;
 
 	// if there were certificates before, reimport them (so they are checked against the new root key)
 	if (old_certs.size() > 0)
@@ -96,13 +96,28 @@ void PkiValidator::validateSignature(const std::string& issuer, nn::pki::sign::S
 	int sig_validate_res = -1;
 
 	// special case if signed by Root
-	if (issuer == nn::pki::sign::kRootIssuerStr)
+	if (issuer.find('-', 0) == std::string::npos)
 	{
-		if (sign_algo != nn::pki::sign::SIGN_ALGO_RSA4096)
+		fnd::rsa::sRsa4096Key rsa4096_pub;
+		fnd::rsa::sRsa2048Key rsa2048_pub;
+		fnd::ecdsa::sEcdsa240Key ecdsa_pub;
+
+		if (mKeyCfg.getPkiRootSignKey(issuer, rsa4096_pub) == true && sign_algo == nn::pki::sign::SIGN_ALGO_RSA4096)
 		{
-			throw fnd::Exception(kModuleName, "Issued by Root, but does not have a RSA4096 signature");
+			sig_validate_res = fnd::rsa::pkcs::rsaVerify(rsa4096_pub, getCryptoHashAlgoFromEsSignHashAlgo(hash_algo), hash.data(), signature.data()); 
+		}
+		else if (mKeyCfg.getPkiRootSignKey(issuer, rsa2048_pub) == true && sign_algo == nn::pki::sign::SIGN_ALGO_RSA2048)
+		{
+			sig_validate_res = fnd::rsa::pkcs::rsaVerify(rsa2048_pub, getCryptoHashAlgoFromEsSignHashAlgo(hash_algo), hash.data(), signature.data()); 
+		}
+		else if (mKeyCfg.getPkiRootSignKey(issuer, ecdsa_pub) == true && sign_algo == nn::pki::sign::SIGN_ALGO_ECDSA240)
+		{
+			throw fnd::Exception(kModuleName, "ECDSA signatures are not supported");
+		}
+		else
+		{
+			throw fnd::Exception(kModuleName, "Public key for issuer \"" + issuer + "\" does not exist.");
 		}
-		sig_validate_res = fnd::rsa::pkcs::rsaVerify(mRootKey, getCryptoHashAlgoFromEsSignHashAlgo(hash_algo), hash.data(), signature.data()); 
 	}
 	else
 	{

programs/nstool/source/PkiValidator.h

@@ -6,13 +6,14 @@
 #include <nn/pki/SignedData.h>
 #include <nn/pki/CertificateBody.h>
 #include <string>
+#include "KeyConfiguration.h"
 
 class PkiValidator
 {
 public:
 	PkiValidator();
 
-	void setRootKey(const fnd::rsa::sRsa4096Key& root_key);
+	void setKeyCfg(const KeyConfiguration& keycfg);
 	void addCertificates(const fnd::List<nn::pki::SignedData<nn::pki::CertificateBody>>& certs);
 	void addCertificate(const nn::pki::SignedData<nn::pki::CertificateBody>& cert);
 	void clearCertificates();
@@ -22,8 +23,7 @@ public:
 private:
 	const std::string kModuleName = "NNPkiValidator";
 
-
+	KeyConfiguration mKeyCfg;
-	fnd::rsa::sRsa4096Key mRootKey;
 	fnd::List<nn::pki::SignedData<nn::pki::CertificateBody>> mCertificateBank;
 
 	void makeCertIdent(const nn::pki::SignedData<nn::pki::CertificateBody>& cert, std::string& ident) const;

programs/nstool/source/RoMetadataProcess.cpp

@@ -1,4 +1,6 @@
 #include <sstream>
+#include <iostream>
+#include <iomanip>
 #include <fnd/types.h>
 
 #include "RoMetadataProcess.h"
@@ -23,12 +25,8 @@ RoMetadataProcess::RoMetadataProcess() :
 
 void RoMetadataProcess::process()
 {
-	if (mRoBlob.size() == 0)
-	{
-		throw fnd::Exception(kModuleName, "No ro binary set.");
-	}
-
 	importApiList();
+	
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
 		displayRoMetaData();
 }
@@ -101,6 +99,11 @@ const fnd::List<ElfSymbolParser::sElfSymbol>& RoMetadataProcess::getSymbolList()
 
 void RoMetadataProcess::importApiList()
 {
+	if (mRoBlob.size() == 0)
+	{
+		throw fnd::Exception(kModuleName, "No ro binary set.");
+	}
+
 	if (mApiInfo.size > 0)
 	{
 		std::stringstream list_stream(std::string((char*)mRoBlob.data() + mApiInfo.offset, mApiInfo.size));
@@ -133,71 +136,71 @@ void RoMetadataProcess::displayRoMetaData()
 	
 	if (api_num > 0 && (mListApi || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED)))
 	{
-		printf("[SDK API List]\n");
+		std::cout << "[SDK API List]" << std::endl;
 		if (mSdkVerApiList.size() > 0)
 		{
-			printf("  Sdk Revision: %s\n", mSdkVerApiList[0].getModuleName().c_str());
+			std::cout << "  Sdk Revision: " << mSdkVerApiList[0].getModuleName() << std::endl;
 		}
 		if (mPublicApiList.size() > 0)
 		{
-			printf("  Public APIs:\n");
+			std::cout << "  Public APIs:" << std::endl;
 			for (size_t i = 0; i < mPublicApiList.size(); i++)
 			{
-				printf("    %s (vender: %s)\n", mPublicApiList[i].getModuleName().c_str(), mPublicApiList[i].getVenderName().c_str());
+				std::cout << "    " << mPublicApiList[i].getModuleName() << " (vender: " << mPublicApiList[i].getVenderName() << ")" << std::endl;
 			}
 		}
 		if (mDebugApiList.size() > 0)
 		{
-			printf("  Debug APIs:\n");
+			std::cout << "  Debug APIs:" << std::endl;
 			for (size_t i = 0; i < mDebugApiList.size(); i++)
 			{
-				printf("    %s (vender: %s)\n", mDebugApiList[i].getModuleName().c_str(), mDebugApiList[i].getVenderName().c_str());
+				std::cout << "    " << mDebugApiList[i].getModuleName() << " (vender: " << mDebugApiList[i].getVenderName() << ")" << std::endl;
 			}
 		}
 		if (mPrivateApiList.size() > 0)
 		{
-			printf("  Private APIs:\n");
+			std::cout << "  Private APIs:" << std::endl;
 			for (size_t i = 0; i < mPrivateApiList.size(); i++)
 			{
-				printf("    %s (vender: %s)\n", mPrivateApiList[i].getModuleName().c_str(), mPrivateApiList[i].getVenderName().c_str());
+				std::cout << "    " << mPrivateApiList[i].getModuleName() << " (vender: " << mPrivateApiList[i].getVenderName() << ")" << std::endl;
 			}
 		}
 	}
 	if (mSymbolList.getSymbolList().size() > 0 && (mListSymbols || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED)))
 	{
-		printf("[Symbol List]\n");
+		std::cout << "[Symbol List]" << std::endl;
 		for (size_t i = 0; i < mSymbolList.getSymbolList().size(); i++)
 		{
 			const ElfSymbolParser::sElfSymbol& symbol = mSymbolList.getSymbolList()[i];
-			printf("  %s [SHN=%s (%04x)][STT=%s][STB=%s]\n", symbol.name.c_str(), getSectionIndexStr(symbol.shn_index), symbol.shn_index, getSymbolTypeStr(symbol.symbol_type), getSymbolBindingStr(symbol.symbol_binding));
+			std::cout << "  " << symbol.name << " [SHN=" << getSectionIndexStr(symbol.shn_index) << " (" << std::hex << std::setw(4) << std::setfill('0') << symbol.shn_index << ")][STT=" << getSymbolTypeStr(symbol.symbol_type) << "][STB=" << getSymbolBindingStr(symbol.symbol_binding) << "]" << std::endl;
 		}
 	}
 }
 
-const char* RoMetadataProcess::getSectionIndexStr(nn::hac::elf::SpecialSectionIndex shn_index) const
+const char* RoMetadataProcess::getSectionIndexStr(uint16_t shn_index) const
 {
 	const char* str;
 	switch (shn_index)
 	{
-		case (nn::hac::elf::SHN_UNDEF):
+		case (fnd::elf::SHN_UNDEF):
 			str = "UNDEF";
 			break;
-		case (nn::hac::elf::SHN_LOPROC):
+		case (fnd::elf::SHN_LOPROC):
 			str = "LOPROC";
 			break;
-		case (nn::hac::elf::SHN_HIPROC):
+		case (fnd::elf::SHN_HIPROC):
 			str = "HIPROC";
 			break;
-		case (nn::hac::elf::SHN_LOOS):
+		case (fnd::elf::SHN_LOOS):
 			str = "LOOS";
 			break;
-		case (nn::hac::elf::SHN_HIOS):
+		case (fnd::elf::SHN_HIOS):
 			str = "HIOS";
 			break;
-		case (nn::hac::elf::SHN_ABS):
+		case (fnd::elf::SHN_ABS):
 			str = "ABS";
 			break;
-		case (nn::hac::elf::SHN_COMMON):
+		case (fnd::elf::SHN_COMMON):
 			str = "COMMON";
 			break;
 		default:
@@ -207,36 +210,36 @@ const char* RoMetadataProcess::getSectionIndexStr(nn::hac::elf::SpecialSectionIn
 	return str;
 }
 
-const char* RoMetadataProcess::getSymbolTypeStr(nn::hac::elf::SymbolType symbol_type) const
+const char* RoMetadataProcess::getSymbolTypeStr(byte_t symbol_type) const
 {
 	const char* str;
 	switch (symbol_type)
 	{
-		case (nn::hac::elf::STT_NOTYPE):
+		case (fnd::elf::STT_NOTYPE):
 			str = "NOTYPE";
 			break;
-		case (nn::hac::elf::STT_OBJECT):
+		case (fnd::elf::STT_OBJECT):
 			str = "OBJECT";
 			break;
-		case (nn::hac::elf::STT_FUNC):
+		case (fnd::elf::STT_FUNC):
 			str = "FUNC";
 			break;
-		case (nn::hac::elf::STT_SECTION):
+		case (fnd::elf::STT_SECTION):
 			str = "SECTION";
 			break;
-		case (nn::hac::elf::STT_FILE):
+		case (fnd::elf::STT_FILE):
 			str = "FILE";
 			break;
-		case (nn::hac::elf::STT_LOOS):
+		case (fnd::elf::STT_LOOS):
 			str = "LOOS";
 			break;
-		case (nn::hac::elf::STT_HIOS):
+		case (fnd::elf::STT_HIOS):
 			str = "HIOS";
 			break;
-		case (nn::hac::elf::STT_LOPROC):
+		case (fnd::elf::STT_LOPROC):
 			str = "LOPROC";
 			break;
-		case (nn::hac::elf::STT_HIPROC):
+		case (fnd::elf::STT_HIPROC):
 			str = "HIPROC";
 			break;
 		default:
@@ -246,30 +249,30 @@ const char* RoMetadataProcess::getSymbolTypeStr(nn::hac::elf::SymbolType symbol_
 	return str;
 }
 
-const char* RoMetadataProcess::getSymbolBindingStr(nn::hac::elf::SymbolBinding symbol_binding) const
+const char* RoMetadataProcess::getSymbolBindingStr(byte_t symbol_binding) const
 {
 	const char* str;
 	switch (symbol_binding)
 	{
-		case (nn::hac::elf::STB_LOCAL):
+		case (fnd::elf::STB_LOCAL):
 			str = "LOCAL";
 			break;
-		case (nn::hac::elf::STB_GLOBAL):
+		case (fnd::elf::STB_GLOBAL):
 			str = "GLOBAL";
 			break;
-		case (nn::hac::elf::STB_WEAK):
+		case (fnd::elf::STB_WEAK):
 			str = "WEAK";
 			break;
-		case (nn::hac::elf::STB_LOOS):
+		case (fnd::elf::STB_LOOS):
 			str = "LOOS";
 			break;
-		case (nn::hac::elf::STB_HIOS):
+		case (fnd::elf::STB_HIOS):
 			str = "HIOS";
 			break;
-		case (nn::hac::elf::STB_LOPROC):
+		case (fnd::elf::STB_LOPROC):
 			str = "LOPROC";
 			break;
-		case (nn::hac::elf::STB_HIPROC):
+		case (fnd::elf::STB_HIPROC):
 			str = "HIPROC";
 			break;
 		default:

programs/nstool/source/RoMetadataProcess.h

@@ -6,7 +6,7 @@
 
 #include <nn/hac/npdm.h>
 
-#include "nstool.h"
+#include "common.h"
 #include "SdkApiString.h"
 #include "ElfSymbolParser.h"
 
@@ -62,7 +62,7 @@ private:
 	void importApiList();
 	void displayRoMetaData();
 
-	const char* getSectionIndexStr(nn::hac::elf::SpecialSectionIndex shn_index) const;
+	const char* getSectionIndexStr(uint16_t shn_index) const;
-	const char* getSymbolTypeStr(nn::hac::elf::SymbolType symbol_type) const;
+	const char* getSymbolTypeStr(byte_t symbol_type) const;
-	const char* getSymbolBindingStr(nn::hac::elf::SymbolBinding symbol_binding) const;
+	const char* getSymbolBindingStr(byte_t symbol_binding) const;
 };

programs/nstool/source/RomfsProcess.cpp

@@ -1,11 +1,12 @@
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleTextOutput.h>
 #include <fnd/SimpleFile.h>
 #include <fnd/io.h>
 #include "RomfsProcess.h"
 
 RomfsProcess::RomfsProcess() :
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false),
 	mExtractPath(),
@@ -20,36 +21,24 @@ RomfsProcess::RomfsProcess() :
 	mRootDir.file_list.clear();
 }
 
-RomfsProcess::~RomfsProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void RomfsProcess::process()
 {
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-
 	resolveRomfs();	
+
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
 	{
 		displayHeader();
 		if (mListFs || _HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 			displayFs();
 	}
+
 	if (mExtract)
 		extractFs();	
 }
 
-void RomfsProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void RomfsProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
 void RomfsProcess::setCliOutputMode(CliOutputMode type)
@@ -87,19 +76,19 @@ void RomfsProcess::printTab(size_t tab) const
 {
 	for (size_t i = 0; i < tab; i++)
 	{
-		printf("  ");
+		std::cout << "  ";
 	}
 }
 
 void RomfsProcess::displayFile(const sFile& file, size_t tab) const
 {
 	printTab(tab);
-	printf("%s", file.name.c_str());
+	std::cout << file.name;
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_LAYOUT))
 	{
-		printf(" (offset=0x%" PRIx64 ", size=0x%" PRIx64 ")", file.offset, file.size);
+		std::cout << std::hex << " (offset=0x" << file.offset << ", size=0x" << file.size << ")";
 	}
-	putchar('\n');
+	std::cout << std::endl;
 }
 
 void RomfsProcess::displayDir(const sDirectory& dir, size_t tab) const
@@ -107,7 +96,7 @@ void RomfsProcess::displayDir(const sDirectory& dir, size_t tab) const
 	if (dir.name.empty() == false)
 	{
 		printTab(tab);
-		printf("%s\n", dir.name.c_str());
+		std::cout << dir.name << std::endl;
 	}
 
 	for (size_t i = 0; i < dir.dir_list.size(); i++)
@@ -122,11 +111,16 @@ void RomfsProcess::displayDir(const sDirectory& dir, size_t tab) const
 
 void RomfsProcess::displayHeader()
 {
-	printf("[RomFS]\n");
+	std::cout << "[RomFS]" << std::endl;
-	printf("  DirNum:      %" PRId64 "\n", (uint64_t)mDirNum);
+	std::cout << "  DirNum:     " << std::dec << mDirNum << std::endl;
-	printf("  FileNum:     %" PRId64 "\n", (uint64_t)mFileNum);
+	std::cout << "  FileNum:    " << std::dec << mFileNum << std::endl;
 	if (mMountName.empty() == false)
-		printf("  MountPoint:  %s%s\n", mMountName.c_str(), mMountName.at(mMountName.length()-1) != '/' ? "/" : "");
+	{
+		std::cout << "  MountPoint:  " << mMountName;
+		if (mMountName.at(mMountName.length()-1) != '/')
+			std::cout << "/";
+		std::cout << std::endl;
+	}
 }
 
 void RomfsProcess::displayFs()
@@ -156,13 +150,13 @@ void RomfsProcess::extractDir(const std::string& path, const sDirectory& dir)
 		fnd::io::appendToPath(file_path, dir.file_list[i].name);
 
 		if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
-			printf("extract=[%s]\n", file_path.c_str());	
+			std::cout << "extract=[" << file_path << "]" << std::endl;	
 		
 		outFile.open(file_path, outFile.Create);
-		mFile->seek(dir.file_list[i].offset);
+		(*mFile)->seek(dir.file_list[i].offset);
 		for (size_t j = 0; j < ((dir.file_list[i].size / kCacheSize) + ((dir.file_list[i].size % kCacheSize) != 0)); j++)
 		{
-			mFile->read(mCache.data(), _MIN(dir.file_list[i].size - (kCacheSize * j),kCacheSize));
+			(*mFile)->read(mCache.data(), _MIN(dir.file_list[i].size - (kCacheSize * j),kCacheSize));
 			outFile.write(mCache.data(), _MIN(dir.file_list[i].size - (kCacheSize * j),kCacheSize));
 		}	
 		outFile.close();
@@ -254,8 +248,13 @@ void RomfsProcess::importDirectory(uint32_t dir_offset, sDirectory& dir)
 
 void RomfsProcess::resolveRomfs()
 {
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+
 	// read header
-	mFile->read((byte_t*)&mHdr, 0, sizeof(nn::hac::sRomfsHeader));
+	(*mFile)->read((byte_t*)&mHdr, 0, sizeof(nn::hac::sRomfsHeader));
 
 	// logic check on the header layout
 	if (validateHeaderLayout(&mHdr) == false)
@@ -265,13 +264,13 @@ void RomfsProcess::resolveRomfs()
 
 	// read directory nodes
 	mDirNodes.alloc(mHdr.sections[nn::hac::romfs::DIR_NODE_TABLE].size.get());
-	mFile->read(mDirNodes.data(), mHdr.sections[nn::hac::romfs::DIR_NODE_TABLE].offset.get(), mDirNodes.size());
+	(*mFile)->read(mDirNodes.data(), mHdr.sections[nn::hac::romfs::DIR_NODE_TABLE].offset.get(), mDirNodes.size());
 	//printf("[RAW DIR NODES]\n");
 	//fnd::SimpleTextOutput::hxdStyleDump(mDirNodes.data(), mDirNodes.size());
 
 	// read file nodes
 	mFileNodes.alloc(mHdr.sections[nn::hac::romfs::FILE_NODE_TABLE].size.get());
-	mFile->read(mFileNodes.data(), mHdr.sections[nn::hac::romfs::FILE_NODE_TABLE].offset.get(), mFileNodes.size());
+	(*mFile)->read(mFileNodes.data(), mHdr.sections[nn::hac::romfs::FILE_NODE_TABLE].offset.get(), mFileNodes.size());
 	//printf("[RAW FILE NODES]\n");
 	//fnd::SimpleTextOutput::hxdStyleDump(mFileNodes.data(), mFileNodes.size());
 	

programs/nstool/source/RomfsProcess.h

@@ -2,11 +2,12 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <fnd/Vec.h>
 #include <fnd/List.h>
 #include <nn/hac/romfs.h>
 
-#include "nstool.h"
+#include "common.h"
 
 class RomfsProcess
 {
@@ -77,12 +78,11 @@ public:
 	};
 
 	RomfsProcess();
-	~RomfsProcess();
 
 	void process();
 
 	// generic
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -96,8 +96,7 @@ private:
 	const std::string kModuleName = "RomfsProcess";
 	static const size_t kCacheSize = 0x10000;
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 

programs/nstool/source/UserSettings.cpp

@@ -1,10 +1,12 @@
 #include "UserSettings.h"
 #include "version.h"
 #include "PkiValidator.h"
+#include "KeyConfiguration.h"
 #include <vector>
 #include <string>
 #include <algorithm>
 #include <iostream>
+#include <iomanip>
 #include <cstdlib>
 #include <fnd/io.h>
 #include <fnd/SimpleFile.h>
@@ -37,14 +39,16 @@ void UserSettings::parseCmdArgs(const std::vector<std::string>& arg_list)
 	populateCmdArgs(arg_list, args);
 	populateKeyset(args);
 	populateUserSettings(args);
+	if (_HAS_BIT(mOutputMode, OUTPUT_KEY_DATA))
+		dumpKeyConfig();
 }
 
 void UserSettings::showHelp()
 {
-	printf("NSTool v%d.%d.%d (C) %s\n", VER_MAJOR, VER_MINOR, VER_PATCH, AUTHORS);
+	printf("%s v%d.%d.%d (C) %s\n", APP_NAME, VER_MAJOR, VER_MINOR, VER_PATCH, AUTHORS);
 	printf("Built: %s %s\n\n", __TIME__, __DATE__);
 	
-	printf("Usage: nstool [options... ] <file>\n");
+	printf("Usage: %s [options... ] <file>\n", BIN_NAME);
 	printf("\n  General Options:\n");
 	printf("      -d, --dev       Use devkit keyset.\n");
 	printf("      -k, --keyset    Specify keyset file.\n");
@@ -55,18 +59,18 @@ void UserSettings::showHelp()
 	printf("      --showlayout    Show layout metadata.\n");
 	printf("      -v, --verbose   Verbose output.\n");
 	printf("\n  XCI (GameCard Image)\n");
-	printf("    nstool [--listfs] [--update <dir> --logo <dir> --normal <dir> --secure <dir>] <.xci file>\n");
+	printf("    %s [--listfs] [--update <dir> --logo <dir> --normal <dir> --secure <dir>] <.xci file>\n", BIN_NAME);
 	printf("      --listfs        Print file system in embedded partitions.\n");
 	printf("      --update        Extract \"update\" partition to directory.\n");
 	printf("      --logo          Extract \"logo\" partition to directory.\n");
 	printf("      --normal        Extract \"normal\" partition to directory.\n");
 	printf("      --secure        Extract \"secure\" partition to directory.\n");
 	printf("\n  PFS0/HFS0 (PartitionFs), RomFs, NSP (Ninendo Submission Package)\n");
-	printf("    nstool [--listfs] [--fsdir <dir>] <file>\n");
+	printf("    %s [--listfs] [--fsdir <dir>] <file>\n", BIN_NAME);
 	printf("      --listfs        Print file system.\n");
 	printf("      --fsdir         Extract file system to directory.\n");
 	printf("\n  NCA (Nintendo Content Archive)\n");
-	printf("    nstool [--listfs] [--bodykey <key> --titlekey <key>] [--part0 <dir> ...] <.nca file>\n");
+	printf("    %s [--listfs] [--bodykey <key> --titlekey <key>] [--part0 <dir> ...] <.nca file>\n", BIN_NAME);
 	printf("      --listfs        Print file system in embedded partitions.\n");
 	printf("      --titlekey      Specify title key extracted from ticket.\n");
 	printf("      --bodykey       Specify body encryption key.\n");
@@ -77,12 +81,12 @@ void UserSettings::showHelp()
 	printf("      --part2         Extract \"partition 2\" to directory.\n");
 	printf("      --part3         Extract \"partition 3\" to directory.\n");
 	printf("\n  NSO (Nintendo Software Object), NRO (Nintendo Relocatable Object)\n");
-	printf("    nstool [--listapi --listsym] [--insttype <inst. type>] <file>\n");
+	printf("    %s [--listapi --listsym] [--insttype <inst. type>] <file>\n", BIN_NAME);
 	printf("      --listapi       Print SDK API List.\n");
 	printf("      --listsym       Print Code Symbols.\n");
 	printf("      --insttype      Specify instruction type [64bit|32bit] (64bit is assumed).\n");
 	printf("\n  ASET (Homebrew Asset Blob)\n");
-	printf("    nstool [--listfs] [--icon <file> --nacp <file> --fsdir <dir>] <file>\n");
+	printf("    %s [--listfs] [--icon <file> --nacp <file> --fsdir <dir>] <file>\n", BIN_NAME);
 	printf("      --listfs        Print filesystem in embedded RomFS partition.\n");
 	printf("      --icon          Extract icon partition to file.\n");
 	printf("      --nacp          Extract NACP partition to file.\n");
@@ -95,9 +99,9 @@ const std::string UserSettings::getInputPath() const
 	return mInputPath;
 }
 
-const sKeyset& UserSettings::getKeyset() const
+const KeyConfiguration& UserSettings::getKeyCfg() const
 {
-	return mKeyset;
+	return mKeyCfg;
 }
 
 FileType UserSettings::getFileType() const
@@ -385,36 +389,23 @@ void UserSettings::populateCmdArgs(const std::vector<std::string>& arg_list, sCm
 
 void UserSettings::populateKeyset(sCmdArgs& args)
 {
-	fnd::aes::sAes128Key zeros_aes_key;
-	fnd::aes::sAesXts128Key zeros_aes_xts_key;
-	memset((void*)&zeros_aes_key, 0, sizeof(fnd::aes::sAes128Key));
-	memset((void*)&zeros_aes_xts_key, 0, sizeof(fnd::aes::sAesXts128Key));
-	memset((void*)&mKeyset, 0, sizeof(sKeyset));
-
-	fnd::ResourceFileReader res;
 	if (args.keyset_path.isSet)
 	{
-		res.processFile(*args.keyset_path);
+		mKeyCfg.importHactoolGenericKeyfile(*args.keyset_path);
  	}
 	else
 	{
 		// open other resource files in $HOME/.switch/prod.keys (or $HOME/.switch/dev.keys if -d/--dev is set).
-		std::string home;
-		if (home.empty()) fnd::io::getEnvironVar(home, "HOME");
-		if (home.empty()) fnd::io::getEnvironVar(home, "USERPROFILE");
-		if (home.empty()) return;
-
-		const std::string kKeysetNameStr[2] = {"prod.keys", "dev.keys"};
-		const std::string kHomeSwitchDirStr = ".switch";
-		
 		std::string keyset_path;
-		fnd::io::appendToPath(keyset_path, home);
+		getSwitchPath(keyset_path);
-		fnd::io::appendToPath(keyset_path, kHomeSwitchDirStr);
+		if (keyset_path.empty())
-		fnd::io::appendToPath(keyset_path, kKeysetNameStr[args.devkit_keys.isSet ? *args.devkit_keys : 0]);
+			return;
+		
+		fnd::io::appendToPath(keyset_path, kGeneralKeyfileName[args.devkit_keys.isSet]);
 
 		try
 		{
-			res.processFile(keyset_path);
+			mKeyCfg.importHactoolGenericKeyfile(keyset_path);
 		}
 		catch (const fnd::Exception&)
 		{
@@ -423,131 +414,28 @@ void UserSettings::populateKeyset(sCmdArgs& args)
 		
 	}
 
-	// suffix
-	const std::string kKeyStr = "key";
-	const std::string kKekStr = "kek";
-	const std::string kSourceStr = "source";
-	const std::string kRsaKeySuffix[2] = {"sign_key_private", "sign_key_modulus"};
-	const std::string kKeyIndex[kMasterKeyNum] = {"00","01","02","03","04","05","06","07","08","09","0a","0b","0c","0d","0e","0f","10","11","12","13","14","15","16","17","18","19","1a","1b","1c","1d","1e","1f"};
-
-	// keyname bases
-	const std::string kMasterBase = "master";
-	const std::string kPackage1Base = "package1";
-	const std::string kPackage2Base = "package2";
-	const std::string kXciHeaderBase = "xci_header";
-	const std::string kNcaHeaderBase[2] = {"header", "nca_header"};
-	const std::string kKekGenSource = "aes_kek_generation";
-	const std::string kKeyGenSource = "aes_key_generation";
-	const std::string kAcidBase = "acid";
-	const std::string kPkiRootBase = "pki_root";
-	const std::string kTicketCommonKeyBase[2] = { "titlekek", "ticket_commonkey" };
-	const std::string kNcaBodyBase[2] = {"key_area_key", "nca_body_keak"};
-	const std::string kNcaBodyKeakIndexName[3] = {"application", "ocean", "system"};
 	
 
-	// sources
-	fnd::aes::sAes128Key master_key[kMasterKeyNum] = { zeros_aes_key };
-	fnd::aes::sAes128Key package2_key_source = zeros_aes_key;
-	fnd::aes::sAes128Key ticket_titlekek_source = zeros_aes_key;
-	fnd::aes::sAes128Key key_area_key_source[3] = { zeros_aes_key, zeros_aes_key, zeros_aes_key };
-	fnd::aes::sAes128Key aes_kek_generation_source = zeros_aes_key;
-	fnd::aes::sAes128Key aes_key_generation_source = zeros_aes_key;
-	fnd::aes::sAes128Key nca_header_kek_source = zeros_aes_key;
-	fnd::aes::sAesXts128Key nca_header_key_source = zeros_aes_xts_key;
-
-
-#define _CONCAT_2_STRINGS(str1, str2) ((str1) + "_" + (str2))
-#define _CONCAT_3_STRINGS(str1, str2, str3) ((str1) + "_"+ (str2) + "_" + (str3))
-
-	std::string key,val;
-
-#define _SAVE_KEYDATA(key_name, array, len) \
-	key = (key_name); \
-	val = res[key]; \
-	if (val.empty() == false) { \
-		decodeHexStringToBytes(key, val, (byte_t*)array, len); \
-	}
-	
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kPackage2Base, kKeyStr, kSourceStr), package2_key_source.key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kTicketCommonKeyBase[0], kSourceStr), ticket_titlekek_source.key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kTicketCommonKeyBase[1], kSourceStr), ticket_titlekek_source.key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[0], kNcaBodyKeakIndexName[0], kSourceStr), key_area_key_source[0].key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[0], kNcaBodyKeakIndexName[1], kSourceStr), key_area_key_source[1].key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[0], kNcaBodyKeakIndexName[2], kSourceStr), key_area_key_source[2].key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[1], kNcaBodyKeakIndexName[0], kSourceStr), key_area_key_source[0].key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[1], kNcaBodyKeakIndexName[1], kSourceStr), key_area_key_source[1].key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[1], kNcaBodyKeakIndexName[2], kSourceStr), key_area_key_source[2].key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kKekGenSource, kSourceStr), aes_kek_generation_source.key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kKeyGenSource, kSourceStr), aes_key_generation_source.key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaHeaderBase[0], kKekStr, kSourceStr), nca_header_kek_source.key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaHeaderBase[0], kKeyStr, kSourceStr), nca_header_key_source.key, 0x20);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaHeaderBase[1], kKekStr, kSourceStr), nca_header_kek_source.key, 0x10);
-	_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaHeaderBase[1], kKeyStr, kSourceStr), nca_header_key_source.key, 0x20);
-
-	// Store Key Variants/Derivatives
-	for (size_t i = 0; i < kMasterKeyNum; i++)
-	{
-		
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kMasterBase, kKeyStr, kKeyIndex[i]), master_key[i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kPackage1Base, kKeyStr, kKeyIndex[i]), mKeyset.package1_key[i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kPackage2Base, kKeyStr, kKeyIndex[i]), mKeyset.package2_key[i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kTicketCommonKeyBase[0], kKeyIndex[i]), mKeyset.ticket.titlekey_kek[i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_2_STRINGS(kTicketCommonKeyBase[1], kKeyIndex[i]), mKeyset.ticket.titlekey_kek[i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[0], kNcaBodyKeakIndexName[0], kKeyIndex[i]), mKeyset.nca.key_area_key[0][i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[0], kNcaBodyKeakIndexName[1], kKeyIndex[i]), mKeyset.nca.key_area_key[1][i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[0], kNcaBodyKeakIndexName[2], kKeyIndex[i]), mKeyset.nca.key_area_key[2][i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[1], kNcaBodyKeakIndexName[0], kKeyIndex[i]), mKeyset.nca.key_area_key[0][i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[1], kNcaBodyKeakIndexName[1], kKeyIndex[i]), mKeyset.nca.key_area_key[1][i].key, 0x10);
-		_SAVE_KEYDATA(_CONCAT_3_STRINGS(kNcaBodyBase[1], kNcaBodyKeakIndexName[2], kKeyIndex[i]), mKeyset.nca.key_area_key[2][i].key, 0x10);
-	}
-	
-	// store nca header key
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kNcaHeaderBase[0], kKeyStr), mKeyset.nca.header_key.key[0], 0x20);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kNcaHeaderBase[1], kKeyStr), mKeyset.nca.header_key.key[0], 0x20);
-
-	// store xci header key
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kXciHeaderBase, kKeyStr), mKeyset.xci.header_key.key, 0x10);
-
-	// store rsa keys
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kNcaHeaderBase[1], kRsaKeySuffix[0]), mKeyset.nca.header_sign_key.priv_exponent, fnd::rsa::kRsa2048Size);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kNcaHeaderBase[1], kRsaKeySuffix[1]), mKeyset.nca.header_sign_key.modulus, fnd::rsa::kRsa2048Size);
-	
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kXciHeaderBase, kRsaKeySuffix[0]), mKeyset.xci.header_sign_key.priv_exponent, fnd::rsa::kRsa2048Size);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kXciHeaderBase, kRsaKeySuffix[1]), mKeyset.xci.header_sign_key.modulus, fnd::rsa::kRsa2048Size);
-
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kAcidBase, kRsaKeySuffix[0]), mKeyset.acid_sign_key.priv_exponent, fnd::rsa::kRsa2048Size);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kAcidBase, kRsaKeySuffix[1]), mKeyset.acid_sign_key.modulus, fnd::rsa::kRsa2048Size);
-
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPackage2Base, kRsaKeySuffix[0]), mKeyset.package2_sign_key.priv_exponent, fnd::rsa::kRsa2048Size);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPackage2Base, kRsaKeySuffix[1]), mKeyset.package2_sign_key.modulus, fnd::rsa::kRsa2048Size);
-
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPkiRootBase, kRsaKeySuffix[0]), mKeyset.pki.root_sign_key.priv_exponent, fnd::rsa::kRsa4096Size);
-	_SAVE_KEYDATA(_CONCAT_2_STRINGS(kPkiRootBase, kRsaKeySuffix[1]), mKeyset.pki.root_sign_key.modulus, fnd::rsa::kRsa4096Size);
-
-
-	// save keydata from input args
 	if (args.nca_bodykey.isSet)
 	{
-		if (args.nca_bodykey.var.length() == (sizeof(fnd::aes::sAes128Key)*2))
+		fnd::aes::sAes128Key tmp_key;
-		{
+		fnd::Vec<byte_t> tmp_raw;
-			decodeHexStringToBytes("--bodykey", args.nca_bodykey.var, mKeyset.nca.manual_body_key_aesctr.key, sizeof(fnd::aes::sAes128Key));
+		fnd::SimpleTextOutput::stringToArray(args.nca_bodykey.var, tmp_raw);
-		}
+		if (tmp_raw.size() != sizeof(fnd::aes::sAes128Key))
-		else
+			throw fnd::Exception(kModuleName, "Key: \"--bodykey\" has incorrect length");
-		{
+		memcpy(tmp_key.key, tmp_raw.data(), 16);
-			decodeHexStringToBytes("--bodykey", args.nca_bodykey.var, mKeyset.nca.manual_body_key_aesxts.key[0], sizeof(fnd::aes::sAesXts128Key));
+		mKeyCfg.addNcaExternalContentKey(kDummyRightsIdForUserBodyKey, tmp_key);
-		}
 	}
 
 	if (args.nca_titlekey.isSet)
 	{
-		if (args.nca_titlekey.var.length() == (sizeof(fnd::aes::sAes128Key)*2))
+		fnd::aes::sAes128Key tmp_key;
-		{
+		fnd::Vec<byte_t> tmp_raw;
-			decodeHexStringToBytes("--titlekey", args.nca_titlekey.var, mKeyset.nca.manual_title_key_aesctr.key, sizeof(fnd::aes::sAes128Key));
+		fnd::SimpleTextOutput::stringToArray(args.nca_titlekey.var, tmp_raw);
-		}
+		if (tmp_raw.size() != sizeof(fnd::aes::sAes128Key))
-		else
+			throw fnd::Exception(kModuleName, "Key: \"--titlekey\" has incorrect length");
-		{
+		memcpy(tmp_key.key, tmp_raw.data(), 16);
-			decodeHexStringToBytes("--titlekey", args.nca_titlekey.var, mKeyset.nca.manual_title_key_aesxts.key[0], sizeof(fnd::aes::sAesXts128Key));
+		mKeyCfg.addNcaExternalContentKey(kDummyRightsIdForUserTitleKey, tmp_key);
-		}
 	}
 
 	// import certificate chain
@@ -601,7 +489,7 @@ void UserSettings::populateKeyset(sCmdArgs& args)
 
 			try 
 			{
-				pki_validator.setRootKey(mKeyset.pki.root_sign_key);
+				pki_validator.setKeyCfg(mKeyCfg);
 				pki_validator.addCertificates(mCertChain);
 				pki_validator.validateSignature(tik.getBody().getIssuer(), tik.getSignature().getSignType(), tik.getSignature().getSignature(), tik_hash);
 			}
@@ -615,75 +503,24 @@ void UserSettings::populateKeyset(sCmdArgs& args)
 		// extract title key
 		if (tik.getBody().getTitleKeyEncType() == nn::es::ticket::AES128_CBC)
 		{
-			memcpy(mKeyset.nca.manual_title_key_aesctr.key, tik.getBody().getEncTitleKey(), fnd::aes::kAes128KeySize);
+			fnd::aes::sAes128Key enc_title_key;
+			memcpy(enc_title_key.key, tik.getBody().getEncTitleKey(), 16);
+			fnd::aes::sAes128Key common_key, external_content_key;
+			if (mKeyCfg.getETicketCommonKey(nn::hac::NcaUtils::getMasterKeyRevisionFromKeyGeneration(tik.getBody().getCommonKeyId()), common_key) == true)
+			{
+				nn::hac::AesKeygen::generateKey(external_content_key.key, tik.getBody().getEncTitleKey(), common_key.key);
+				mKeyCfg.addNcaExternalContentKey(tik.getBody().getRightsId(), external_content_key);
+			}
+			else
+			{
+				std::cout << "[WARNING] Titlekey not imported from ticket because commonkey was not available" << std::endl;
+			}
 		}
 		else
 		{
 			std::cout << "[WARNING] Titlekey not imported from ticket because it is personalised" << std::endl;
 		}
 	}
-
-#undef _SAVE_KEYDATA
-#undef _CONCAT_3_STRINGS
-#undef _CONCAT_2_STRINGS
-	
-	// Derive keys 
-	for (size_t i = 0; i < kMasterKeyNum; i++)
-	{
-		if (master_key[i] != zeros_aes_key)
-		{
-			if (aes_kek_generation_source != zeros_aes_key && aes_key_generation_source != zeros_aes_key)
-			{
-				if (i == 0 && nca_header_kek_source != zeros_aes_key && nca_header_key_source != zeros_aes_xts_key)
-				{
-					if (mKeyset.nca.header_key == zeros_aes_xts_key)
-					{
-						fnd::aes::sAes128Key nca_header_kek;
-						nn::hac::AesKeygen::generateKey(nca_header_kek.key, aes_kek_generation_source.key, nca_header_kek_source.key, aes_key_generation_source.key, master_key[i].key);
-						nn::hac::AesKeygen::generateKey(mKeyset.nca.header_key.key[0], nca_header_key_source.key[0], nca_header_kek.key);
-						nn::hac::AesKeygen::generateKey(mKeyset.nca.header_key.key[1], nca_header_key_source.key[1], nca_header_kek.key);
-						//printf("nca header key[0] ");
-						//fnd::SimpleTextOutput::hexDump(mKeyset.nca.header_key.key[0], 0x10);
-						//printf("nca header key[1] ");
-						//fnd::SimpleTextOutput::hexDump(mKeyset.nca.header_key.key[1], 0x10);
-					}
-				}
-
-				for (size_t j = 0; j < nn::hac::nca::kKeyAreaEncryptionKeyNum; j++)
-				{
-					if (key_area_key_source[j] != zeros_aes_key && mKeyset.nca.key_area_key[j][i] == zeros_aes_key)
-					{
-						nn::hac::AesKeygen::generateKey(mKeyset.nca.key_area_key[j][i].key, aes_kek_generation_source.key, key_area_key_source[j].key, aes_key_generation_source.key, master_key[i].key);
-						//printf("nca keak %d/%02d ", j, i);
-						//fnd::SimpleTextOutput::hexDump(mKeyset.nca.key_area_key[j][i].key, 0x10);
-					}
-				}
-			}
-
-			if (ticket_titlekek_source != zeros_aes_key && mKeyset.ticket.titlekey_kek[i] == zeros_aes_key)
-			{
-				nn::hac::AesKeygen::generateKey(mKeyset.ticket.titlekey_kek[i].key, ticket_titlekek_source.key, master_key[i].key);
-				//printf("ticket titlekek %02d ", i);
-				//fnd::SimpleTextOutput::hexDump(mKeyset.ticket.titlekey_kek[i].key, 0x10);
-			}
-			if (package2_key_source != zeros_aes_key && mKeyset.package2_key[i] == zeros_aes_key)
-			{
-				nn::hac::AesKeygen::generateKey(mKeyset.package2_key[i].key, package2_key_source.key, master_key[i].key);
-				//printf("package2 key %02d ", i);
-				//fnd::SimpleTextOutput::hexDump(mKeyset.package2_key[i].key, 0x10);
-			}
-		}
-		/*
-		for (size_t j = 0; j < nn::hac::nca::kKeyAreaEncryptionKeyNum; j++)
-		{
-			if (mKeyset.nca.key_area_key[j][i] != zeros_aes_key)
-			{
-				printf("nca body keak %d/%02d ", j, i);
-				fnd::SimpleTextOutput::hexDump(mKeyset.nca.key_area_key[j][i].key, 0x10);
-			}
-		}
-		*/
-	}
 }
 
 void UserSettings::populateUserSettings(sCmdArgs& args)
@@ -747,21 +584,6 @@ void UserSettings::populateUserSettings(sCmdArgs& args)
 		throw fnd::Exception(kModuleName, "Unknown file type.");
 }
 
-
-void UserSettings::decodeHexStringToBytes(const std::string& name, const std::string& str, byte_t* out, size_t out_len)
-{
-	size_t size = str.size();
-	if ((size % 2) || ((size / 2) != out_len))
-	{
-		throw fnd::Exception(kModuleName, "Key: \"" + name + "\" has incorrect length");
-	}
-
-	for (size_t i = 0; i < out_len; i++)
-	{
-		out[i] = (charToByte(str[i * 2]) << 4) | charToByte(str[(i * 2) + 1]);
-	}
-}
-
 FileType UserSettings::getFileTypeFromString(const std::string& type_str)
 {
 	std::string str = type_str;
@@ -804,7 +626,7 @@ FileType UserSettings::getFileTypeFromString(const std::string& type_str)
 
 FileType UserSettings::determineFileTypeFromFile(const std::string& path)
 {
-	static const size_t kMaxReadSize = 0x4000;
+	static const size_t kMaxReadSize = 0x5000;
 	FileType file_type = FILE_INVALID;
 	fnd::SimpleFile file;
 	fnd::Vec<byte_t> scratch;
@@ -840,12 +662,6 @@ FileType UserSettings::determineFileTypeFromFile(const std::string& path)
 	// test nca
 	else if (determineValidNcaFromSample(scratch))
 		file_type = FILE_NCA;
-	// test cnmt
-	else if (determineValidCnmtFromSample(scratch))
-		file_type = FILE_CNMT;
-	// test nacp
-	else if (determineValidNacpFromSample(scratch))
-		file_type = FILE_NACP;
 	// test nso
 	else if (_ASSERT_SIZE(sizeof(nn::hac::sNsoHeader)) && _TYPE_PTR(nn::hac::sNsoHeader)->st_magic.get() == nn::hac::nso::kNsoStructMagic)
 		file_type = FILE_NSO;
@@ -861,6 +677,16 @@ FileType UserSettings::determineFileTypeFromFile(const std::string& path)
 	// test hb asset
 	else if (_ASSERT_SIZE(sizeof(nn::hac::sAssetHeader)) && _TYPE_PTR(nn::hac::sAssetHeader)->st_magic.get() == nn::hac::aset::kAssetStructMagic)
 		file_type = FILE_HB_ASSET;
+	
+	// do heuristics
+	// test cnmt
+	else if (determineValidCnmtFromSample(scratch))
+		file_type = FILE_CNMT;
+	// test nacp
+	else if (determineValidNacpFromSample(scratch))
+		file_type = FILE_NACP;
+
+
 	// else unrecognised
 	else
 		file_type = FILE_INVALID;
@@ -880,7 +706,9 @@ bool UserSettings::determineValidNcaFromSample(const fnd::Vec<byte_t>& sample) c
 	if (sample.size() < nn::hac::nca::kHeaderSize)
 		return false;
 
-	nn::hac::NcaUtils::decryptNcaHeader(sample.data(), nca_raw, mKeyset.nca.header_key);
+	fnd::aes::sAesXts128Key header_key;
+	mKeyCfg.getNcaHeaderKey(header_key);
+	nn::hac::NcaUtils::decryptNcaHeader(sample.data(), nca_raw, header_key);
 
 	if (nca_header->st_magic.get() != nn::hac::nca::kNca2StructMagic && nca_header->st_magic.get() != nn::hac::nca::kNca3StructMagic)
 		return false;
@@ -1019,3 +847,186 @@ nn::hac::npdm::InstructionType UserSettings::getInstructionTypeFromString(const
 
 	return type;
 }
+
+void UserSettings::getHomePath(std::string& path) const
+{
+	// open other resource files in $HOME/.switch/prod.keys (or $HOME/.switch/dev.keys if -d/--dev is set).
+	path.clear();
+	if (path.empty()) fnd::io::getEnvironVar(path, "HOME");
+	if (path.empty()) fnd::io::getEnvironVar(path, "USERPROFILE");
+	if (path.empty()) return;
+}
+
+void UserSettings::getSwitchPath(std::string& path) const
+{
+	std::string home;
+	home.clear();
+	getHomePath(home);
+	if (home.empty())
+		return;
+	
+	path.clear();
+	fnd::io::appendToPath(path, home);
+	fnd::io::appendToPath(path, kHomeSwitchDirStr);
+}
+
+void UserSettings::dumpKeyConfig() const
+{
+	fnd::aes::sAes128Key aes_key;
+		fnd::aes::sAesXts128Key aesxts_key;
+		fnd::rsa::sRsa2048Key rsa2048_key;
+		fnd::rsa::sRsa4096Key rsa4096_key;
+
+		const std::string kKeyIndex[kMasterKeyNum] = {"00","01","02","03","04","05","06","07","08","09","0a","0b","0c","0d","0e","0f","10","11","12","13","14","15","16","17","18","19","1a","1b","1c","1d","1e","1f"};
+
+
+		std::cout << "[KeyConfiguration]" << std::endl;
+		std::cout << "  NCA Keys:" << std::endl;
+		if (mKeyCfg.getNcaHeader0SignKey(rsa2048_key) == true)
+			dumpRsa2048Key(rsa2048_key, "Header Signature[0] Key", 2);
+		if (mKeyCfg.getNcaHeaderKey(aesxts_key) == true)
+			dumpAesXtsKey(aesxts_key, "Header Encryption Key", 2);
+		
+		for (size_t i = 0; i < kMasterKeyNum; i++)
+		{
+			if (mKeyCfg.getNcaKeyAreaEncryptionKey(i,0, aes_key) == true)
+				dumpAesKey(aes_key, "KeyAreaEncryptionKey-Application-" + kKeyIndex[i], 2);
+			if (mKeyCfg.getNcaKeyAreaEncryptionKey(i,1, aes_key) == true)
+				dumpAesKey(aes_key, "KeyAreaEncryptionKey-Ocean-" + kKeyIndex[i], 2);
+			if (mKeyCfg.getNcaKeyAreaEncryptionKey(i,2, aes_key) == true)
+				dumpAesKey(aes_key, "KeyAreaEncryptionKey-System-" + kKeyIndex[i], 2);
+		}
+
+		for (size_t i = 0; i < kMasterKeyNum; i++)
+		{
+			if (mKeyCfg.getNcaKeyAreaEncryptionKeyHw(i,0, aes_key) == true)
+				dumpAesKey(aes_key, "KeyAreaEncryptionKeyHw-Application-" + kKeyIndex[i], 2);
+			if (mKeyCfg.getNcaKeyAreaEncryptionKeyHw(i,1, aes_key) == true)
+				dumpAesKey(aes_key, "KeyAreaEncryptionKeyHw-Ocean-" + kKeyIndex[i], 2);
+			if (mKeyCfg.getNcaKeyAreaEncryptionKeyHw(i,2, aes_key) == true)
+				dumpAesKey(aes_key, "KeyAreaEncryptionKeyHw-System-" + kKeyIndex[i], 2);
+		}
+		
+		std::cout << "  XCI Keys:" << std::endl;
+		if (mKeyCfg.getXciHeaderSignKey(rsa2048_key) == true)
+			dumpRsa2048Key(rsa2048_key, "Header Signature Key", 2);
+		if (mKeyCfg.getXciHeaderKey(aes_key) == true)
+			dumpAesKey(aes_key, "Extended Header Encryption Key", 2);
+		
+		
+		if (mKeyCfg.getAcidSignKey(rsa2048_key) == true)
+			dumpRsa2048Key(rsa2048_key, "ACID Signer Key", 1);
+		
+		
+		std::cout << "  Package1 Keys:" << std::endl;
+		for (size_t i = 0; i < kMasterKeyNum; i++)
+		{
+			if (mKeyCfg.getPkg1Key(i, aes_key) == true)
+				dumpAesKey(aes_key, "EncryptionKey-" + kKeyIndex[i], 2);
+		}
+
+		std::cout << "  Package2 Keys:" << std::endl;
+		if (mKeyCfg.getPkg2SignKey(rsa2048_key) == true)
+			dumpRsa2048Key(rsa2048_key, "Signature Key", 2);
+		for (size_t i = 0; i < kMasterKeyNum; i++)
+		{
+			if (mKeyCfg.getPkg2Key(i, aes_key) == true)
+				dumpAesKey(aes_key, "EncryptionKey-" + kKeyIndex[i], 2);
+		}
+
+		std::cout << "  ETicket Keys:" << std::endl;
+		for (size_t i = 0; i < kMasterKeyNum; i++)
+		{
+			if (mKeyCfg.getETicketCommonKey(i, aes_key) == true)
+				dumpAesKey(aes_key, "CommonKey-" + kKeyIndex[i], 2);
+		}
+		
+		if (mKeyCfg.getPkiRootSignKey("Root", rsa4096_key) == true)
+			dumpRsa4096Key(rsa4096_key, "NNPKI Root Key", 1);
+}
+
+void UserSettings::dumpRsa2048Key(const fnd::rsa::sRsa2048Key& key, const std::string& name, size_t indent) const
+{
+	std::string indent_str;
+
+	indent_str.clear();
+	for (size_t i = 0; i < indent; i++)
+	{
+		indent_str += "  ";
+	}
+	
+	std::cout << indent_str << name << ":" << std::endl;
+	if (key.modulus[0] != 0x00 && key.modulus[1] != 0x00)
+	{
+		std::cout << indent_str << "  Modulus:" << std::endl;
+		for (size_t i = 0; i < 0x10; i++)
+		{
+			std::cout << indent_str << "    " << fnd::SimpleTextOutput::arrayToString(key.modulus + i * 0x10, 0x10, true, ":") << std::endl;
+		}
+	}
+	if (key.priv_exponent[0] != 0x00 && key.priv_exponent[1] != 0x00)
+	{
+		std::cout << indent_str << "  Private Exponent:" << std::endl;
+		for (size_t i = 0; i < 0x10; i++)
+		{
+			std::cout << indent_str << "    " << fnd::SimpleTextOutput::arrayToString(key.priv_exponent + i * 0x10, 0x10, true, ":") << std::endl;
+		}
+	}
+}
+
+void UserSettings::dumpRsa4096Key(const fnd::rsa::sRsa4096Key& key, const std::string& name, size_t indent) const
+{
+	std::string indent_str;
+
+	indent_str.clear();
+	for (size_t i = 0; i < indent; i++)
+	{
+		indent_str += "  ";
+	}
+	
+	std::cout << indent_str << name << ":" << std::endl;
+	if (key.modulus[0] != 0x00 && key.modulus[1] != 0x00)
+	{
+		std::cout << indent_str << "  Modulus:" << std::endl;
+		for (size_t i = 0; i < 0x20; i++)
+		{
+			std::cout << indent_str << "    " << fnd::SimpleTextOutput::arrayToString(key.modulus + i * 0x10, 0x10, true, ":") << std::endl;
+		}
+	}
+	if (key.priv_exponent[0] != 0x00 && key.priv_exponent[1] != 0x00)
+	{
+		std::cout << indent_str << "  Private Exponent:" << std::endl;
+		for (size_t i = 0; i < 0x20; i++)
+		{
+			std::cout << indent_str << "    " << fnd::SimpleTextOutput::arrayToString(key.priv_exponent + i * 0x10, 0x10, true, ":") << std::endl;
+		}
+	}
+}
+
+void UserSettings::dumpAesKey(const fnd::aes::sAes128Key& key, const std::string& name, size_t indent) const
+{
+	std::string indent_str;
+
+	indent_str.clear();
+	for (size_t i = 0; i < indent; i++)
+	{
+		indent_str += "  ";
+	}
+	
+	std::cout << indent_str << name << ":" << std::endl;
+	std::cout << indent_str << "  " << fnd::SimpleTextOutput::arrayToString(key.key, 0x10, true, ":") << std::endl;
+}
+
+void UserSettings::dumpAesXtsKey(const fnd::aes::sAesXts128Key& key, const std::string& name, size_t indent) const
+{
+	std::string indent_str;
+
+	indent_str.clear();
+	for (size_t i = 0; i < indent; i++)
+	{
+		indent_str += "  ";
+	}
+
+	std::cout << indent_str << name << ":" << std::endl;
+	std::cout << indent_str << "  " << fnd::SimpleTextOutput::arrayToString(key.key[0], 0x20, true, ":") << std::endl;
+}

programs/nstool/source/UserSettings.h

@@ -7,7 +7,8 @@
 #include <nn/pki/SignedData.h>
 #include <nn/pki/CertificateBody.h>
 #include <nn/hac/npdm.h>
-#include "nstool.h"
+#include "common.h"
+#include "KeyConfiguration.h"
 
 class UserSettings
 {
@@ -19,7 +20,7 @@ public:
 
 	// generic options
 	const std::string getInputPath() const;
-	const sKeyset& getKeyset() const;
+	const KeyConfiguration& getKeyCfg() const;
 	FileType getFileType() const;
 	bool isVerifyFile() const;
 	CliOutputMode getCliOutputMode() const;
@@ -47,6 +48,11 @@ public:
 private:
 	const std::string kModuleName = "UserSettings";
 
+	const std::string kHomeSwitchDirStr = ".switch";
+	const std::string kGeneralKeyfileName[2] = { "prod.keys", "dev.keys" };
+	const std::string kTitleKeyfileName = "title.keys";
+	
+	
 	struct sCmdArgs
 	{
 		sCmdArgs() {}
@@ -81,7 +87,7 @@ private:
 	
 	std::string mInputPath;
 	FileType mFileType;
-	sKeyset mKeyset;
+	KeyConfiguration mKeyCfg;
 	bool mVerifyFile;
 	CliOutputMode mOutputMode;
 
@@ -109,7 +115,6 @@ private:
 	void populateCmdArgs(const std::vector<std::string>& arg_list, sCmdArgs& cmd_args);
 	void populateKeyset(sCmdArgs& args);
 	void populateUserSettings(sCmdArgs& args);
-	void decodeHexStringToBytes(const std::string& name, const std::string& str, byte_t* out, size_t out_len);
 	FileType getFileTypeFromString(const std::string& type_str);
 	FileType determineFileTypeFromFile(const std::string& path);
 	bool determineValidNcaFromSample(const fnd::Vec<byte_t>& sample) const;
@@ -118,4 +123,12 @@ private:
 	bool determineValidEsCertFromSample(const fnd::Vec<byte_t>& sample) const;
 	bool determineValidEsTikFromSample(const fnd::Vec<byte_t>& sample) const;
 	nn::hac::npdm::InstructionType getInstructionTypeFromString(const std::string& type_str);
+	void getHomePath(std::string& path) const;
+	void getSwitchPath(std::string& path) const;
+
+	void dumpKeyConfig() const;
+	void dumpRsa2048Key(const fnd::rsa::sRsa2048Key& key, const std::string& name, size_t indent) const;
+	void dumpRsa4096Key(const fnd::rsa::sRsa4096Key& key, const std::string& name, size_t indent) const;
+	void dumpAesKey(const fnd::aes::sAes128Key& key, const std::string& name, size_t indent) const;
+	void dumpAesXtsKey(const fnd::aes::sAesXts128Key& key, const std::string& name, size_t indent) const;
 };

programs/nstool/source/XciProcess.cpp

@@ -1,12 +1,12 @@
+#include <iostream>
+#include <iomanip>
 #include <fnd/SimpleTextOutput.h>
 #include <nn/hac/XciUtils.h>
 #include "OffsetAdjustedIFile.h"
 #include "XciProcess.h"
 
 XciProcess::XciProcess() :
-	mFile(nullptr),
+	mFile(),
-	mOwnIFile(false),
-	mKeyset(nullptr),
 	mCliOutputMode(_BIT(OUTPUT_BASIC)),
 	mVerify(false),
 	mListFs(false),
@@ -15,38 +15,13 @@ XciProcess::XciProcess() :
 {
 }
 
-XciProcess::~XciProcess()
-{
-	if (mOwnIFile)
-	{
-		delete mFile;
-	}
-}
-
 void XciProcess::process()
 {
-	fnd::Vec<byte_t> scratch;
+	importHeader();
-
-	if (mFile == nullptr)
-	{
-		throw fnd::Exception(kModuleName, "No file reader set.");
-	}
-	
-	// read header page
-	mFile->read((byte_t*)&mHdrPage, 0, sizeof(nn::hac::sXciHeaderPage));
-
-	// allocate memory for and decrypt sXciHeader
-	scratch.alloc(sizeof(nn::hac::sXciHeader));
-	nn::hac::XciUtils::decryptXciHeader((const byte_t*)&mHdrPage.header, scratch.data(), mKeyset->xci.header_key.key);
 
 	// validate header signature
 	if (mVerify)
-	{
 		validateXciSignature();
-	}
-
-	// deserialise header
-	mHdr.fromBytes(scratch.data(), scratch.size());
 
 	// display header
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_BASIC))
@@ -59,15 +34,14 @@ void XciProcess::process()
 	processPartitionPfs();
 }
 
-void XciProcess::setInputFile(fnd::IFile* file, bool ownIFile)
+void XciProcess::setInputFile(const fnd::SharedPtr<fnd::IFile>& file)
 {
 	mFile = file;
-	mOwnIFile = ownIFile;
 }
 
-void XciProcess::setKeyset(const sKeyset* keyset)
+void XciProcess::setKeyCfg(const KeyConfiguration& keycfg)
 {
-	mKeyset = keyset;
+	mKeyCfg = keycfg;
 }
 
 void XciProcess::setCliOutputMode(CliOutputMode type)
@@ -90,93 +64,117 @@ void XciProcess::setListFs(bool list_fs)
 	mListFs = list_fs;
 }
 
+void XciProcess::importHeader()
+{
+	fnd::Vec<byte_t> scratch;
+
+	if (*mFile == nullptr)
+	{
+		throw fnd::Exception(kModuleName, "No file reader set.");
+	}
+	
+	// read header page
+	(*mFile)->read((byte_t*)&mHdrPage, 0, sizeof(nn::hac::sXciHeaderPage));
+
+	// allocate memory for and decrypt sXciHeader
+	scratch.alloc(sizeof(nn::hac::sXciHeader));
+
+	fnd::aes::sAes128Key header_key;
+	mKeyCfg.getXciHeaderKey(header_key);
+	nn::hac::XciUtils::decryptXciHeader((const byte_t*)&mHdrPage.header, scratch.data(), header_key.key);
+
+	// deserialise header
+	mHdr.fromBytes(scratch.data(), scratch.size());
+}
+
 void XciProcess::displayHeader()
 {
-	printf("[XCI Header]\n");
+	std::cout << "[XCI Header]" << std::endl;
-	printf("  CardHeaderVersion:      %d\n", mHdr.getCardHeaderVersion());
+	std::cout << "  CardHeaderVersion:      " << std::dec << (uint32_t)mHdr.getCardHeaderVersion() << std::endl;
-	printf("  RomSize:                %s", getRomSizeStr(mHdr.getRomSizeType()));
+	std::cout << "  RomSize:                " << getRomSizeStr(mHdr.getRomSizeType());
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
-		printf(" (0x%x)", mHdr.getRomSizeType());
+		std::cout << " (0x" << std::hex << (uint32_t)mHdr.getRomSizeType() << ")";
-	printf("\n");
+	std::cout << std::endl;
-	printf("  PackageId:              0x%" PRIx64 "\n", mHdr.getPackageId());
+	std::cout << "  PackageId:              0x" << std::hex << std::setw(16) << std::setfill('0') << mHdr.getPackageId() << std::endl;
-	printf("  Flags:                  0x%x\n", mHdr.getFlags());
+	std::cout << "  Flags:                  0x" << std::dec << (uint32_t)mHdr.getFlags() << std::endl;
 	if (mHdr.getFlags() != 0)
 	{
 		for (uint32_t i = 0; i < 8; i++)
 		{
 			if (_HAS_BIT(mHdr.getFlags(), i))
 			{
-				printf("    %s\n", getHeaderFlagStr(i));
+				std::cout << "    " << getHeaderFlagStr(i) << std::endl;
 			}
 		}
 	}
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 	{
-		printf("  InitialData:\n");
+		std::cout << "  InitialData:" << std::endl;
-		printf("    KekIndex:             %d\n", mHdr.getKekIndex());
+		std::cout << "    KekIndex:             " << std::dec << (uint32_t)mHdr.getKekIndex() << std::endl;
-		printf("    TitleKeyDecIndex:     %d\n", mHdr.getTitleKeyDecIndex());
+		std::cout << "    TitleKeyDecIndex:     " << std::dec << (uint32_t)mHdr.getTitleKeyDecIndex() << std::endl;
-		printf("    Hash:\n");
+		std::cout << "    Hash:" << std::endl;
-		fnd::SimpleTextOutput::hexDump(mHdr.getInitialDataHash().bytes, sizeof(mHdr.getInitialDataHash().bytes), 0x10, 6);
+		std::cout << "      " << fnd::SimpleTextOutput::arrayToString(mHdr.getInitialDataHash().bytes, 0x10, true, ":") << std::endl;
+		std::cout << "      " << fnd::SimpleTextOutput::arrayToString(mHdr.getInitialDataHash().bytes+0x10, 0x10, true, ":") << std::endl;
 	}
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 	{
-		printf("  Enc Header AES-IV:\n");
+		std::cout << "  Extended Header AesCbc IV:" << std::endl;
-		fnd::SimpleTextOutput::hexDump(mHdr.getAesCbcIv().iv, sizeof(mHdr.getAesCbcIv().iv), 0x10, 4);
+		std::cout << "    " << fnd::SimpleTextOutput::arrayToString(mHdr.getAesCbcIv().iv, sizeof(mHdr.getAesCbcIv().iv), true, ":") << std::endl;
 	}
-	printf("  SelSec:                 0x%x\n", mHdr.getSelSec());
+	std::cout << "  SelSec:                 0x" << std::hex << mHdr.getSelSec() << std::endl;
-	printf("  SelT1Key:               0x%x\n", mHdr.getSelT1Key());
+	std::cout << "  SelT1Key:               0x" << std::hex << mHdr.getSelT1Key() << std::endl;
-	printf("  SelKey:                 0x%x\n", mHdr.getSelKey());
+	std::cout << "  SelKey:                 0x" << std::hex << mHdr.getSelKey() << std::endl;
 	if (_HAS_BIT(mCliOutputMode, OUTPUT_LAYOUT))
 	{
-		printf("  RomAreaStartPage:       0x%0x", mHdr.getRomAreaStartPage());
+		std::cout << "  RomAreaStartPage:       0x" << std::hex << mHdr.getRomAreaStartPage();
 		if (mHdr.getRomAreaStartPage() != (uint32_t)(-1))
-			printf(" (0x%" PRIx64 ")", nn::hac::XciUtils::blockToAddr(mHdr.getRomAreaStartPage()));
+			std::cout << " (0x" << std::hex << nn::hac::XciUtils::blockToAddr(mHdr.getRomAreaStartPage()) << ")";
-		printf("\n");
+		std::cout << std::endl;
 
-		printf("  BackupAreaStartPage:    0x%0x", mHdr.getBackupAreaStartPage());
+		std::cout << "  BackupAreaStartPage:    0x" << std::hex << mHdr.getBackupAreaStartPage();
 		if (mHdr.getBackupAreaStartPage() != (uint32_t)(-1))
-			printf(" (0x%" PRIx64 ")", nn::hac::XciUtils::blockToAddr(mHdr.getBackupAreaStartPage()));
+			std::cout << " (0x" << std::hex << nn::hac::XciUtils::blockToAddr(mHdr.getBackupAreaStartPage()) << ")";
-		printf("\n");
+		std::cout << std::endl;
 
-		printf("  ValidDataEndPage:       0x%x", mHdr.getValidDataEndPage());
+		std::cout << "  ValidDataEndPage:       0x" << std::hex << mHdr.getValidDataEndPage();
 		if (mHdr.getValidDataEndPage() != (uint32_t)(-1))
-			printf(" (0x%" PRIx64 ")", nn::hac::XciUtils::blockToAddr(mHdr.getValidDataEndPage()));
+			std::cout << " (0x" << std::hex << nn::hac::XciUtils::blockToAddr(mHdr.getValidDataEndPage()) << ")";
-		printf("\n");
+		std::cout << std::endl;
 
-		printf("  LimArea:                0x%x", mHdr.getLimAreaPage());
+		std::cout << "  LimArea:                0x" << std::hex << mHdr.getLimAreaPage();
 		if (mHdr.getLimAreaPage() != (uint32_t)(-1))
-			printf(" (0x%" PRIx64 ")", nn::hac::XciUtils::blockToAddr(mHdr.getLimAreaPage()));
+			std::cout << " (0x" << std::hex << nn::hac::XciUtils::blockToAddr(mHdr.getLimAreaPage()) << ")";
-		printf("\n");
+		std::cout << std::endl;
 
-		printf("  PartitionFs Header:\n");
+		std::cout << "  PartitionFs Header:" << std::endl;
-		printf("    Offset:               0x%" PRIx64 "\n", mHdr.getPartitionFsAddress());
+		std::cout << "    Offset:               0x" << std::hex << mHdr.getPartitionFsAddress() << std::endl;
-		printf("    Size:                 0x%" PRIx64 "\n", mHdr.getPartitionFsSize());
+		std::cout << "    Size:                 0x" << std::hex << mHdr.getPartitionFsSize() << std::endl;
 		if (_HAS_BIT(mCliOutputMode, OUTPUT_EXTENDED))
 		{
-			printf("    Hash:\n");
+			std::cout << "    Hash:" << std::endl;
-			fnd::SimpleTextOutput::hexDump(mHdr.getPartitionFsHash().bytes, sizeof(mHdr.getPartitionFsHash().bytes), 0x10, 6);
+			std::cout << "      " << fnd::SimpleTextOutput::arrayToString(mHdr.getPartitionFsHash().bytes, 0x10, true, ":") << std::endl;
+			std::cout << "      " << fnd::SimpleTextOutput::arrayToString(mHdr.getPartitionFsHash().bytes+0x10, 0x10, true, ":") << std::endl;
 		}
 	}
 
 	
 	if (mHdr.getFwVerMinor() != 0)
 	{
-		printf("[XCI Extended Header]\n");
+		std::cout << "[XCI Extended Header]" << std::endl;
-		printf("  FwVersion:              v%d.%d\n", mHdr.getFwVerMajor(), mHdr.getFwVerMinor());
+		std::cout << "  FwVersion:              v" << std::dec << mHdr.getFwVerMajor() << "." << mHdr.getFwVerMinor() << std::endl;
-		printf("  AccCtrl1:               0x%x\n", mHdr.getAccCtrl1());
+		std::cout << "  AccCtrl1:               0x" << std::hex << mHdr.getAccCtrl1() << std::endl;
-		printf("    CardClockRate:        %s\n", getCardClockRate(mHdr.getAccCtrl1()));
+		std::cout << "    CardClockRate:        " << getCardClockRate(mHdr.getAccCtrl1()) << std::endl;
-		printf("  Wait1TimeRead:          0x%x\n", mHdr.getWait1TimeRead());
+		std::cout << "  Wait1TimeRead:          0x" << std::hex << mHdr.getWait1TimeRead() << std::endl;
-		printf("  Wait2TimeRead:          0x%x\n", mHdr.getWait2TimeRead());
+		std::cout << "  Wait2TimeRead:          0x" << std::hex << mHdr.getWait2TimeRead() << std::endl;
-		printf("  Wait1TimeWrite:         0x%x\n", mHdr.getWait1TimeWrite());
+		std::cout << "  Wait1TimeWrite:         0x" << std::hex << mHdr.getWait1TimeWrite() << std::endl;
-		printf("  Wait2TimeWrite:         0x%x\n", mHdr.getWait2TimeWrite());
+		std::cout << "  Wait2TimeWrite:         0x" << std::hex << mHdr.getWait2TimeWrite() << std::endl;
-		printf("  FwMode:                 0x%x\n", mHdr.getFwMode());
+		std::cout << "  FwMode:                 0x" << std::hex << mHdr.getFwMode() << std::endl;
-		printf("  Update Partition Info:\n");
+		std::cout << "  Update Partition Info:" << std::endl;
-#define _SPLIT_VER(ver) ( (ver>>26) & 0x3f), ( (ver>>20) & 0x3f), ( (ver>>16) & 0xf), (ver & 0xffff)
+#define _SPLIT_VER(ver) std::dec << ((ver>>26) & 0x3f) << "." << ((ver>>20) & 0x3f) << "." << ((ver>>16) & 0xf) << "." << (ver & 0xffff)
-		printf("    CUP Version:          v%" PRId32 " (%d.%d.%d.%d)\n", mHdr.getUppVersion(), _SPLIT_VER(mHdr.getUppVersion()));
+		std::cout << "    CUP Version:          v" << std::dec << mHdr.getUppVersion() << " (" << _SPLIT_VER(mHdr.getUppVersion()) << ")" << std::endl;
 #undef _SPLIT_VER
-		printf("    CUP TitleId:          %016" PRIx64 "\n", mHdr.getUppId());
+		std::cout << "    CUP TitleId:          0x" << std::hex << std::setw(16) << std::setfill('0') << mHdr.getUppId() << std::endl;
-		printf("    Partition Hash:       ");
+		std::cout << "    Partition Hash:       " << fnd::SimpleTextOutput::arrayToString(mHdr.getUppHash(), 8, true, ":") << std::endl;
-		fnd::SimpleTextOutput::hexDump(mHdr.getUppHash(), 8);
 	}
 }
 
@@ -185,18 +183,20 @@ bool XciProcess::validateRegionOfFile(size_t offset, size_t len, const byte_t* t
 	fnd::Vec<byte_t> scratch;
 	fnd::sha::sSha256Hash calc_hash;
 	scratch.alloc(len);
-	mFile->read(scratch.data(), offset, scratch.size());
+	(*mFile)->read(scratch.data(), offset, scratch.size());
 	fnd::sha::Sha256(scratch.data(), scratch.size(), calc_hash.bytes);
 	return calc_hash.compare(test_hash);
 }
 
 void XciProcess::validateXciSignature()
 {
+	fnd::rsa::sRsa2048Key header_sign_key;
 	fnd::sha::sSha256Hash calc_hash;
 	fnd::sha::Sha256((byte_t*)&mHdrPage.header, sizeof(nn::hac::sXciHeader), calc_hash.bytes);
-	if (fnd::rsa::pkcs::rsaVerify(mKeyset->xci.header_sign_key, fnd::sha::HASH_SHA256, calc_hash.bytes, mHdrPage.signature) != 0)
+	mKeyCfg.getXciHeaderSignKey(header_sign_key);
+	if (fnd::rsa::pkcs::rsaVerify(header_sign_key, fnd::sha::HASH_SHA256, calc_hash.bytes, mHdrPage.signature) != 0)
 	{
-		printf("[WARNING] XCI Header Signature: FAIL \n");
+		std::cout << "[WARNING] XCI Header Signature: FAIL" << std::endl;
 	}
 }
 
@@ -204,9 +204,9 @@ void XciProcess::processRootPfs()
 {
 	if (mVerify && validateRegionOfFile(mHdr.getPartitionFsAddress(), mHdr.getPartitionFsSize(), mHdr.getPartitionFsHash().bytes) == false)
 	{
-		printf("[WARNING] XCI Root HFS0: FAIL (bad hash)\n");
+		std::cout << "[WARNING] XCI Root HFS0: FAIL (bad hash)" << std::endl;
 	}
-	mRootPfs.setInputFile(new OffsetAdjustedIFile(mFile, SHARED_IFILE, mHdr.getPartitionFsAddress(), mHdr.getPartitionFsSize()), OWN_IFILE);
+	mRootPfs.setInputFile(new OffsetAdjustedIFile(mFile, mHdr.getPartitionFsAddress(), mHdr.getPartitionFsSize()));
 	mRootPfs.setListFs(mListFs);
 	mRootPfs.setVerifyMode(false);
 	mRootPfs.setCliOutputMode(mCliOutputMode);
@@ -222,11 +222,11 @@ void XciProcess::processPartitionPfs()
 		// this must be validated here because only the size of the root partiton header is known at verification time
 		if (mVerify && validateRegionOfFile(mHdr.getPartitionFsAddress() + rootPartitions[i].offset, rootPartitions[i].hash_protected_size, rootPartitions[i].hash.bytes) == false)
 		{
-			printf("[WARNING] XCI %s Partition HFS0: FAIL (bad hash)\n", rootPartitions[i].name.c_str());
+			std::cout << "[WARNING] XCI " << rootPartitions[i].name << " Partition HFS0: FAIL (bad hash)" << std::endl;
 		}
 
 		PfsProcess tmp;
-		tmp.setInputFile(new OffsetAdjustedIFile(mFile, SHARED_IFILE, mHdr.getPartitionFsAddress() + rootPartitions[i].offset, rootPartitions[i].size), OWN_IFILE);
+		tmp.setInputFile(new OffsetAdjustedIFile(mFile, mHdr.getPartitionFsAddress() + rootPartitions[i].offset, rootPartitions[i].size));
 		tmp.setListFs(mListFs);
 		tmp.setVerifyMode(mVerify);
 		tmp.setCliOutputMode(mCliOutputMode);
@@ -240,7 +240,8 @@ void XciProcess::processPartitionPfs()
 
 const char* XciProcess::getRomSizeStr(byte_t rom_size) const
 {
-	const char* str = "unknown";
+	const char* str = nullptr;
+
 	switch (rom_size)
 	{
 		case (nn::hac::xci::ROM_SIZE_1GB):
@@ -261,13 +262,18 @@ const char* XciProcess::getRomSizeStr(byte_t rom_size) const
 		case (nn::hac::xci::ROM_SIZE_32GB):
 			str = "32GB";
 			break;
+		default:
+			str = "Unknown";
+			break;
 	}
+
 	return str;
 }
 
 const char* XciProcess::getHeaderFlagStr(byte_t flag) const
 {
-	const char* str = "unknown";
+	const char* str = nullptr;
+	
 	switch (flag)
 	{
 		case (nn::hac::xci::FLAG_AUTOBOOT):
@@ -279,14 +285,19 @@ const char* XciProcess::getHeaderFlagStr(byte_t flag) const
 		case (nn::hac::xci::FLAG_REPAIR_TOOL):
 			str = "RepairTool";
 			break;
+		default:
+			str = "Unknown";
+			break;
 	}
+
 	return str;
 }
 
 
 const char* XciProcess::getCardClockRate(uint32_t acc_ctrl_1) const
 {
-	const char* str = "unknown";
+	const char* str = nullptr;
+
 	switch (acc_ctrl_1)
 	{
 		case (nn::hac::xci::CLOCK_RATE_25):
@@ -295,7 +306,10 @@ const char* XciProcess::getCardClockRate(uint32_t acc_ctrl_1) const
 		case (nn::hac::xci::CLOCK_RATE_50):
 			str = "50 MHz";
 			break;
-
+		default:
+			str = "Unknown";
+			break;
 	}
+
 	return str;
 }

programs/nstool/source/XciProcess.h

@@ -2,25 +2,24 @@
 #include <string>
 #include <fnd/types.h>
 #include <fnd/IFile.h>
+#include <fnd/SharedPtr.h>
 #include <fnd/List.h>
 #include <nn/hac/XciHeader.h>
-
+#include "KeyConfiguration.h"
-#include "nstool.h"
-
 #include "PfsProcess.h"
 
+#include "common.h"
 
 class XciProcess
 {
 public:
 	XciProcess();
-	~XciProcess();
 
 	void process();
 
 	// generic
-	void setInputFile(fnd::IFile* file, bool ownIFile);
+	void setInputFile(const fnd::SharedPtr<fnd::IFile>& file);
-	void setKeyset(const sKeyset* keyset);
+	void setKeyCfg(const KeyConfiguration& keycfg);
 	void setCliOutputMode(CliOutputMode type);
 	void setVerifyMode(bool verify);
 
@@ -32,9 +31,8 @@ private:
 	const std::string kModuleName = "XciProcess";
 	const std::string kXciMountPointName = "gamecard:/";
 
-	fnd::IFile* mFile;
+	fnd::SharedPtr<fnd::IFile> mFile;
-	bool mOwnIFile;
+	KeyConfiguration mKeyCfg;
-	const sKeyset* mKeyset;
 	CliOutputMode mCliOutputMode;
 	bool mVerify;
 
@@ -62,6 +60,7 @@ private:
 	PfsProcess mRootPfs;
 	fnd::List<sExtractInfo> mExtractInfo;
 
+	void importHeader();
 	void displayHeader();
 	bool validateRegionOfFile(size_t offset, size_t len, const byte_t* test_hash);
 	void validateXciSignature();

programs/nstool/source/common.h

@@ -0,0 +1,60 @@
+#pragma once
+#include <string>
+#include <fnd/types.h>
+#include <fnd/aes.h>
+#include <fnd/rsa.h>
+#include <nn/hac/nca.h>
+
+static const size_t kMasterKeyNum = 0x20;
+static const size_t kNcaKeakNum = nn::hac::nca::kKeyAreaEncryptionKeyNum;
+
+enum FileType
+{
+	FILE_XCI,
+	FILE_NSP,
+	FILE_PARTITIONFS,
+	FILE_ROMFS,
+	FILE_NCA,
+	FILE_NPDM,
+	FILE_CNMT,
+	FILE_NSO,
+	FILE_NRO,
+	FILE_NACP,
+	FILE_PKI_CERT,
+	FILE_ES_TIK,
+	FILE_HB_ASSET,
+	FILE_INVALID = -1,
+};
+
+enum CliOutputModeFlag
+{
+	OUTPUT_BASIC,
+	OUTPUT_LAYOUT,
+	OUTPUT_KEY_DATA,
+	OUTPUT_EXTENDED
+};
+
+typedef byte_t CliOutputMode;
+
+template <typename T>
+struct sOptional
+{
+	bool isSet;
+	T var;
+	inline sOptional() : isSet(false) {}
+	inline sOptional(const T& other) : isSet(true), var(other) {}
+	inline sOptional(const sOptional& other) : isSet(other.isSet), var(other.var) {}
+	inline const T& operator=(const T& other) { isSet = true; var = other; return var; }
+	inline const sOptional<T>& operator=(const sOptional<T>& other) 
+	{
+		isSet = other.isSet;
+		if (isSet) {
+			var = other.var;
+		}
+		return *this; 
+	}
+	inline T& operator*() { return var; }
+};
+
+const byte_t kDummyRightsIdForUserTitleKey[nn::hac::nca::kRightsIdLen] = {0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+const byte_t kDummyRightsIdForUserBodyKey[nn::hac::nca::kRightsIdLen] = {0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe};

programs/nstool/source/main.cpp

@@ -1,5 +1,6 @@
 #include <cstdio>
 #include <fnd/SimpleFile.h>
+#include <fnd/SharedPtr.h>
 #include <fnd/StringConv.h>
 #include "UserSettings.h"
 #include "XciProcess.h"
@@ -35,13 +36,15 @@ int main(int argc, char** argv)
 	try {
 		user_set.parseCmdArgs(args);
 
+		fnd::SharedPtr<fnd::IFile> inputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read));
+
 		if (user_set.getFileType() == FILE_XCI)
 		{	
 			XciProcess xci;
 
-			xci.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			xci.setInputFile(inputFile);
 			
-			xci.setKeyset(&user_set.getKeyset());
+			xci.setKeyCfg(user_set.getKeyCfg());
 			xci.setCliOutputMode(user_set.getCliOutputMode());
 			xci.setVerifyMode(user_set.isVerifyFile());
 
@@ -61,7 +64,7 @@ int main(int argc, char** argv)
 		{
 			PfsProcess pfs;
 
-			pfs.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			pfs.setInputFile(inputFile);
 			pfs.setCliOutputMode(user_set.getCliOutputMode());
 			pfs.setVerifyMode(user_set.isVerifyFile());
 
@@ -75,7 +78,7 @@ int main(int argc, char** argv)
 		{
 			RomfsProcess romfs;
 
-			romfs.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			romfs.setInputFile(inputFile);
 			romfs.setCliOutputMode(user_set.getCliOutputMode());
 			romfs.setVerifyMode(user_set.isVerifyFile());
 
@@ -89,8 +92,8 @@ int main(int argc, char** argv)
 		{
 			NcaProcess nca;
 
-			nca.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			nca.setInputFile(inputFile);
-			nca.setKeyset(&user_set.getKeyset());
+			nca.setKeyCfg(user_set.getKeyCfg());
 			nca.setCliOutputMode(user_set.getCliOutputMode());
 			nca.setVerifyMode(user_set.isVerifyFile());
 
@@ -111,8 +114,8 @@ int main(int argc, char** argv)
 		{
 			NpdmProcess npdm;
 
-			npdm.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			npdm.setInputFile(inputFile);
-			npdm.setKeyset(&user_set.getKeyset());
+			npdm.setKeyCfg(user_set.getKeyCfg());
 			npdm.setCliOutputMode(user_set.getCliOutputMode());
 			npdm.setVerifyMode(user_set.isVerifyFile());
 
@@ -122,7 +125,7 @@ int main(int argc, char** argv)
 		{
 			CnmtProcess cnmt;
 
-			cnmt.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			cnmt.setInputFile(inputFile);
 			cnmt.setCliOutputMode(user_set.getCliOutputMode());
 			cnmt.setVerifyMode(user_set.isVerifyFile());
 
@@ -132,7 +135,7 @@ int main(int argc, char** argv)
 		{
 			NsoProcess obj;
 
-			obj.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			obj.setInputFile(inputFile);
 			obj.setCliOutputMode(user_set.getCliOutputMode());
 			obj.setVerifyMode(user_set.isVerifyFile());
 			
@@ -146,7 +149,7 @@ int main(int argc, char** argv)
 		{
 			NroProcess obj;
 
-			obj.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			obj.setInputFile(inputFile);
 			obj.setCliOutputMode(user_set.getCliOutputMode());
 			obj.setVerifyMode(user_set.isVerifyFile());
 			
@@ -169,7 +172,7 @@ int main(int argc, char** argv)
 		{
 			NacpProcess nacp;
 
-			nacp.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			nacp.setInputFile(inputFile);
 			nacp.setCliOutputMode(user_set.getCliOutputMode());
 			nacp.setVerifyMode(user_set.isVerifyFile());
 
@@ -179,8 +182,8 @@ int main(int argc, char** argv)
 		{
 			PkiCertProcess cert;
 
-			cert.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			cert.setInputFile(inputFile);
-			cert.setKeyset(&user_set.getKeyset());
+			cert.setKeyCfg(user_set.getKeyCfg());
 			cert.setCliOutputMode(user_set.getCliOutputMode());
 			cert.setVerifyMode(user_set.isVerifyFile());
 
@@ -190,8 +193,8 @@ int main(int argc, char** argv)
 		{
 			EsTikProcess tik;
 
-			tik.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			tik.setInputFile(inputFile);
-			tik.setKeyset(&user_set.getKeyset());
+			tik.setKeyCfg(user_set.getKeyCfg());
 			tik.setCertificateChain(user_set.getCertificateChain());
 			tik.setCliOutputMode(user_set.getCliOutputMode());
 			tik.setVerifyMode(user_set.isVerifyFile());
@@ -202,7 +205,7 @@ int main(int argc, char** argv)
 		{
 			AssetProcess obj;
 
-			obj.setInputFile(new fnd::SimpleFile(user_set.getInputPath(), fnd::SimpleFile::Read), OWN_IFILE);
+			obj.setInputFile(inputFile);
 			obj.setCliOutputMode(user_set.getCliOutputMode());
 			obj.setVerifyMode(user_set.isVerifyFile());
 

programs/nstool/source/nstool.h

@@ -1,110 +0,0 @@
-#pragma once
-#pragma once
-#include <string>
-#include <fnd/types.h>
-#include <fnd/aes.h>
-#include <fnd/rsa.h>
-#include <nn/hac/nca.h>
-
-static const size_t kMasterKeyNum = 0x20;
-static const size_t kNcaKeakNum = nn::hac::nca::kKeyAreaEncryptionKeyNum;
-
-enum IFileOwnershipMode
-{
-	SHARED_IFILE = false,
-	OWN_IFILE = true
-};
-
-enum FileType
-{
-	FILE_XCI,
-	FILE_NSP,
-	FILE_PARTITIONFS,
-	FILE_ROMFS,
-	FILE_NCA,
-	FILE_NPDM,
-	FILE_CNMT,
-	FILE_NSO,
-	FILE_NRO,
-	FILE_NACP,
-	FILE_PKI_CERT,
-	FILE_ES_TIK,
-	FILE_HB_ASSET,
-	FILE_INVALID = -1,
-};
-
-enum CliOutputModeFlag
-{
-	OUTPUT_BASIC,
-	OUTPUT_LAYOUT,
-	OUTPUT_KEY_DATA,
-	OUTPUT_EXTENDED
-};
-
-typedef byte_t CliOutputMode;
-
-template <typename T>
-struct sOptional
-{
-	bool isSet;
-	T var;
-	inline sOptional() : isSet(false) {}
-	inline const T& operator=(const T& other) { isSet = true; var = other; return var; }
-	inline const sOptional<T>& operator=(const sOptional<T>& other) 
-	{
-		isSet = other.isSet;
-		if (isSet) {
-			var = other.var;
-		}
-		return *this; 
-	}
-	inline T& operator*() { return var; }
-};
-
-struct sKeyset
-{
-	fnd::rsa::sRsa2048Key acid_sign_key;
-	fnd::aes::sAes128Key package1_key[kMasterKeyNum];
-	fnd::rsa::sRsa2048Key package2_sign_key;
-	fnd::aes::sAes128Key package2_key[kMasterKeyNum];
-
-	struct sNcaData
-	{
-		fnd::rsa::sRsa2048Key header_sign_key;
-		fnd::aes::sAesXts128Key header_key;
-		fnd::aes::sAes128Key key_area_key[kNcaKeakNum][kMasterKeyNum];
-
-		fnd::aes::sAes128Key manual_title_key_aesctr;
-		fnd::aes::sAesXts128Key manual_title_key_aesxts;
-		fnd::aes::sAes128Key manual_body_key_aesctr;
-		fnd::aes::sAesXts128Key manual_body_key_aesxts;
-	} nca;
-
-	struct sXciData
-	{
-		fnd::rsa::sRsa2048Key header_sign_key;
-		fnd::aes::sAes128Key header_key;
-	} xci;
-
-	struct sTicketData
-	{
-		fnd::rsa::sRsa2048Key sign_key;
-		fnd::aes::sAes128Key titlekey_kek[kMasterKeyNum];
-	} ticket;
-
-	struct sPkiData
-	{
-		fnd::rsa::sRsa4096Key root_sign_key;
-	} pki;
-};
-
-inline byte_t charToByte(char chr)
-{
-	if (chr >= 'a' && chr <= 'f')
-		return (chr - 'a') + 0xa;
-	else if (chr >= 'A' && chr <= 'F')
-		return (chr - 'A') + 0xa; 
-	else if (chr >= '0' && chr <= '9')
-		return chr - '0';
-	return 0;
-}

programs/nstool/source/version.h

@@ -1,5 +1,7 @@
 #pragma once
+#define APP_NAME	"NSTool"
+#define BIN_NAME	"nstool"
 #define VER_MAJOR	1
 #define VER_MINOR	0
-#define VER_PATCH   0
+#define VER_PATCH   4
 #define AUTHORS		"jakcron"